Question

Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate...

Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75.

1. Calculate its pH

2. Calculate the change in pH if 0.135 g of solid NaOH is added to 180 mL of this solution.

3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.

Homework Answers

Answer #1

a) We will use Hendersen's equation here to calcualte pH of buffer

pH = pKa + log [Salt] / [acid]

pKa = 3.75

[Salt] = 0.2 M

[Acid] = 0.25 M

pH = 3.75 + log [0.2 / 0.25] = 3.65

b) If we will add NaOH to the buffer then the base will react with acid to form salt

The moles of salt formed = Moles of NaOH added = Moles of acid reacted

Moles of NaOH added = Mass / Molecular weight = 0.135/40 = 0.003375 moles

Moles of acid present initially = Molarity X volume (L) = 0.25 X 0.180 = 0.045

Moles of acid left = 0.045 - 0.003375 = 0.0416 moles

Moles of salt present = 0.2 X 0.180 = 0.036 moles

Moles of salt after addition of NaOH = 0.036 + 0.003375 = 0.0394 moles

New pH will be

pH = pKa + log[salt ] / [Acid] = 3.75 + log [0.0394/ 0.0416] = 3.73

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate...
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate its pH & Calculate the change in pH if 0.140 g of solid NaOH is added to 190 mL of this solution. b) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.30 M H3PO4 and 0.10 M NaH2PO4. pKa(H3PO4)=2.16. 1. Calculate...
Consider a buffer solution that contains 0.30 M H3PO4 and 0.10 M NaH2PO4. pKa(H3PO4)=2.16. 1. Calculate its pH 2. Calculate the change in pH if 0.150 g of solid NaOH is added to 200 mL of this solution. 3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate...
Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate its pH 2) Calculate the change in pH if 0.155 g of solid NaOH is added to 250 mL of this solution. 3) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
A buffer solution that is 0.10 M sodium acetate and 0.20 M acetic acid is prepared....
A buffer solution that is 0.10 M sodium acetate and 0.20 M acetic acid is prepared. Calculate the initial pH of this solution. The Ka for CH3COOH is 1.8 x 10-5 M. As usual, report pH to 2 decimal places. Calculate the pH when 21.1 mL of 0.014 M HCl is added to 100.0 mL of the above buffer.
Part A Consider a buffer solution that is 0.50 M in NH3 and 0.20 M in...
Part A Consider a buffer solution that is 0.50 M in NH3 and 0.20 M in NH4Cl. For ammonia, pKb=4.75.​ Calculate the pH of 1.0 L of the original buffer, upon addition of 0.190 mol of solid NaOH. Part B A 1.0-L buffer solution contains 0.100 mol HC2H3O2 and 0.100 mol NaC2H3O2. The value of Ka for HC2H3O2 is 1.8×10−5.​ Calculate the pH of the solution, upon addition of 0.030 mol of NaOH to the original buffer. (I will leave...
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274...
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274 moles of perchloric acid are added to 125 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume change does not change upon adding perchloric acid) pH = _______ PART B A buffer solution contains 0.328 M nitrous acid and 0.481 M sodium nitrite. If 0.0248 moles of hydrochloric acid are added to 125 mL of this...
1. A buffer that contains 0.37 M of an acid, HA and 0.48 M of its...
1. A buffer that contains 0.37 M of an acid, HA and 0.48 M of its conjugate base A-, has a pH of 3.76. What is the pH after 0.02 mol of NaOH are added to 0.71 L of the solution? 2. Calculate the pH during the titration of 30 mL of 0.25 M HNO3(aq) with 0.18 M NaOH after 18 mL of the base have been added.
Calculate the pH of the buffer solution (1.00 M HNO2 and 1.00 M NaNO2) after 0.20...
Calculate the pH of the buffer solution (1.00 M HNO2 and 1.00 M NaNO2) after 0.20 mol of NaOH is added to 1.00 L of buffer solution (Ka = 4.0 x 10^-4)
A 100 mL of buffer solution contains 0.100 M in NH3 (aq) and 0.100 M in...
A 100 mL of buffer solution contains 0.100 M in NH3 (aq) and 0.100 M in NH4Cl. (Q7 ‒ Q9) 7. Calculate pH of the buffer solution. 8. Calculate the change of pH when 4.00 mL of 0.100 M HCl (aq) is added to the buffer solution. 9. Calculate the pH of the solution when 4.00 mL of 0.100 M NaOH is added to the original buffer solution. Please show steps and explain so I can understand how. thank you
a 100 mL buffer solution containing 0.25 M CH3COOH and 0.15 M CH3COONa is placed into...
a 100 mL buffer solution containing 0.25 M CH3COOH and 0.15 M CH3COONa is placed into a volumetric flask and diluted to 250 mL with water. a) Calculate the pH of the initial solution (when the volume was 100 mL) b) Calculate the pH of the final solution, after dilution (when the volume is 250 mL) What can you conclude?
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT