Question

If one dissolves 0.1 mole of Fe (NO3)3 (s) in 1 L of water, what is...

If one dissolves 0.1 mole of Fe (NO3)3 (s) in 1 L of water, what is the total ionic concentration?

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Fe (NO3)3 concentration = moles / volume

                                         = 0.1 / 1

                                         = 0.1 M

Fe (NO3)3 -----------------------> Fe+3 + 3 NO3-

total ions = 1 + 3 = 4

total ionis concentration = 4 x 0.1 = 0.4 M

total ionis concentration = 0.4 M

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)
Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
What the net ionic reaction for zn+mg(no3)2, fe +mg(no3)2, cu+mg(no3)2,Al+mg(no3)2, Fe+Zn(no3)2 , Cu+Zn(no3)2, Cu+Fe(no3)3
What the net ionic reaction for zn+mg(no3)2, fe +mg(no3)2, cu+mg(no3)2,Al+mg(no3)2, Fe+Zn(no3)2 , Cu+Zn(no3)2, Cu+Fe(no3)3
40.0 mL of 2.0 M Fe(NO3)3 is mixed with 2 mL of 5 M Fe(NO3) and...
40.0 mL of 2.0 M Fe(NO3)3 is mixed with 2 mL of 5 M Fe(NO3) and 48 mL of water. What is the final molar concentration of Fe(NO3)? Answer is 1M but how do we get this solution? Please help.
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
A 75 L solution of 0.63 M Fe(NO3)3 is mixed with 89 mL of 0.33 M...
A 75 L solution of 0.63 M Fe(NO3)3 is mixed with 89 mL of 0.33 M Ni(NO3)2. Ksp Fe(OH)3=1.63x10^-39 and Ksp Ni(OH)2 = 6x10^-16 (a) If solid KOH is added to the solution, what will precipitate first? Give the chemical formula. (b) If solid KOH is added to the solution, at what concentration of [OH-] will one begin to see the first sign of precipitate? (c) At what concentration of [OH-] will one begin to see the first sign of...
3. Consider the following redox reaction, 3 Fe(NO3)2 (aq) + 2 Al (s) → 3 Fe...
3. Consider the following redox reaction, 3 Fe(NO3)2 (aq) + 2 Al (s) → 3 Fe (s) + 2 Al(NO3)3 (aq) a) Identify the species getting oxidized and the species getting reduced. b) If 6.3 moles of Fe(NO3)2 reacts with 5.4 moles of Al, which reactant is the limiting reactant? and c) How many grams of Al(NO3)3 will be produced?
3. Determine the pH of a buffer that contains 0.5 mole HOCl and 0.5 mole NaOCl...
3. Determine the pH of a buffer that contains 0.5 mole HOCl and 0.5 mole NaOCl in a total volume of 1.0 L. The Ka of HOCl is 3.5 x 10^-8. 4. Write a net ionic Equation for what happens when NaOH is added into the solution in number 3. 5. Determine the pH when 0.1 mole NaOH is added to the solution in number 3. Assume the total volume does not change. 6. Determine the pH when 0.1 mole...
One millimole of Ni(NO3)2 dissolves in 210.0 mL of a solution that is .300 M in...
One millimole of Ni(NO3)2 dissolves in 210.0 mL of a solution that is .300 M in ammonia. a.) What is the initial concentration of Ni(NO3)2 in the solution? Answer: 4.76e-3 b.) What is the equilibrium concentration of Ni2+(aq) in the solution? I keep getting 1.19e-8, but that is not correct.
One millimole of Ni(NO3)2 dissolves in 270.0 mL of a solution that is 0.500 M in...
One millimole of Ni(NO3)2 dissolves in 270.0 mL of a solution that is 0.500 M in ammonia. The formation constant of Ni(NH3)62+ is 5.5×108 What is the initial concentration of Ni(NO3)2 in the solution? _____M What is the equilibrium concentration of Ni2+(aq ) in the solution? ______M
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT