Question

Calcium hydroxide is decomposed as follows. Ca(OH)2(s) → CaO(s) + H2O(g) a) From the thermodynamic quantities...

Calcium hydroxide is decomposed as follows.

Ca(OH)2(s) → CaO(s) + H2O(g)

a) From the thermodynamic quantities listed in the supporting material, predict whether this reaction will occur at 298 K.

b) Above what temperature will the reaction occur? Assume ΔrH° and ΔrS° are temperature independent

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
When 0.500 g CaO(s) is added to 140. g H2O at 23.1 °C in a coffee...
When 0.500 g CaO(s) is added to 140. g H2O at 23.1 °C in a coffee cup calorimeter, this reaction occurs. CaO(s)+H2O(l)-->Ca(OH)2 (aq) and enthalpy = -81.9 kj/mol Calculate the final temperature of the solution. The specific heat capacity of water is 4.184
Calcium oxide reacts with water in a combination reaction to produce calcium hydroxide: BaO(s)+H2O(l)-->Ba(OH)2(s) In a...
Calcium oxide reacts with water in a combination reaction to produce calcium hydroxide: BaO(s)+H2O(l)-->Ba(OH)2(s) In a particular experiment, a 1.50-g sample of BaO is reacted with excess water and 1.29 g of Ba(OH)2 is recovered. Calculate the theoretical yield and the percent yield of Ba(OH)2 in this experiment.
When 10.0 g of calcium metal is reacted with water, 5.00 g of calcium hydroxide is...
When 10.0 g of calcium metal is reacted with water, 5.00 g of calcium hydroxide is produced. Using the following balanced equation, calculate the percent yield for the reaction? (6 pts) Ca (s) + 2 H2O (l) → Ca(OH)2 (aq) + H2 (g)
C alcium oxide reacts with water in a combination reaction to produce calcium hydroxide: 2 2...
C alcium oxide reacts with water in a combination reaction to produce calcium hydroxide: 2 2 CaO (s) H O (l)Ca(OH) (s)  In a particular experiment, a 5.00-g sample of CaO is reacted with 125 g of water and 6.11 g of is recovered. 2 Ca(OH) a. How many moles of each reactant are present? (Show all work below) (2 pt) ______________ moles CaO ______________ moles H2O b. Which is the limiting reagent? ______________ is the limiting reagent. (Show...
What is the standard molar entropy for calcium hydroxide, Ca(OH)2? Express your answer in units of...
What is the standard molar entropy for calcium hydroxide, Ca(OH)2? Express your answer in units of J/mol*K What is the entropy of 4.06 g of Ca(OH)2? Express your answer in units of J/K
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn=...
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn= -285kJ Ca(OH)2(s)--CaO(s)+H2O(l) Hrxn= 64kJ 2Ca(s)+O2(g)--2CaO(s) Hrxn= -1270kJ
A) Consider the reaction 3 Fe2O3(s) + H2(g) --> 2 Fe3O4(s) + H2O(g) Using the standard...
A) Consider the reaction 3 Fe2O3(s) + H2(g) --> 2 Fe3O4(s) + H2O(g) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K. B) Consider the reaction CaCO3(s)--->CaO(s) + CO2(g) Using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15K.
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) +...
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) + 2 H2(g) This reaction is sometimes used to inflate life rafts, weather balloons, and the like, where a simple, compact means of generating H2 is desired. How many grams of CaH2 are needed to generate 13.0 L of H2 gas if the pressure of H2 is 740. torr at 22°C? g
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) +...
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) + 2 H2(g) This reaction is sometimes used to inflate life rafts, weather balloons, and the like, where a simple, compact means of generating H2 is desired. How many grams of CaH2 are needed to generate 16.0 L of H2 gas if the pressure of H2 is 740. torr at 24°C?
Consider the following reaction: CaCO3(s)→CaO(s)+CO2(g). Estimate ΔG∘ for this reaction at each of the following temperatures....
Consider the following reaction: CaCO3(s)→CaO(s)+CO2(g). Estimate ΔG∘ for this reaction at each of the following temperatures. (Assume that ΔH∘ and ΔS∘ do not change too much within the given temperature range.) A. 1090 K B.1405 K C.Predict whether or not the reaction in part A will be spontaneous at 320 K . D. Predict whether or not the reaction in part B will be spontaneous at 1090. E. Predict whether or not the reaction in part C will be spontaneous...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT