Question

balance the following chemical equation 1.---mgcl2 +----k3po4>-----mg3(po4)2 + kcl 2. ----n2 +----h2>NH3 3.----Agclo3>Agcl + o2 4.give...

balance the following chemical equation

1.---mgcl2 +----k3po4>-----mg3(po4)2 + kcl

2. ----n2 +----h2>NH3

3.----Agclo3>Agcl + o2

4.give the IUPAC name or chemical formula of the .Cr2S3, CO3P2 and silver chromate and lron (lll) chlorate

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Answer

  1. 3 MgCl2 + 2 K3PO4 = Mg3(PO4)2 + 6 KCl
  2. N2 + 3 H2 = 2 NH3
  3. 2 AgClO3 = 2 AgCl + 3 O2
  4. A) IUPAC name of Cr2S3 = Chromium(III) Sulfide

           B) IUPAC name of Co3P2 = Cobalt(II) Phosphide

           C) Chemical formula for Silver chromate = Ag2CrO4

           D) Chemical formula for lron (lll) chlorate = Fe(ClO3)3

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1a) Balance following chemica reaction K3PO4(aq) + NiCl2(aq) --> Ni3(PO4)2(s) + KCl(aq) b) Now write the...
1a) Balance following chemica reaction K3PO4(aq) + NiCl2(aq) --> Ni3(PO4)2(s) + KCl(aq) b) Now write the complete ionic equation c)Write the net ionic equation 2a) Balance following chemical reaction K2SO4(aq) + CaI2(aq) --> CaSO4 (s) + Kl(aq) b)write complete ionic equation c) write net ionic equation 3. When the following equation is balanced using the smallest possible integers, what is the coefficent of oxygen gas? C7H16O(g)+O2(g)-> CO2(g)+H2O(g)
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO +...
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO + NH3   ⟶ N2 + H2O A: 4 B: 5 C: 6 D: 3 E: 2 2:Which combination of reactants dissolved in water is most likely to produce a precipitate as a product in a “double-displacement”-type reaction? A: (NH4)3PO4 + K2CrO4 B: AgCH3CO2 + KBr C: KI + Zn(NO3)2 D: Fe(NO3)3 + LiCl E: NaBr +MgCl2 3: Which of the following is not a redox...
Consider the following balanced chemical reaction: 4 NH3 + 3 O2 --> 2 N2 + 6...
Consider the following balanced chemical reaction: 4 NH3 + 3 O2 --> 2 N2 + 6 H2O How many grams of H2O can be produced when 35.00 g of NH3 react with 40.00 g of O2? Use atomic masses that have been rounded to the closest hundredths of an amu. Express answer in decimal notation and to the proper number of significant figures
Use the balanced equation for the exothermic reaction, N2 (g) + 3 H2 (g)----->2 NH3 (g),...
Use the balanced equation for the exothermic reaction, N2 (g) + 3 H2 (g)----->2 NH3 (g), to answer the 4 questions below. In which direction will the system shift when hydrogen is added? _____________ In which direction will the system shift when nitrogen is removed? _____________ In which direction will the system shift when ammonia is added? _____________ In which direction will the system shift when the temperature is increased? _____________
Please give us the following formulas: 1. The Fundamental Accounting Equation 2. The Expanded Accounting Equation...
Please give us the following formulas: 1. The Fundamental Accounting Equation 2. The Expanded Accounting Equation 3. The Formula for Computing Net Income 4. The Formula for the Balance Sheet Please give us one or two examples of the following accounts: Assets Liabilities Owner's Equity (provide only one example for this account) Revenue Expenses
For the following reactions: 1) Name the reactants and products, 2) balance the equation, and 3)...
For the following reactions: 1) Name the reactants and products, 2) balance the equation, and 3) ... Edit question For the following reactions: 1) Name the reactants and products, 2) balance the equation, and 3) calculate the molecular mass of the reactants and products. Starting with 2.0 grams of each reactant, 4) identify the limiting reagent and 5) determine the mass of the first product. ____Ca (s) + _____H2O (l) → _____Ca(OH) 2 (aq) + ____H2 (g)
1.         Write equilibrium (mass action) expressions for each of the following reactions: (a) H2(g) + I2(g)          2 HI...
1.         Write equilibrium (mass action) expressions for each of the following reactions: (a) H2(g) + I2(g)          2 HI (b)2 NO(g) + O2(g)           2 NO2(g) (c)N2(g) + 3 H2(g)           2 NH3(g) (d) CO(g) + NO2(g)           CO2(g) + NO(g) (e) 2 CO(g) + O2(g)             2 CO2(g) 2.    Write equilibrium expressions for each of the following equilibria: (a) 2 C(s) + O2(g)                  CO(g) (b) Zn2+(aq) + H2S(g)               ZnS(s) + 2 H+(aq) (c) HCl(g) + H2O()                  H3O+(aq) + Cl–(aq) (d)H2(g) +  O2(g)                   H2O(g) 3.         Which of the following is more likely to precipitate the hydroxide ion? (a)...
1)The following chemical reaction takes place in aqueous solution: CuCl2(aq)+2KOH(aq)→CuOH2(s)+2KCl(aq) Write the net ionic equation for...
1)The following chemical reaction takes place in aqueous solution: CuCl2(aq)+2KOH(aq)→CuOH2(s)+2KCl(aq) Write the net ionic equation for this reaction. 2)Calculate the volume in milliliters of a 2.4M silver nitrate solution that contains 150.g of silver nitrate AgNO3. Be sure your answer has the correct number of significant digits. 3)Write the empirical formula for at least four ionic compounds that could be formed from the following ions:MnO−4,SO−24,Fe+3, Pb+4 4)Green plants use light from the Sun to drive photosynthesis. Photosynthesis is a chemical...
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Nomenclature lab: will choose best answr NM NM = nonmetal -3 -2 -1 NM +1 +2...
Nomenclature lab: will choose best answr NM NM = nonmetal -3 -2 -1 NM +1 +2 md = metalloid md NM NM NM NM NM +1 +2 +3 md NM NM NM NM +1 +2 +2 md md NM NM NM +1 +2 +1 md md NM NM +1 +2 md NM +1 +2 Type I Binary Ionic Compounds Type I binary ionic compounds contain a metal and a nonmetal AND the metal that is present only forms one type...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT