Question

Derive equation bolometric Solar luminosity, L = 3.8 × 1033 erg s−1. Use ray leigh jeans...

Derive equation bolometric Solar luminosity,
L = 3.8 × 1033 erg s−1. Use ray leigh jeans equation.

Science   Physics   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
a) Given the Sun’s luminosity today, (L = 3.39x10^33 erg s^-1) how many protons are consumed...
a) Given the Sun’s luminosity today, (L = 3.39x10^33 erg s^-1) how many protons are consumed per second by nuclear reactions in the center of the Sun? b) Assuming that 2 protons are converted into 2 neutrons each time the Sun makes 1 4He nucleus, what is the flux of neutrinos from the Sun at the Earth’s orbit? Give your answer in [number of neutrinos per second per square centimeter].
Use integration to derive the formula for the area of an ellipse with equation x^2/a^2+ Y^2/b2...
Use integration to derive the formula for the area of an ellipse with equation x^2/a^2+ Y^2/b2 = 1 (the symmetry of the ellipse across the y and x-axes may be used in your solution without proof).
Consider the proposed matrix factorization: A = LS, where L is lower triangular with 1’s on...
Consider the proposed matrix factorization: A = LS, where L is lower triangular with 1’s on the diagonal, and S is symmetric. (a) Show how the LU decomposition can be used to derive this factorization. (b) What conditions must A satisfy for this factorization to exist?
Given the differential equation y''−2y'+y=0,  y(0)=1,  y'(0)=2 Apply the Laplace Transform and solve for Y(s)=L{y} Y(s) =     Now...
Given the differential equation y''−2y'+y=0,  y(0)=1,  y'(0)=2 Apply the Laplace Transform and solve for Y(s)=L{y} Y(s) =     Now solve the IVP by using the inverse Laplace Transform y(t)=L^−1{Y(s)} y(t) =
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn=...
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn= -285kJ Ca(OH)2(s)--CaO(s)+H2O(l) Hrxn= 64kJ 2Ca(s)+O2(g)--2CaO(s) Hrxn= -1270kJ
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq)...
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 3- Write balanced complete ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 4- Write balanced net ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 5- Write balanced complete ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 6- Write balanced net ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 7- Write balanced complete ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) 8- Write balanced net ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) (Express your answer as a chemical equation. Identify all of the phases in your answer)
1. Given the equation H3PO4(aq) + NaOH(aq) ---> NaH2PO4(aq) + H2O(l) : a) Rewrite it as...
1. Given the equation H3PO4(aq) + NaOH(aq) ---> NaH2PO4(aq) + H2O(l) : a) Rewrite it as a net ionic equation, assuming that H3PO4 is a weak acid. b) Use the net ionic equation and a table of standard enthalpies of formation to calculate the heat change for exactly 1 mole of each reactant producing exactly 1 mole of each product. Be careful to use aqueous solution values (aq). c) Calculate the heat change for 0.100 mole of each reactant producing...
3.8/3.9 5. Use Newton's Method to approximate the zero(s) of the function. Continue the iterations until...
3.8/3.9 5. Use Newton's Method to approximate the zero(s) of the function. Continue the iterations until two successive approximations differ by less than 0.001. Then find the zero(s) to three decimal places using a graphing utility and compare the results. f(x) = 3 − x + sin(x) Newton's Method: x= Graphing Utility: x= 6. Find the tangent line approximation T to the graph of f at the given point. Then complete the table. (Round your answer to four decimal places.)...
Consider the following recursive equation s(2n) = 2s(n) + 3; where n = 1, 2, 4,...
Consider the following recursive equation s(2n) = 2s(n) + 3; where n = 1, 2, 4, 8, 16, ... s(1) = 1 a. Calculate recursively s(8) b. Find an explicit formula for s(n) c. Use the formula of part b to calculate s(1), s(2), s(4), and s(8) d Use the formula of part b to prove the recurrence equation s(2n) = 2s(n) + 3
3. Cu(s) + 4HNO3(aq) --> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) a)Write the net ionic equation for...
3. Cu(s) + 4HNO3(aq) --> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) a)Write the net ionic equation for the reaction of concentrated nitric acid with solid copper b) calculate the volume of concentrated nitric acid (16M) required to react with 0.37 g of Cu(s) c) If you use 1.69 mL (an excess) of HNO3, what volume of 5.0M NaOH will you need to neutralize the solution after the copper is compeltely dissolved?
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT