Question

A certain gas-phase reaction is first order in each of the reactants. The energy of activation...

A certain gas-phase reaction is first order in each of the reactants. The energy of activation for the reaction is 39.7 kJ mol−1. At 65 °C the rate constant is 0.35 m3 mol−1 s−1. Calculate the entropy of activation at 65 °C.

The answer should be 44.1 kJ/mol

Engineering   Chemical-Engineering   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
The gas-phase association reaction between F2 and IF5 is first-order in each of the reactants. The...
The gas-phase association reaction between F2 and IF5 is first-order in each of the reactants. The energy of activation for the reaction is 58.6 kJ mol−1. At 65°C the rate constant is 7.84 ✕ 10−3 kPa−1 s−1. Calculate the entropy of activation at 65°C. Please show all work and report answer in J/k*mol to multiple sig figs.
The gas phase reaction 2N2O5(g)->4NO2(g)+O2(g) has an activation energy of 103 kJ/mole, and the first order...
The gas phase reaction 2N2O5(g)->4NO2(g)+O2(g) has an activation energy of 103 kJ/mole, and the first order rate constant is 1.16x10^-8 min^-1 at 231 K. what is the rate constant at 211K?
The gas phase reaction 2 N2O5(g) ? 4 NO2(g) + O2(g) has an activation energy of...
The gas phase reaction 2 N2O5(g) ? 4 NO2(g) + O2(g) has an activation energy of 103 kJ/mol, and the first order rate constant is 3.77×10-5 min-1 at 272 K. What is the rate constant at 292 K?
a.)A certain reaction has an activation energy of 25.10 kJ/mol. At what Kelvin temperature will the...
a.)A certain reaction has an activation energy of 25.10 kJ/mol. At what Kelvin temperature will the reaction proceed 7.00 times faster than it did at 289 K? b.A certain reaction has an enthalpy of ΔH = 39 kJ and an activation energy of Ea = 51 kJ. What is the activation energy of the reverse reaction? c.)At a given temperature, the elementary reaction A<=> B in the forward direction is the first order in A with a rate constant of...
The gas-phase reaction of NO with F2 to form NOF and F has an activation energy...
The gas-phase reaction of NO with F2 to form NOF and F has an activation energy of Ea = 6.30 kJ/mol and a frequency factor of A = 6.00×108M−1⋅s−1 . The reaction is believed to be bimolecular: NO(g)+F2(g)→NOF(g)+F(g) What is the rate constant at 695 ∘C ? Express your answer to three significant digits with the appropriate units. For compound units, place a multiplication dot between units (e.g. J⋅mol−1⋅K−1). (I got 2.74*10^8 M-1s-1 but it is wrong. I got a...
1) A first order reaction has an activation energy of 66.6 kJ/mol and a frequency factor...
1) A first order reaction has an activation energy of 66.6 kJ/mol and a frequency factor (Arrhenius constant) of 8.78 x 1010 sec -1. Calculate the rate constant at 19 oC. Use 4 decimal places for your answer. 2) A first order reaction has a rate constant of 0.988 at 25 oC and 9.6 at 33 oC. Calculate the value of the activation energy in KILOJOULES (enter answer to one decimal place)
A certain first order reaction has k = 6.2 × 10‒5 s‒1 at 35 oC and...
A certain first order reaction has k = 6.2 × 10‒5 s‒1 at 35 oC and an activation energy of 108 kJ/mole. What is the numerical value of the specific rate constant, k, at 45 oC? A certain first order reaction has k = 9.3 × 10‒5 M‒1 s‒1 at 100 oC and k = 1.0 × 10‒3 M‒1 s‒1 at 130 oC. What is the numerical value of the activation energy in kJ/mol for this reaction?
ARRHENIUS EQUATION CALCULATIONS The activation energy for the gas phase decomposition of dinitrogen pentoxide is 103...
ARRHENIUS EQUATION CALCULATIONS The activation energy for the gas phase decomposition of dinitrogen pentoxide is 103 kJ. N2O52 NO2 + 1/2 O2 The rate constant at 319 K is 5.59×10-4 /s. The rate constant will be 6.37×10-3 /s at ______ K. PART 2 The activation energy for the gas phase isomerization of isopropenyl allyl ether is 123 kJ. CH2=C(CH3)-O-CH2CH=CH2CH3COCH2CH2CH=CH2 The rate constant at 432 K is 2.68×10-4 /s. The rate constant will be______ /s at 474 K.
A certain reaction has an activation energy of 66.0 kJ/mol and a frequency factor of A1...
A certain reaction has an activation energy of 66.0 kJ/mol and a frequency factor of A1 = 8.30×1012 M−1s−1 . What is the rate constant, k, of this reaction at 27.0 ∘C ? An unknown reaction was observed, and the following data were collected: T (K) k (M−1⋅s−1) 352 109 426 185 Determine the activation energy for this reaction.
The rate constant of a first-order reaction is 3.20 × 10−4 s−1 at 350.°C. If the...
The rate constant of a first-order reaction is 3.20 × 10−4 s−1 at 350.°C. If the activation energy is 135 kJ/mol, calculate the temperature at which its rate constant is 9.15 × 10−4 s−1.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT