Question

Calculate the equilibrium constant value at 25ºC for the reaction (8 pts): Hint: Use ΔG0 =...

Calculate the equilibrium constant value at 25ºC for the reaction (8 pts): Hint: Use ΔG0 = - RTln (K). C

2H6 (g) + 4 H2O (g) → 2 CO2 (g) + 7 H2 (g)

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g)...
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g) K=[C2H6]2[O2]7 / [CO2]4[H2O]6 K=[CO2]4 / [C2H6]2[O2]7 K=K=[CO2]4[H2O]6 / [C2H6]2[O2]7 K=[CO2][H2O] / [C2H6]2[O2] B.)Consider the chemical equation and equilibrium constant at 25∘C: H2(g)+I2(g)⇌2HI(g) , K=6.2×102 Calculate the equilibrium constant for the following reaction at 25∘C: HI(g)⇌12H2(g)+12I2(g) Express the equilibrium constant to two significant figures. C.) Consider the following reaction and corresponding value of Kc: H2(g)+Br2(g)⇌2HBr(g) , Kc=1.9×1019 at 25∘C What is the value of Kp...
The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g)...
The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g) + H2(g) ⇌ CO(g) + H2O(g) If 0.35 moles of CO2 and 0.35 moles of H2 are introduced into a 1.0-L flask, what will be the concentration of CO when equilibrium is reached? The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g) + H2(g) ⇌ CO(g) + H2O(g) If 0.35 moles of CO2 and 0.35 moles of...
Consider the water–gas reaction, CO + H2O CO2 + H2 (a) Calculate the equilibrium constant, expressed...
Consider the water–gas reaction, CO + H2O CO2 + H2 (a) Calculate the equilibrium constant, expressed as log10 K, of the reaction at 298 K, (b) Calculate the equilibrium constant, expressed as log10 K, of the reaction at 1000 K
The Equilibrium constant Kc for the reaction H2(g) + CO2(g) -> H2O(g) + CO(g) is 4.2...
The Equilibrium constant Kc for the reaction H2(g) + CO2(g) -> H2O(g) + CO(g) is 4.2 at 1650 deg C. Initially .74 mol H2 and .74 mol CO2 are injected into a 4.6-L flask. Calculate the concentration of each species at equilibrium. H2= CO2 = H2O= CO=
The equilibrium constant Kc for the reaction H2(g) + Br2(g) ⇆ 2HBr(g) is 2.180×106 at 730°...
The equilibrium constant Kc for the reaction H2(g) + Br2(g) ⇆ 2HBr(g) is 2.180×106 at 730° C. Starting with 4.20 moles of HBr in a 17.8−L reaction vessel, calculate the concentrations of H2,Br2, and HBr at equilibrium. 17. The equilibrium constant Kc for the reaction below is 0.00771 at a certain temperature. Br2(g) ⇌ 2Br(g) If the initial concentrations are [Br2] = 0.0433 M and [Br] = 0.0462 M, calculate the concentrations of these species at equilibrium. For the reaction...
a) Calculate the equilibrium constant at 17 K for a reaction with ΔHrxno = 10 kJ...
a) Calculate the equilibrium constant at 17 K for a reaction with ΔHrxno = 10 kJ and ΔSrxno = -100 J/K. (Don't round until the end. Using the exponent enlarges any round-off error.) b) Calculate the equilibrium constant at 146 K for the thermodynamic data in the previous question (Notice that Keq is larger at the larger temperature for an endothermic reaction) c) Calculate the equilibrium constant at 43 K for a reaction with ΔHrxno = 10 kJ and ΔSrxno...
Debate continues on the practicality of H2 gas as a fuel. The equilibrium constant for the...
Debate continues on the practicality of H2 gas as a fuel. The equilibrium constant for the reaction CO(g)+ H2O (g) <--> CO2(g)+ H2 (g) is 1.0x10^5 at 25 degrees C. Calculate the standard free energy change (R=8.134 j/k*mol) and, without doing any calculations, estimate delta H(rxn) and delta S(rxn)
7. Calculate the equilibrium concentrations for the following reaction when the 0.200 mol of H2S is...
7. Calculate the equilibrium concentrations for the following reaction when the 0.200 mol of H2S is placed in an empty 1.00 L container. (This one will be hard to solve by hand: use an online tool once you set up the expression.) 2 H2S (g) ⇌ 2 H2 (g) + S2 (g) K = 4.2 x 10-6 at 1100 K 8. Consider the reaction 2 CO2(g) ⇄ 2 CO (g) + O2 (g). In one equilibrium mixture [CO2] = 0.18...
Consider the following reaction. K is .54 at 800 K. Calculate the equilibrium partial pressures of...
Consider the following reaction. K is .54 at 800 K. Calculate the equilibrium partial pressures of all species, starting with Pco2=1.00 atm; PH2= 1.00 atm Pco=Ph2O=0 CO2 (g) + H2 (g) ------CO (g) + H2O (g)
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT