Question

Consider the following reaction: HC2H3O2(aq)+H2O(l)⇌H3O+(aq)+C2H3O−2(aq) Kc=1.8×10−5 at 25∘C If a solution initially contains 0.260 M HC2H3O2,...

Consider the following reaction: HC2H3O2(aq)+H2O(l)⇌H3O+(aq)+C2H3O−2(aq) Kc=1.8×10−5 at 25∘C If a solution initially contains 0.260 M HC2H3O2, what is the equilibrium concentration of H3O+ at 25∘C?

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

CH3COOH dissociates as:

CH3COOH     H2O     ----->     H3O+   + CH3COO-
0.26                              0         0
0.26-x                     x         x


Kc = [H3O+][CH3COO-]/[CH3COOH]
Kc = x*x/(c-x)
Assuming x can be ignored as compared to c
So, above expression becomes

Ka = x*x/(c)
so, x = sqrt (Ka*c)
x = sqrt ((1.8*10^-5)*0.26) = 2.163*10^-3

since c is much greater than x, our assumption is correct
so, x = 2.163*10^-3 M



So, [H3O+] = x = 2.163*10^-3 M

Answer: 2.16*10^-3 M

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
For the reaction HF(aq) + H2O (l) <--->    H3O+(aq) + F-(aq)      Kc = 6.8...
For the reaction HF(aq) + H2O (l) <--->    H3O+(aq) + F-(aq)      Kc = 6.8 x 10-4 What is [H3O+] at equilibrium for a 0.0100M solution of HF. ( successive approximation method or quadratic) ( 2 sig figs)
Cyanic acid, HCNO, is a weak acid with the following equilibrium: HCNO(aq) + H2O(l) ⇌ CNO-(aq)...
Cyanic acid, HCNO, is a weak acid with the following equilibrium: HCNO(aq) + H2O(l) ⇌ CNO-(aq) + H3O+(aq) In a 0.200 M aqueous solution of HCNO, the concentration of H3O+ is 6.50 x 10-3M. The equilibrium constant (Kc) for this reaction is
Cyanic acid, HCNO, is a weak acid with the following equilibrium: HCNO(aq) + H2O(l) ⇌ CNO-(aq)...
Cyanic acid, HCNO, is a weak acid with the following equilibrium: HCNO(aq) + H2O(l) ⇌ CNO-(aq) + H3O+(aq) In a 0.200 M aqueous solution of HCNO, the concentration of H3O+ is 6.50 x 10-3M. The equilibrium constant (Kc) for this reaction is?
Consider the following reaction: CO(g)+H2O(g)⇌CO2(g)+H2(g) Kc=102 at 500 K A reaction mixture initially contains 0.120 M...
Consider the following reaction: CO(g)+H2O(g)⇌CO2(g)+H2(g) Kc=102 at 500 K A reaction mixture initially contains 0.120 M COand 0.120 M H2O. A)What will be the equilibrium concentration of [CO]? B)What will be the equilibrium concentration of [H2O]? C)What will be the equilibrium concentration of [CO2]? D)What will be the equilibrium concentration of [H2]?
In-Class Assignment #6 (ch. 18) [10 pts.] CH3COOH (aq)  +  H2O(l)    ⇌   H3O+(aq) + CH3COO−(aq)       ...
In-Class Assignment #6 (ch. 18) [10 pts.] CH3COOH (aq)  +  H2O(l)    ⇌   H3O+(aq) + CH3COO−(aq)        Ka = 1.8 x 10-5 For the reaction of above, write the expression for Ka. Set up an ICE table and find [H3O+] for a 0.10 M solution of CH3COOH. Calculate the pH of the solution at equilibrium
Consider the reaction: HNO2 (aq) + H2O (l) ⇄ NO2- (aq) + H3O+ (aq) Which of...
Consider the reaction: HNO2 (aq) + H2O (l) ⇄ NO2- (aq) + H3O+ (aq) Which of the following statements will decrease the amount of work the system could perform? - Add water to the reaction vessel - Add solid NaOH to the reaction (assume no volume change) - Selectively remove NO2- from the solution - Boil off water from the container (increasing the concentration of all species) - Increase the concentration of the HNO2
Consider the reaction IO−4(aq)+2H2O(l)⇌H4IO−6(aq);Kc=3.5×10−2 If you start with 21.0 mL of a 0.905 M solution of...
Consider the reaction IO−4(aq)+2H2O(l)⇌H4IO−6(aq);Kc=3.5×10−2 If you start with 21.0 mL of a 0.905 M solution of NaIO4, and then dilute it with water to 500.0 mL, what is the concentration of H4IO−6 at equilibrium?
Oxalic acid can donate two protons to water in successive reactions: (1) H2C2O4(aq)+H2O(l)⇌H3O+(aq)+HC2O4-(aq) (2) HC2O4-(aq)+H2O(l)⇌H3O+(aq)+C2O42-(aq) If...
Oxalic acid can donate two protons to water in successive reactions: (1) H2C2O4(aq)+H2O(l)⇌H3O+(aq)+HC2O4-(aq) (2) HC2O4-(aq)+H2O(l)⇌H3O+(aq)+C2O42-(aq) If Kc1 = 5.9 × 10-2 andKc2 = 6.4 × 10-5 at 25°C, what is the value of Kc for reaction (3)? (3) H2C2O4(aq)+2H2O(l)⇌2H3O+(aq)+C2O42-(aq) A) 9.2 × 102 B) 1.1 × 10-3 C) 5.9 × 10-2 D) 3.8 × 10-6 Why is C not the right answer? Does Hess's Law not apply in this problem?
Consider the reaction CaSO4(s)⇌Ca2+(aq)+SO2−4(aq) At 25 ∘C the equilibrium constant is Kc=2.4×10−5 for this reaction. If...
Consider the reaction CaSO4(s)⇌Ca2+(aq)+SO2−4(aq) At 25 ∘C the equilibrium constant is Kc=2.4×10−5 for this reaction. If the resulting solution has a volume of 1.1 L , what is the minimum mass of CaSO4(s) needed to achieve equilibrium? Express your answer to two significant figures and include the appropriate units.
Consider the following reaction: SO2Cl2(g)⇌SO2(g)+Cl2(g) Kc=2.99×10−7 at 227∘C If a reaction mixture initially contains 0.195 M...
Consider the following reaction: SO2Cl2(g)⇌SO2(g)+Cl2(g) Kc=2.99×10−7 at 227∘C If a reaction mixture initially contains 0.195 M SO2Cl2, what is the equilibrium concentration of Cl2 at 227 ∘C?
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT