Question

A) Balance the equation: Cr(s) + SnCl4(l) ---> CrCl3(s) + Sn(s) B) If 6.000 g of...

A) Balance the equation: Cr(s) + SnCl4(l) ---> CrCl3(s) + Sn(s)

B) If 6.000 g of chromium and 23.000 g of tin(IV) chloride react according to this equation, whichof these is the limiting reactant?

C) What mass (in g) of chromium (III) chloride will be made?

D) What mass (in g) of the non-limiting reactant will remain after the reaction is over?

Homework Answers

Answer #1

A)

B) Since

4 moles of Cr reacts with 3 moles of SnCl4

this means

208gm of Cr reacts with 781 g of SnCl4

therefore

6gm of Cr will react with (781/208)*6 g of SnCl4

6gm of Cr will react with 22.53g of SnCl4

Since Cr is consumed first while there is still some SnCl4 is left, Chromium is the limitng reagent.

C)

4 moles of Cr gives 4 moles of CrCl3

this means

208gm of Cr will give 633.4 g of CrCl3

therefore

6g of Cr will give (633.4/208)* 6 g of CrCl3

=> 6g of Cr will give 18.27 g of CrCl3

D) After the reaction is over

SnCl4 left=23-22.53=0.47g

=>SnCl4 left0.47g

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Phosphorus and chlorine react as follows: P4(s) + Cl2(g) => PCl3(l). Balance it! Assume 135 g...
Phosphorus and chlorine react as follows: P4(s) + Cl2(g) => PCl3(l). Balance it! Assume 135 g P4(s) react with 333 g of Cl2(g). a) What is the limiting reactant? b) What is the reactant in excess and the amount in excess? c) What mass of phosphorus trichloride can be formed from the reaction?
The reaction 6ClO2 (g) + 2BrF3 (l) --> 6ClO2F (s) + Br2 (l) is carried out...
The reaction 6ClO2 (g) + 2BrF3 (l) --> 6ClO2F (s) + Br2 (l) is carried out with 12 mol of ClO2 and 5 mol of BrF3. a) Identify the excess reactant. b) Estimate how many moles of each product will be produced and how many moles of the excess reactant will remain. c) Which reactant is limiting?
P4(s) + 6Cl2(g) ==> 4PCl3(l) If 112g of P4 and 303g of Cl2 react what mass...
P4(s) + 6Cl2(g) ==> 4PCl3(l) If 112g of P4 and 303g of Cl2 react what mass of PCl3 is expected to form? What is the limiting reactant?
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Iron(III) oxide reacts with carbon monoxide according to the equation: Fe2O3(s)+3CO(g)→2Fe(s)+3CO2(g) A reaction mixture initially contains...
Iron(III) oxide reacts with carbon monoxide according to the equation: Fe2O3(s)+3CO(g)→2Fe(s)+3CO2(g) A reaction mixture initially contains 22.95 g Fe2O3 and 14.26 g CO. Once the reaction has occurred as completely as possible, what mass (in g) of the excess reactant is left?
Iron(III) oxide reacts with carbon monoxide according to the equation: Fe2O3(s)+3CO(g)→2Fe(s)+3CO2(g) A reaction mixture initially contains...
Iron(III) oxide reacts with carbon monoxide according to the equation: Fe2O3(s)+3CO(g)→2Fe(s)+3CO2(g) A reaction mixture initially contains 23.00 g Fe2O3and 15.66 g CO. Once the reaction has occurred as completely as possible, what mass (in g) of the excess reactant is left?
Elemental phosphorus reacts with chlorine gas according to the equation: P4(s)+6Cl2(g)→4PCl3(l) A reaction mixture initially contains...
Elemental phosphorus reacts with chlorine gas according to the equation: P4(s)+6Cl2(g)→4PCl3(l) A reaction mixture initially contains 45.21 g P4 and 130.4 g Cl2. Part A Once the reaction has occurred as completely as possible, what mass (in g) of the excess reactant remains? Express your answer to three significant figures. m =
a) Balance the equation for the reaction of iron metal with silver (I) nitrate to form...
a) Balance the equation for the reaction of iron metal with silver (I) nitrate to form iron (II) nitrate and silver metal. b) Using the equation from part a, determine the mass of silver metal that can be made if the reaction is performed using 67.3 g iron metal and 75.3 g silver (I) nitrate. HINT: This is a limiting reactant problem! c) If the actual yield of silver metal is 45.1 g when the reaction is performed, what is...
For the following reactions: 1) Name the reactants and products, 2) balance the equation, and 3)...
For the following reactions: 1) Name the reactants and products, 2) balance the equation, and 3) ... Edit question For the following reactions: 1) Name the reactants and products, 2) balance the equation, and 3) calculate the molecular mass of the reactants and products. Starting with 2.0 grams of each reactant, 4) identify the limiting reagent and 5) determine the mass of the first product. ____Ca (s) + _____H2O (l) → _____Ca(OH) 2 (aq) + ____H2 (g)
please answer these questions 1-Consider the following balanced equation: 2 Fe(s) + 3 Cl2(g) → 2...
please answer these questions 1-Consider the following balanced equation: 2 Fe(s) + 3 Cl2(g) → 2 FeCl3(s) How many moles of iron(III) chloride are obtained when 7.67 moles of chlorine gas react with excess solid iron? Assume the reaction is 100% efficient. 2- What mass of hydrochloric acid must have reacted with magnesium if 9.56 grams of hydrogen were produced? Include units with your answer. The UNBALANCED equation is provided: Mg(s) + HCl(aq) → H2(g) + MgCl2(aq) 3- What volume...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT