Question

Consider a buffer solution that contains 0.30 M H3PO4 and 0.10 M NaH2PO4. pKa(H3PO4)=2.16. 1. Calculate...

Consider a buffer solution that contains 0.30 M H3PO4 and 0.10 M NaH2PO4. pKa(H3PO4)=2.16.

1. Calculate its pH

2. Calculate the change in pH if 0.150 g of solid NaOH is added to 200 mL of this solution.

3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

1)

concnetration of acid = 0.30 M

concentration of salt = 0.10 M

pH = pKa + log [salt / acid]

     = 2.16 + log [0.1 / 0.30]

pH = 1.68

2)

moles of NaOH = 0.150 / 40 = 0.00375

moles of acid = 0.06

moles of salt = 0.02

pH = pKa + log [salt + C / acid - C]

     = 2.16 + log [0.02 + 0.00375 / 0.06 - 0.00375]

pH = 1.79

3)

pH = 1.68 - 0.10 = 1.58

1.58 = 2.16 + log [25- x / 75 + x]

[25 - x / 75 + x] = 0.263

25 - x = 19.72 - 0.263 x

x = 7.155

moles of H3O+ = 7.16 x 10^-3 mol

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate...
Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate its pH 2) Calculate the change in pH if 0.155 g of solid NaOH is added to 250 mL of this solution. 3) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate...
Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate its pH 2. Calculate the change in pH if 0.135 g of solid NaOH is added to 180 mL of this solution. 3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate...
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate its pH & Calculate the change in pH if 0.140 g of solid NaOH is added to 190 mL of this solution. b) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
1) Calculate the pH of a 100 ml solution containing 0.6 grams of NaH2PO4 and 0.142...
1) Calculate the pH of a 100 ml solution containing 0.6 grams of NaH2PO4 and 0.142 grams of Na2HPO4 The pKa of NaH2PO4 = 7.2 Mol. Wt. of NaH2PO4 = 120 Mol. Wt. Of Na2HPO4 = 142 2) Calculate the pH of a solution obtained when 1.0 ml of 0.1 M HCL is added to 99.0 ml pure water. 3) Calculate the pH of the solution obtained by adding 1.0 ml of 0.1 M HCl to 99 ml of buffer...
0.10 M Phospate buffer at pH 7.0 total 100.0 ml. 30mL of 0.20M NaH2PO4, 20 mL...
0.10 M Phospate buffer at pH 7.0 total 100.0 ml. 30mL of 0.20M NaH2PO4, 20 mL of 0.20M Na2HPO4 and 50.0 mL of water were used to prepare the buffer. The average pKa is 6.76 Using the average pKa value calculated in 3, calculate the pH of the pH 7.0 buffer solution that is expected after the addition of 1.0 mL of 1.0M HCl.
A buffer solution contains 0.233 M ammonium chloride and 0.321 M ammonia. If 0.0188 moles of...
A buffer solution contains 0.233 M ammonium chloride and 0.321 M ammonia. If 0.0188 moles of perchloric acid are added to 150 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding perchloric acid) pH = A buffer solution contains 0.338 M NaH2PO4 and 0.394 M Na2HPO4. If 0.0497 moles of perchloric acid are added to 225 mL of this buffer, what is the pH of the resulting...
A buffer solution contains 0.484 M NaH2PO4 and 0.211 M K2HPO4. Determine the pH change when...
A buffer solution contains 0.484 M NaH2PO4 and 0.211 M K2HPO4. Determine the pH change when 0.054 mol HCl is added to 1.00 L of the buffer. ph change=
Consider 2.50 L of a buffer solution made from NaOH and 3.50 M H3PO4 at pH...
Consider 2.50 L of a buffer solution made from NaOH and 3.50 M H3PO4 at pH 2.23 that has a total concentration of phosphate containing species of 0.188 M. How many mL of 2.00 M HCl must be added to the buffer solution to change its pH by 1.25 units?
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274...
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274 moles of perchloric acid are added to 125 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume change does not change upon adding perchloric acid) pH = _______ PART B A buffer solution contains 0.328 M nitrous acid and 0.481 M sodium nitrite. If 0.0248 moles of hydrochloric acid are added to 125 mL of this...
A 100 mL of buffer solution contains 0.100 M in NH3 (aq) and 0.100 M in...
A 100 mL of buffer solution contains 0.100 M in NH3 (aq) and 0.100 M in NH4Cl. (Q7 ‒ Q9) 7. Calculate pH of the buffer solution. 8. Calculate the change of pH when 4.00 mL of 0.100 M HCl (aq) is added to the buffer solution. 9. Calculate the pH of the solution when 4.00 mL of 0.100 M NaOH is added to the original buffer solution. Please show steps and explain so I can understand how. thank you
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT