Question

Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate...

Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88.

1) Calculate its pH

2) Calculate the change in pH if 0.155 g of solid NaOH is added to 250 mL of this solution.

3) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.

Homework Answers

Answer #1

Q1

this is a buffer so:

pH = pKa + log(base/acid)

pH = 9.88 + log(0.35/0.55)

pH = 9.6837

b)

mol of acid = MV = 0.35*0.25 = 0.0875

mol of conjguate = MV = = 0.55*0.25 = 0.1375

after adding base:

mol of base = MV = 0.155/40 = 0.003875

mol of acid = = 0.0875-0.003875 = 0.083625

mol of conjguate == 0.1375+0.003875 = 0.141375

pH = 9.88 + log(0.141375/0.083625)

pH = v

c)

if pH drop is 0.1

then

initial pH = 9.6837

pH drop max = pH = 9.6837-0.1 = 9.5837

pH = pKa + log(base/acid)

9.5837 = 9.88 + log((0.1375-x)/(0.0875+x))

10^(9.5837-9.88 ) = (0.1375-x)/(0.0875+x)

0.5054*(0.0875+x) = 0.1375-x

0.04422 + 0.5054x = 0.1375-x

(1+0.5054)x = 0.1375-0.04422

x = (0.1375-0.04422 )/(1+0.5054)

x = 0.06196 mol of acid

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Consider a buffer solution that contains 0.30 M H3PO4 and 0.10 M NaH2PO4. pKa(H3PO4)=2.16. 1. Calculate...
Consider a buffer solution that contains 0.30 M H3PO4 and 0.10 M NaH2PO4. pKa(H3PO4)=2.16. 1. Calculate its pH 2. Calculate the change in pH if 0.150 g of solid NaOH is added to 200 mL of this solution. 3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate...
Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate its pH 2. Calculate the change in pH if 0.135 g of solid NaOH is added to 180 mL of this solution. 3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate...
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate its pH & Calculate the change in pH if 0.140 g of solid NaOH is added to 190 mL of this solution. b) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274...
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274 moles of perchloric acid are added to 125 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume change does not change upon adding perchloric acid) pH = _______ PART B A buffer solution contains 0.328 M nitrous acid and 0.481 M sodium nitrite. If 0.0248 moles of hydrochloric acid are added to 125 mL of this...
A 100 mL of buffer solution contains 0.100 M in NH3 (aq) and 0.100 M in...
A 100 mL of buffer solution contains 0.100 M in NH3 (aq) and 0.100 M in NH4Cl. (Q7 ‒ Q9) 7. Calculate pH of the buffer solution. 8. Calculate the change of pH when 4.00 mL of 0.100 M HCl (aq) is added to the buffer solution. 9. Calculate the pH of the solution when 4.00 mL of 0.100 M NaOH is added to the original buffer solution. Please show steps and explain so I can understand how. thank you
A buffer solution contains 0.341 M nitrous acid and 0.303 M sodium nitrite. If 0.0573 moles...
A buffer solution contains 0.341 M nitrous acid and 0.303 M sodium nitrite. If 0.0573 moles of nitric acid are added to 250 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding nitric acid) pH =
A buffer solution contains 0.259 M ammonium bromide and 0.394 M ammonia. If 0.0385 moles of...
A buffer solution contains 0.259 M ammonium bromide and 0.394 M ammonia. If 0.0385 moles of hydrochloric acid are added to 250 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding hydrochloric acid)
A buffer solution contains 0.233 M ammonium chloride and 0.321 M ammonia. If 0.0188 moles of...
A buffer solution contains 0.233 M ammonium chloride and 0.321 M ammonia. If 0.0188 moles of perchloric acid are added to 150 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding perchloric acid) pH = A buffer solution contains 0.338 M NaH2PO4 and 0.394 M Na2HPO4. If 0.0497 moles of perchloric acid are added to 225 mL of this buffer, what is the pH of the resulting...
1.) If a buffer solution is 0.110 M in a weak base (Kb = 5.7 ×...
1.) If a buffer solution is 0.110 M in a weak base (Kb = 5.7 × 10-5) and 0.590 M in its conjugate acid, what is the pH? 2.) You need to prepare 100.0 mL of a pH=4.00 buffer solution using 0.100 M benzoic acid (pKa = 4.20) and 0.240 M sodium benzoate. How much of each solution should be mixed to prepare this buffer? 3.) Calculate the change in pH when 6.00 mL of 0.100 M HCl(aq) is added...
A 1.0 L buffer solution contains 0.192 MHC2H3O2 and 0.192 M NaC2H3O2. The value of Ka...
A 1.0 L buffer solution contains 0.192 MHC2H3O2 and 0.192 M NaC2H3O2. The value of Ka for HC2H3O2 is 1.8×10−5. Because the initial amounts of acid and conjugate base are equal, the pH of the buffer is equal to pKa=−log(1.8×10−5)=4.74. Calculate the new pH after adding 0.019 mol of solid NaOH to the buffer.