Question

Using the balanced chemical equation below… 4 Zn(s) + 10 HNO3(aq)  4 Zn(NO3) 2 (aq)...

Using the balanced chemical equation below…

4 Zn(s) + 10 HNO3(aq)  4 Zn(NO3) 2 (aq) + N2O(g) + 5 H2O(l)

a. Calculate the theoretical yield of H2O, if 10.45 g of Zn are reacted with 18.5 g of HNO3. (4 pts)

b. If 2.15 g of H2O was collected, what is the percentage yield? (2 pts)

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO +...
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO + NH3   ⟶ N2 + H2O A: 4 B: 5 C: 6 D: 3 E: 2 2:Which combination of reactants dissolved in water is most likely to produce a precipitate as a product in a “double-displacement”-type reaction? A: (NH4)3PO4 + K2CrO4 B: AgCH3CO2 + KBr C: KI + Zn(NO3)2 D: Fe(NO3)3 + LiCl E: NaBr +MgCl2 3: Which of the following is not a redox...
Zn(s) + AgNO3(aq) Zn(NO3)2(aq) + Ag(s) Balanced: Complete: Ionic:
Zn(s) + AgNO3(aq) Zn(NO3)2(aq) + Ag(s) Balanced: Complete: Ionic:
Balanced Chemical Equation for Preparation of Malachite: 2CuSO4(aq) + H2O + 2 Na2CO3(aq)  CuCO3Cu(OH)2(s) +...
Balanced Chemical Equation for Preparation of Malachite: 2CuSO4(aq) + H2O + 2 Na2CO3(aq)  CuCO3Cu(OH)2(s) + 2Na2SO4(aq) + CO2(g) 1. Measured Mass of CuSO4.5H2O 12.248g 2. Molar mass of CuSO4.5H2O ___g/mol 3. Moles CuSO4 .5H2O dissolved in reaction mixture (Entry 1 divided by Entry 2) ___mol 4. Moles of CuSO4 reacted (Same as Entry 3) ___mol 5. Mole to mole ratio of Cu2(OH)2CO3 produced to CuSO4 reacted from balanced chemical equation (see above)___ 6. Theoretical moles Cu2(OH)2CO3 produced (Entry 4...
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq)...
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 3- Write balanced complete ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 4- Write balanced net ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 5- Write balanced complete ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 6- Write balanced net ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 7- Write balanced complete ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) 8- Write balanced net ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) (Express your answer as a chemical equation. Identify all of the phases in your answer)
Given the reaction: 2 Al (s) + 6 HNO3 (aq) ® 2 Al(NO3)3 (aq) + 3...
Given the reaction: 2 Al (s) + 6 HNO3 (aq) ® 2 Al(NO3)3 (aq) + 3 H2 (g) .. When 0.143 g of Al were added to 200 mL of 0.500 M HNO3, 0.00842 g of H2 were produced. Find the percent yield of H2. (Please don’t forget to calculate the theoretical yield of hydrogen from both the aluminum and the nitric acid.) the answer should be = 53.0%
PbCO3(s) + 2HNO3(aq) -> Pb(NO3)2(aq) + H2O(l) + CO2(g) Pb(NO3)2(aq) + 2HCl(aq) -> 2HNO3(aq) + PbCl2(s)...
PbCO3(s) + 2HNO3(aq) -> Pb(NO3)2(aq) + H2O(l) + CO2(g) Pb(NO3)2(aq) + 2HCl(aq) -> 2HNO3(aq) + PbCl2(s) (A) If a student starts with 4.000 g of lead(II) carbonate for the first reaction and all other reagents are added in excess, what is the theoretical yield of lead(II) chloride solid? (B) If the student isolates 3.571 g of lead(II) chloride, what is the percent yield?
Cu(s) + HNO3(aq) -> Cu^2+(aq)+ NO2(g) +H2O (l) Balance the reaction of copper metal with nitric...
Cu(s) + HNO3(aq) -> Cu^2+(aq)+ NO2(g) +H2O (l) Balance the reaction of copper metal with nitric acid using the half- reaction method. Give the balanced half- reactions as well as the total balanced chemical equation. Which elements are changing oxidation states in this reaction?
1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2) 2HNO3(aq) + Na2CO3(s) -> H2O(l)...
1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2) 2HNO3(aq) + Na2CO3(s) -> H2O(l) + CO2(g) + 2NaNO3(aq) 3)Cu(NO3)2(aq) + Na2CO3(s) -> CuCO3(s) + 2NANO3(aq) 4)CuCO3(s) + 2HCL(aq) -> CuCl2(aq) + H2O(l) + CO2(g) 5)CuCl2(aq) + Cu(s) -> 2CuCl(s) weight of copper 1.022g volume of added nitric acid   5.3 ml total weight of added sodium carbonate 4.873g weight of watch glass and filter paper 25.372g Weight of watch glass, filter paper, and CuCl precipitate 53.650 g What is...
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Preparation of Copper(I) Chloride Reactions: 1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2)...
Preparation of Copper(I) Chloride Reactions: 1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2) 2HNO3(aq) + Na2CO3(s) -> H2O(l) + CO2(g) + 2NaNO3(aq) 3)Cu(NO3)2(aq) + Na2CO3(s) -> CuCO3(s) + 2NANO3(aq) 4)CuCO3(s) + 2HCL(aq) -> CuCl2(aq) + H2O(l) + CO2(g) 5)CuCl2(aq) + Cu(s) -> 2CuCl(s) Report: Weight of Copper: 1.067g Volume of Added Nitric Acid: 5.0mL Total weight of added Sodium Carbonate: 3.929g Weight of watch glass and filter paper: 51.204g Weight of watch glass, filter paper, and CuCl...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT