Question

Write the expression for the equilibrium constant Kc for each of the following equations: b   FeO(s)...

Write the expression for the equilibrium constant Kc for each of the following equations:
b   FeO(s) + CO(g) - Fe(s) + CO2(g)

d   PbI2(s) - Pb2 1 (aq) + 2I2(aq)

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

b   FeO(s) + CO(g) - Fe(s) + CO2(g)

                                 for solid [FeO] = 1, [Fe] = 1

Kc   = [CO2]/[CO]

d   PbI2(s) ----------->Pb2 1 (aq) + 2I2(aq) it is not correct equation

PbI2(s) ------------>Pb^2+ (aq) + 2I^-(aq) it is correct equation

for solid [PbI2]   = 1

Kc   = [Pb^2+][I]^2

plz any doubt comment on the BOX. I will explain

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Write the equilibrium expression (Kc) for the following reacCon. PbCl2(s) ? Pb2+(aq) + 2Cl–(aq) Kc =...
Write the equilibrium expression (Kc) for the following reacCon. PbCl2(s) ? Pb2+(aq) + 2Cl–(aq) Kc = ______________________ b. (6 pts) At 25˚C, a certain mass of PbCl2 was dissolved in water and the equilibrium concentraCon of dissolved Pb2+ was measured to be 1.62 x 10–2 M. Calculate Kc for this process. (Hint: If 1 mole of Pb2+ dissolves, how much Cl– dissolves with it?) c. (4 pts) In ques@on 2b, the mass of solid PbCl2 added to water was not...
write the equilibrium constant expression, Kc, for this reaction: NiS(s) > Ni^+2(aq) + S^-2(aq). given that...
write the equilibrium constant expression, Kc, for this reaction: NiS(s) > Ni^+2(aq) + S^-2(aq). given that Ksp=3.0×10^-10
Calculate the value of the equilibrium constant, Kc, for the following reaction. FeS(s) + 6CN-(aq) <----->...
Calculate the value of the equilibrium constant, Kc, for the following reaction. FeS(s) + 6CN-(aq) <-----> [Fe(CN)6]4-(aq) + S2-(aq) Kc=______? The solubility product constant, Ksp, for FeS is 1.6 × 10^–19, and the formation constant, Kf, for [Fe(CN)6]^4– is 1.5 × 10^35 Kc=______
Write the equilibrium‑constant expression for the reaction A(s)+3B(l)↽−−⇀2C(aq)+D(aq)A(s)+3B(l)↽−−⇀2C(aq)+D(aq) in terms of [A],[A], [B],[B], [C],[C], and [D],[D],...
Write the equilibrium‑constant expression for the reaction A(s)+3B(l)↽−−⇀2C(aq)+D(aq)A(s)+3B(l)↽−−⇀2C(aq)+D(aq) in terms of [A],[A], [B],[B], [C],[C], and [D],[D], as needed. Note that ?c,Kc, which is sometimes symbolized as ?eq,Keq, denotes that the equilibrium constant is expressed using molar concentrations. For this question, ?cKc means the same thing as ?eq.
Problem 15.15 Write the expression for Kc for the following reactions. In each case indicate whether...
Problem 15.15 Write the expression for Kc for the following reactions. In each case indicate whether the reaction is homogeneous or heterogeneous. Part A 3NO(g)⇌N2O(g)+NO2(g) Kc=   [N2O][NO2]3[NO] [NO]3[N2O][NO2] 3[NO][N2O][NO2] [N2O][NO2][NO]3 SubmitMy AnswersGive Up Part B 3NO(g)⇌N2O(g)+NO2(g) reaction is homogeneous heterogeneous SubmitMy AnswersGive Up Part C CH4(g)+2H2S(g)⇌CS2(g)+4H2(g) Kc=   [CH4][H2S]2[CS2][H2]4 [CH4][H2S]2[CS2][H2] 2[CS2][H2][CH4][H2S] [CS2][H2]4[CH4][H2S]2 SubmitMy AnswersGive Up Part D CH4(g)+2H2S(g)⇌CS2(g)+4H2(g) reaction is homogeneous heterogeneous SubmitMy AnswersGive Up Part E Ni(CO)4(g)⇌Ni(s)+4CO(g) Kc=   [Ni(CO)4]4[CO] [Ni(CO)4][CO]4 [CO]4[Ni(CO)4] 4[CO][Ni(CO)4] SubmitMy AnswersGive Up Part F Ni(CO)4(g)⇌Ni(s)+4CO(g) reaction is...
A key step in the extraction of iron from its ore is FeO(s)+CO(g)=Fe(s)+CO2(g). Kp=0.403 at 1000°C....
A key step in the extraction of iron from its ore is FeO(s)+CO(g)=Fe(s)+CO2(g). Kp=0.403 at 1000°C. This step occurs in the 700°C to 1200°C zone within a blast furnace. What are the equilibrium partial pressures of CO(g) and CO2(g) when 1.00 atm of CO(g) and excess FeO(s) react in a sealed container at 1000°C?
What is the equilibrium expression (Kc) for the following reaction? B(aq) → 2C(aq)
What is the equilibrium expression (Kc) for the following reaction? B(aq) → 2C(aq)
consider the following system as equilibrium PbI2(s)= Pb2+(aq)+2I-(aq) how will adding more PbI2 shift the equilibrium?...
consider the following system as equilibrium PbI2(s)= Pb2+(aq)+2I-(aq) how will adding more PbI2 shift the equilibrium? how will removing some Pb2+ shift the equilibrium?
For each of the following reactions, predict whether the equilibrium constant is greater than or less...
For each of the following reactions, predict whether the equilibrium constant is greater than or less than 1 and explain why. a). AgF (aq) + LiI (aq) <--> AgI (s) + LiF (aq) b). 2 Fe(OCN)3 (aq) + 3 Fe(SCN)2 (aq) <--> 2Fe(SCN)3 (aq) + 3 Fe(OCN)2 (aq) c). CdI2 (s) + CaF2 (s) <--> CaI2 (s) + CdF2 (s) d). [CuI4]2- + [CuCl4]3- <---> [CuCl4]2- + [CuI4]3- e). TiF4 (g) + 2TiI2 (g) <--> TiI4 (g) + 2TiF2 (g)
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT