Question

Write the equilibrium constant expression for the following reaction in the reverse direction:
2 CH₄ (g) + 3 O₂ (g) ⇌ 2 CO (g) + 4 H₂O (g)

a. K′c=[CO]2[H2O]4[CH4]2[O2]3

b. K′c=[CH4]2[O2]3[CO]2[H2O]4

c. K′c=2[CO]+4[H2O]2[CH4]+3[O2]

d. K′c=2[CH4]+3[O2]2[CO]+4[H2O]

Write the equilibrium constant expression for the following reaction in the reverse direction:
2 CH₄(g) + 3 O₂(g) ⇌ 2 CO(g) + 4 H₂O(g)

a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O]

b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2]

c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3

d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4

What is the equilibrium equation for the following reaction?
C₂H₄ (g) + 3 O₂ (g) ⇌ 2 CO₂ (g) + 2 H₂O (l)

a. Kp=[PC2H4][PO2]3[PCO2]2[PH2O]2

b. Kp=[PCO2]2[PC2H4][PO2]3

c. Kp=[PCO2]2[PH2O]2[PC2H4][PO2]3

d. Kp=[PC2H4][PO2]3[PCO2]2

Answer 1

1)

Kc’ will have reactants on top and product at bottom

b and d matches this

Coefficient should become power

only b matches

b is correct option

Answer: b

2)

Kp’ will have reactants on top and product at bottom

a and d matches this

Coefficient should become power

only d matches

d is correct option

Answer: d

3)

Kp will have products on top and reactants at bottom

b and c matches this

H2O being liquid will not appear in kp expression

only b matches

b is correct option

Answer: b