Question

Zn(s) + AgNO3(aq) Zn(NO3)2(aq) + Ag(s) Balanced: Complete: Ionic:


Zn(s) + AgNO3(aq) Zn(NO3)2(aq) + Ag(s)
Balanced:
Complete:
Ionic:
Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

1)

we have below Balanced equation

Zn (s) + 2 AgNO3 (aq) --> Zn(NO3)2 (aq) + 2 Ag (s)

2)

Total ionic equation is

Spectator ions should not be removed here. Spectator ions are part of total ionic equation

Zn (s) + 2 Ag+ (aq) + 2 NO3- (aq) --> Zn2+ (aq) + 2 NO3- (aq) + 2 Ag (s)

3)

Spectator ions should be removed now. Spectator ions are not part of total ionic equation

After removing Spectator ions, net ionic equation is:

2 Ag+ (aq) + Zn (s) --> 2 Ag (s) + Zn2+ (aq)

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq)...
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 3- Write balanced complete ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 4- Write balanced net ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 5- Write balanced complete ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 6- Write balanced net ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 7- Write balanced complete ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) 8- Write balanced net ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) (Express your answer as a chemical equation. Identify all of the phases in your answer)
From the balanced molecular equations, write the complete ionic and net ionic equations for the following....
From the balanced molecular equations, write the complete ionic and net ionic equations for the following. (Use the lowest possible whole number coefficients. Include states-of-matter under the given conditions in your answer.) a)CaCO3(s) + H2SO4(aq) → CaSO4(s) + CO2(g) + H2O(l) *Need complete ionic and net ionic equations b)K2C2O4(aq) + Cd(OH)2(aq) → 2 KOH(aq) + CdC2O4(s) *Need complete ionic and net ionic equations c)Zn(NO3)2(aq) + H2SO4(aq) → ZnSO4(s) + 2 HNO3(aq) *Need complete ionic and net ionic equations
Using the balanced chemical equation below… 4 Zn(s) + 10 HNO3(aq)  4 Zn(NO3) 2 (aq)...
Using the balanced chemical equation below… 4 Zn(s) + 10 HNO3(aq)  4 Zn(NO3) 2 (aq) + N2O(g) + 5 H2O(l) a. Calculate the theoretical yield of H2O, if 10.45 g of Zn are reacted with 18.5 g of HNO3. (4 pts) b. If 2.15 g of H2O was collected, what is the percentage yield? (2 pts)
Write balanced molecular and ionic equations for each. explain AgNO3+NaBr AgNO3+NaOH AgNO3+Na2CO3 Pb(NO3)2+NaBr Pb(NO3)2+Na2SO4 Pb(NO3)2+NaOH Pb(NO3)2+Na2CO3...
Write balanced molecular and ionic equations for each. explain AgNO3+NaBr AgNO3+NaOH AgNO3+Na2CO3 Pb(NO3)2+NaBr Pb(NO3)2+Na2SO4 Pb(NO3)2+NaOH Pb(NO3)2+Na2CO3 Ni(NO3)2+NaOH Ni(NO3)2+Na2CO3
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
write a balanced net ionic equation for the following reaction in acidic solution: Zn(s)+VO2+(aq)->Zn2+(aq)+V3+(aq)
write a balanced net ionic equation for the following reaction in acidic solution: Zn(s)+VO2+(aq)->Zn2+(aq)+V3+(aq)
Assume you are constructing a Galvanic cell based on the half-reactions between Zn2+(aq)/Zn(s) and Ag+(aq)/Ag. The...
Assume you are constructing a Galvanic cell based on the half-reactions between Zn2+(aq)/Zn(s) and Ag+(aq)/Ag. The standard reduction potentials are given below. Ag+ (aq) + e- Ag (s) Eo = 0.80 V Zn2+ (aq) + 2 e- Zn(s) Eo = -0.76 V Write a balanced chemical REDOX equation and determine the Eo for the cell. What will be observed at the cathode and at the anode? Is the reaction thermodynamically favored? Explain.
1. write the full and net ionic equations; Mg(No3)2 (ag) +Na2CO3(aq)----->MgCO3(s) +2NaNO3(aq) 2. H2SO4(aq) +2KOH(aq) ------->K2SO4(aq0...
1. write the full and net ionic equations; Mg(No3)2 (ag) +Na2CO3(aq)----->MgCO3(s) +2NaNO3(aq) 2. H2SO4(aq) +2KOH(aq) ------->K2SO4(aq0 + 2H2O(l) 3. MnCl2(aq) +(NH4)2CO3(aq)------>MnCO3(s) +2 NH4Cl(aq) 4. BaBr2(aq) +K2SO4(aq)-----> BaSO4(s) + 2KBr(aq)
Write the balanced complete ionic equation for the reaction HI(aq)+CsOH(aq)→ Write the balanced net ionic equation...
Write the balanced complete ionic equation for the reaction HI(aq)+CsOH(aq)→ Write the balanced net ionic equation for the reaction HI(aq)+CsOH(aq)→ Write the balanced complete ionic equation for the reaction HCHO2(aq)+NaOH(aq)→ Write the balanced net ionic equation for the reaction HCHO2(aq)+NaOH(aq)→ Write the balanced complete ionic equation for the reaction HC2H3O2(aq)+LiOH(aq)→ Write the balanced net ionic equation for the reaction HC2H3O2(aq)+LiOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your answer.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT