Question

Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)

Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Write the net ionic equations for the reaction of CuSO4(aq) with 1. Zn(s) 2. Mg(s) 3....
Write the net ionic equations for the reaction of CuSO4(aq) with 1. Zn(s) 2. Mg(s) 3. Fe(s) indicate the oxidizing agent and reducing agent in each of the three reactions
Balance the following ionic reactions and write the net ionic equations: PLEASE TYPE THE ANSWER DO...
Balance the following ionic reactions and write the net ionic equations: PLEASE TYPE THE ANSWER DO NOT WRITE ON A PIECE OF PAPER 1) 3NH(OH)(aq) + H3PO4(aq) -----> (NH3)PO4(aq) +3H2O (I) 2) Na2O(aq) + Pb(NO3)2(aq) ----> 2NaNO3(aq) + PbO(s)
Write the net ionic equation (including phases) that corresponds to Fe(NO3)2(aq)+K2S(aq) right arrow FeS(s)+2KNO3(aq)
Write the net ionic equation (including phases) that corresponds to Fe(NO3)2(aq)+K2S(aq) right arrow FeS(s)+2KNO3(aq)
1. write the full and net ionic equations; Mg(No3)2 (ag) +Na2CO3(aq)----->MgCO3(s) +2NaNO3(aq) 2. H2SO4(aq) +2KOH(aq) ------->K2SO4(aq0...
1. write the full and net ionic equations; Mg(No3)2 (ag) +Na2CO3(aq)----->MgCO3(s) +2NaNO3(aq) 2. H2SO4(aq) +2KOH(aq) ------->K2SO4(aq0 + 2H2O(l) 3. MnCl2(aq) +(NH4)2CO3(aq)------>MnCO3(s) +2 NH4Cl(aq) 4. BaBr2(aq) +K2SO4(aq)-----> BaSO4(s) + 2KBr(aq)
write a balanced net ionic equation for the reactions, if any, that occur between (a) ZnS(s)...
write a balanced net ionic equation for the reactions, if any, that occur between (a) ZnS(s) and HCl(aq); (b) K2CO3(aq) and Ca(NO3)2(aq); (c) Fe(NO3)2(aq) and H2S(aq); (d) Bi(OH)3(s) and HNO3(aq). Please show me molecular to complete ionic to net ionic as I need to understand how to do this, not just the answers.
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
From the balanced molecular equations, write the complete ionic and net ionic equations for the following....
From the balanced molecular equations, write the complete ionic and net ionic equations for the following. (Use the lowest possible whole number coefficients. Include states-of-matter under the given conditions in your answer.) a)CaCO3(s) + H2SO4(aq) → CaSO4(s) + CO2(g) + H2O(l) *Need complete ionic and net ionic equations b)K2C2O4(aq) + Cd(OH)2(aq) → 2 KOH(aq) + CdC2O4(s) *Need complete ionic and net ionic equations c)Zn(NO3)2(aq) + H2SO4(aq) → ZnSO4(s) + 2 HNO3(aq) *Need complete ionic and net ionic equations
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
From the balanced molecular equations, write the complete ionic and net ionic equations for the following:...
From the balanced molecular equations, write the complete ionic and net ionic equations for the following: (a) K2C2 O4 (aq) + Ba(OH)2 (aq) ⟶ 2KOH(aq) + BaC2 O4 (s) (b) Pb(NO3 )2 (aq) + H2SO4 (aq) ⟶ PbSO4 (s) + 2HNO3 (aq) (c) CaCO3 (s) + H2SO4 (aq) ⟶ CaSO4 (s) + CO2 (g) + H2 O(l)
1) Write the ionic and net ionic equations for the balanced chemical reaction given. Ca(NO3)2(aq) +...
1) Write the ionic and net ionic equations for the balanced chemical reaction given. Ca(NO3)2(aq) + Na2CO3(aq) CaCO3(s) + 2 NaNO3(aq) 2) Give the products of the reaction between aqueous solutions of Na3PO4 and MgCl2. Na3PO4 + MgCl2  3) How much energy is needed to raise the temperature of 49.32 g of copper metal from 23.0oC to 137.0oC?
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT