Question

how could we cause the equilibrium to shift to the left? CH4(g) + 2H2S(g) => CS2(g)...

how could we cause the equilibrium to shift to the left? CH4(g) + 2H2S(g) => CS2(g) + 4 H2(g) K = 2.5 x 10-3

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

The condition written below is in accordance with Lechateliers principle

Effect of Concentration- Increase in concentration of any of the product shift in a direction where it can consume it i.e- favor backward reaction (towards left)

Effect of pressure- In the given equilibrium, (mole)product = 5 > (mole)reactant = 3

When pressure increases volume decreases and equilibrium shifts in a direction where there is less number of moles. Since here moles of reactant is less, increase in pressure will shift the equilibrium to left.

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1.) Write the equilibrium onstant expression for the reaction below (Keq): CH4(g)+2H2S(g) <--> CS2(g)+4H2(g) A reation...
1.) Write the equilibrium onstant expression for the reaction below (Keq): CH4(g)+2H2S(g) <--> CS2(g)+4H2(g) A reation mixture initially contains 0.50M CH4 ad 0.75M H2S. If the equilibrium concenration of H2 is 0.44M, find the equilibrium constatn (Kc) for the reaction. 2.) Express the equilibrium constant for the following reaction. P4(s)+5O2(g) <--> P4O10(s)
Consider the reaction       CS2(g) + 4 H2(g) --> CH4(g) + 2 H2S(g) Determine the temperature...
Consider the reaction       CS2(g) + 4 H2(g) --> CH4(g) + 2 H2S(g) Determine the temperature at which the reaction changes spontaneity. (DS° for CS2(g) is 237.79 J/molK, DH° for CS2(g) is 117.0 kJ/mol)
Consider the following reaction at equilibrium: 2H2(g)+S2(g)⇌2H2S(g)+heat In a 10.0-L container, an equilibrium mixture contains 2.20...
Consider the following reaction at equilibrium: 2H2(g)+S2(g)⇌2H2S(g)+heat In a 10.0-L container, an equilibrium mixture contains 2.20 g of H2, 10.9 g of S2 and 68.1 g of H2S. Part A What is the numerical Kc value for this equilibrium mixture? Part B If more H2 is added to the equlibrium mixture, how will the equilibrium shift? Part C How will the equilibrium shift if the mixture is placed in a 5.00-L container with no change in temperature? Part D If...
Determine how each of the following changes will affect the equilibrium reaction below (shift left, shift...
Determine how each of the following changes will affect the equilibrium reaction below (shift left, shift right, no change) H2O(g) + C(s) ↔ H2(g) + CO(g) ∆H° = 131 kJ a. increasing the temperature b. adding CO c. removing H2 c. removing H e. increasing the volume of the container f. adding more carbon to the reaction
Consider the following system at equilibrium CH4(g) + 2H2O(g) ↔ CO2(g) + 4H2(g). Suppose the concentration...
Consider the following system at equilibrium CH4(g) + 2H2O(g) ↔ CO2(g) + 4H2(g). Suppose the concentration of H2O is increased. (a) In which direction does the reaction shift to reestablish equilibrium? (b) What happens to the concentrations of CH4, CO2, and H2 as the reaction shifts to reestablish equilibrium?
Consider the following reaction at equilibrium: C(s)+H2O(g)⇌CO(g)+H2(g) Predict whether the reaction will shift left, shift right,...
Consider the following reaction at equilibrium: C(s)+H2O(g)⇌CO(g)+H2(g) Predict whether the reaction will shift left, shift right, or remain unchanged upon each of the following disturbances. Part A C is added to the reaction mixture. -is added to the reaction mixture. -the reaction will shift left -the reaction will shift right -the reaction will remain unchanged Part B H2O is condensed and removed from the reaction mixture. -is condensed and removed from the reaction mixture. -the reaction will shift left -the...
applying Leonard Chateliers principal which direction will the equilibrium shift in the following reaction CH4 (g)...
applying Leonard Chateliers principal which direction will the equilibrium shift in the following reaction CH4 (g) + 2O2 (g) = CO2 (g) + 802.3 kj (a) if the temperature is increased (b) if a catalyst is added (c) if CH4 is added (d) if the volume of the reaction vessel is decreased
Consider the reaction for the decomposition of hydrogen disulfide: 2H2S(g)⇌2H2(g)+S2(g),                            &nbs
Consider the reaction for the decomposition of hydrogen disulfide: 2H2S(g)⇌2H2(g)+S2(g),                              Kc=1.67×10−7 at 800∘C The reaction is carried out at the same temperature with the following initial concentrations: [H2S] =4.80 x 10^-4 M [H2] = 0.00 M [S2]= 0.00 M Find the equilibrium concentration of S2 . Express the concentration to three significant figures and include the appropriate units.
The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH2Cl2(g) CH4(g) +...
The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH2Cl2(g) CH4(g) + CCl4(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.19×10-2 M CH2Cl2, 0.168 M CH4 and 0.168 M CCl4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 0.133 mol of CH4(g) is added to the flask? [CH2Cl2] =____ M [CH4] = ______M [CCl4] = ______M
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT