Question

Stacy and Jaala are asking which of the following chemicals is a reactant of the reaction...

Stacy and Jaala are asking which of the following chemicals is a reactant of the reaction shown below?

CH4 + O2 => CO2 + H2O

CO2

None of the other answers is correct.

CH4
Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Reactants are the starting materials in a chemical reaction. Reactants undergo a chemical change in which chemical bonds are broken and new ones formed to make products. In a chemical equation, reactants are listed on the left side of the arrow, while products are on the right side. If a chemical reaction has an arrow that points both left and right, then substances on both sides of the arrow are reactants as well as products (the reaction proceeds in both directions simultaneously).

So here CH4 is the reactant.

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1. The Greek letter, Δ, is shown in the equation. What is the meaning of this...
1. The Greek letter, Δ, is shown in the equation. What is the meaning of this letter in the equation shown below? CH4 + O2 ->Δ CO2 + H2O The reactants sit in a triangle to form the products. None of the other answers is correct. Isotopes of hydrogen are needed to start the reaction. The reaction will not take place unless the chemist uses a carbon-based catalyst. Heat is needed to start the reaction. 2. Abigail and Peter are...
Which is the most exothermic reaction? A. CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(g)...
Which is the most exothermic reaction? A. CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(g) B. CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(l) C. CO2(g) + 2 H2O(l) → CH4(g) + 2 O2(g) D. CO2(g) + 2 H2O(g) → CH4(g) + 2 O2(g)
When methane (CH4) burns it combines with oxygen and forms carbon dioxide and water. Which of...
When methane (CH4) burns it combines with oxygen and forms carbon dioxide and water. Which of the following is the balanced chemical reaction for the burning of methane? CH4 + O2 → CO2 + H2O 3 CH4 + 6 O2 → 3 CO2 + 6 H2O 2 CH4 + 3 O2 → CO2 + 4 H2O CH4 + 3 O2 → 2 CO2 + 2 H2O CH4 + 2 O2 → CO2 + 2 H2O
Consider the balanced chemical reaction shown below. 2 C3H6(g) + 9 O2(g) 6 CO2(g) + 6...
Consider the balanced chemical reaction shown below. 2 C3H6(g) + 9 O2(g) 6 CO2(g) + 6 H2O(l) In a certain experiment, 6.004 g of C3H6(g) reacts with 2.118 g of O2(g). (a) Which is the limiting reactant? _____ is the limiting reactant. (b) How many grams of CO2(g) form? _____g of CO2(g) form. (c) How many grams of H2O(l) form? _____g of H2O(l) form. (d) How many grams of the excess reactant remains after the limiting reactant is completely consumed?_____...
In the following reaction, HCl is __________ ; and NaCl is ___________. NaOH + HCl à...
In the following reaction, HCl is __________ ; and NaCl is ___________. NaOH + HCl à NaCl + H2O        Catalyst; reactant        Product; reactant        reactant; catalyst        reactant; product ___________________ Which coefficient is placed in front of Potassiumto balance the following equation? K + H2SO4 ---> K2SO4 + H2   1, 2, 3, 4, or 5 _____________________________ Which coefficient is placed in front of O2 to balance the following equation? C6H12O6 + ? O2--> CO2 + H2O_       1...
1. Enthalpies and energies of reactions. Consider the combustion of methane, which involves the reaction of...
1. Enthalpies and energies of reactions. Consider the combustion of methane, which involves the reaction of 1 mol CH4(g) with 2 mol of O2(g) to form 1 mol CO2 (g) and 2 mol H2O (l): CH4(g) + 2 O2(g) → CO2(g)+ 2 H2O(l) (a) Using heats of formation from Table 2.6 in the text (or from the tables in the back of the book, or from webbook.nist.gov) calculate ∆Hr◦ for the reaction. (b) Calculate ∆Ur for the reaction by only...
The flame of the Bunsen burner is caused by the reaction of methane (CH4) and oxygen...
The flame of the Bunsen burner is caused by the reaction of methane (CH4) and oxygen according to the the following unbalanced equation CH4 + O2 → CO2 + H2O If 5.00 g of methane is burned, what mass of water can be produced? Assume the reaction goes to completion.
In a reversible reaction, when the rate of the forward reaction equals the rate of the...
In a reversible reaction, when the rate of the forward reaction equals the rate of the reverse reaction, the reaction is at ________. If Kc is the equilibrium constant for a forward reaction what is Kc' for the reverse reaction? Kc -Kc (Kc)-1 none of these Write the equilibrium constant expression for the following reaction in the forward direction: 2 CH4 (g) + 3 O2 (g) ⇋ 2 CO (g) + 4 H2O (g) Write the equilibrium constant expression for...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
The reaction between carbon monoxide and water is given below: CO(g) + H2O(l) --------> CO2(g) +...
The reaction between carbon monoxide and water is given below: CO(g) + H2O(l) --------> CO2(g) + H2(g) We therefore know that which of the following reactions can also occur? a)  PbCl2(s) ---------->   Pb(s) + Cl2(g) b) CH4(g) + H2O(g) ----------> CO(g) + 3 H2(g) c) CO(g) + 3 H2(g) ------------------> CH4(g) + H2O(g) d) None of the Above
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT