Question

Match the redox equation with the number and location of water molecules that appear in the...

Match the redox equation with the number and location of water molecules that appear in the equation when it is correctly balanced.

-A.B.C.D.E.F.G.H.I.J.

Fe+2 (aq) + H2O2 (aq) --> Fe+3 (aq) in acidic solution
-A.B.C.D.E.F.G.H.I.J.

Cl2 (aq) --> ClO3- (aq) + Cl- in acidic solution
-A.B.C.D.E.F.G.H.I.J.

Sn (s) + NO3- (aq) --> Sn+2 (aq) + NO (g) in acidic solution
-A.B.C.D.E.F.G.H.I.J.

Ag (s) + HS- (aq) + CrO4-2 (aq) --> Ag2S (s) + Cr(OH)3 (s) in basic solution
A.

3 H2O in the reactants
B.

1 H2O in the reactants
C.

5 H2O in the products
D.

1 H2O in the products
E.

4 H2O in the products
F.

3 H2O in the products
G.

5 H2O in the reactants
H.

2 H2O in the products
I.

4 H2O in the reactants
J.

2 H2O in the reactants
Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1. What is the strongest reducing agent? Na F^- Fe^2+ Cd Fe^3+ 2. Balance the follow...
1. What is the strongest reducing agent? Na F^- Fe^2+ Cd Fe^3+ 2. Balance the follow redox rxn. what are the coefficients in front of Cr & Cl2 in the balanced rxn? Cr (s) + Cl2 (g) = Cr^3+ (aq) + Cl^- (aq) 3. Balance the follow redox rxn. what are the coefficients in front of Fe & Ag^+ in the balanced rxn? Fe (s) + Ag^+ (aq) = Ag (s) + Fe^2+ (aq) 4. Balance the following redox rxn....
Part A Which of the following reactions are redox reactions? Which of the following reactions are...
Part A Which of the following reactions are redox reactions? Which of the following reactions are redox reactions? Ba(NO3)2(aq)+K2SO4(aq)?BaSO4(s)+2KNO3(aq) Zn(s)+Fe2+(aq)?Zn2+(aq)+Fe(s) HCl(aq)+NaOH(aq)?H2O(l)+NaCl(aq) Ca(s)+Cl2(g)?CaCl2(s)
Balance the following equations by using OH- but not H^+ A) PbO2 + Cl^- --> CLO^-...
Balance the following equations by using OH- but not H^+ A) PbO2 + Cl^- --> CLO^- + Pb(OH)3^- B) HNO2 + SbO^+ --> NO + Sb2O5 C) Ag2S + CN^- + O2 --> S + Ag(CN)2^- + OH^- D) HO2^- + Cr(OH)3^- --> CrO4^2- + OH- E) ClO2 + OH^- --> ClO2^- + ClO3^- F) WO3^- + O2 --> HW6O21^-5 + OH^- G) Mn2O3 + CN^- --> Mn(CN)6^4- + (CN)2 H) Cu^2+ + H2 --> Cu + H2O
Balance the following reactions under acidic conditions: 1. ClO4-1 (aq) + Cl- -> ClO3-1 (aq) +...
Balance the following reactions under acidic conditions: 1. ClO4-1 (aq) + Cl- -> ClO3-1 (aq) + Cl2 (g) 2. HAsO2-2 (aq) + H2O2 (aq) -> H3AsO4 (aq) + H2O (l) Please post all steps. Thank you!
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO +...
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO + NH3   ⟶ N2 + H2O A: 4 B: 5 C: 6 D: 3 E: 2 2:Which combination of reactants dissolved in water is most likely to produce a precipitate as a product in a “double-displacement”-type reaction? A: (NH4)3PO4 + K2CrO4 B: AgCH3CO2 + KBr C: KI + Zn(NO3)2 D: Fe(NO3)3 + LiCl E: NaBr +MgCl2 3: Which of the following is not a redox...
When the following redox equation is balanced with smallest whole–number coefficients, the coefficient for ReO41- will...
When the following redox equation is balanced with smallest whole–number coefficients, the coefficient for ReO41- will be _____. Au(s) +   ReO4–(aq) --> Re(s) + Au3+(aq) (acidic solution) A. 2    B. 3    C. 7   D. 8   E. None of these choices is correct.
Balancing the following redox reaction in an acidic solution. How many electrons are transferred in this...
Balancing the following redox reaction in an acidic solution. How many electrons are transferred in this reaction? Cr2O7 2-(aq) + Cl- (aq)  Cr3+ (aq) Cl2 (g)
Balance the following oxidation-reduction reactions, which occur in acidic solution, using the half-reaction method. (Use the...
Balance the following oxidation-reduction reactions, which occur in acidic solution, using the half-reaction method. (Use the lowest possible coefficients. Include states-of-matter under the given conditions in your answer.) (a) O2(g) + Pb(s) → H2O(l) + Pb2+(aq) (b) NO3−(aq) + Sn(s) → NO(g) + Sn2+(aq) (c) Cl2(g) + Cr3+(aq) → Cl −(aq) + Cr2O72−(aq) (d) F2(g) + Mn2+(aq) → F −(aq) + MnO4−(aq)
Balance the following reactions under BASIC conditions: 1. CrO (s) + ClO-1 (aq) -> CrO4-2 (aq)...
Balance the following reactions under BASIC conditions: 1. CrO (s) + ClO-1 (aq) -> CrO4-2 (aq) + Cr-1 (aq) 2. Ca (s) + H2O (l) -> Ca(OH)2 (aq) + H2 (g) 3. Fe(OH)3 (s) + OCl-1 (aq) -> FeO4-2 (aq) + Cl-1 (aq) Thank you!
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT