Question

The Ka of propanoic acid (C2H5COOH) is 1.34 x 10-5. Calculate the pH of the solution...

The Ka of propanoic acid (C2H5COOH) is 1.34 x 10-5. Calculate the pH of the solution and the concentrations of C2H5COOH and C2H5COO- in a 0.297 M propanoic acid solution at equilibrium.

pH = _____

[C2H5COOH] = _____ M

[C2H5COO-] = ______ M

Homework Answers

Answer #1

..........................[C2H5COOH] ............. [H+] ........... [C2H5C00-]
initial .......................... 0.227 ....... ........... 0............ 0
change ... ................ -x .......... ........ ......... +x .... ...... .... + x
equilibrium......... 0.297 -x ........ ................. x ..... .......... x

Ka = 1.34 x 10^-5 = [H+][C2H5COO-]/[C2H5COOH]

1.34 x 10^-5 = (x)(x)/(0.297-x)

As an approximation, I am neglecting x in the denominator rather than solving a quadratic.

1.34 x 10^-5 = x^2/0.297

3.9798 x 10^-6 = x^2

x = 1.9949 x 10^-3

[H+] = 1.9949 x 10^-3

pH = - log[H+] = - log(1.9949 x 10^-3)

pH = 2.702

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
The Ka of propanoic acid (C2H5COOH) is 1.34×10−5. Calculate the pH of the solution and the...
The Ka of propanoic acid (C2H5COOH) is 1.34×10−5. Calculate the pH of the solution and the concentrations of C2H5COOH and C2H5COO− in a 0.331 M propanoic acid solution at equilibrium. pH= C2H5COOH]= [C2H5COO−]= At 25 °C,25 °C, how many dissociated H+H+ ions are there in 357 mL357 mL of an aqueous solution whose pH is 11.95?
In a solution containing benzoic acid (Ka = 6.3*10^-5), propanoic acid (Ka = 1.3*10^-5), formic acid...
In a solution containing benzoic acid (Ka = 6.3*10^-5), propanoic acid (Ka = 1.3*10^-5), formic acid (Ka = 1.8*10^-4), and hydrazoic (Ka = 2.5*10^-5) acid buffered to pH 4.373, what percent of hydrazoic acid is protonated?
At 25 °C, how many dissociated H+ ions are there in 327 mL327 mL of an...
At 25 °C, how many dissociated H+ ions are there in 327 mL327 mL of an aqueous solution whose pH is 11.65? Write the balanced equation for each reaction. Phases are optional. The carbonate ion (CO2−3)(CO32−) acts as a Brønsted base with water. The carbon-containing product from the first reaction acts as a Brønsted base with water. The carbon-containing product from the second reaction decomposes into carbon dioxide gas and water. The carbon-containing product from the second reaction decomposes into...
A student performs a titration of a solution of unknown concentration of propanoic acid (Ka =...
A student performs a titration of a solution of unknown concentration of propanoic acid (Ka = 1.3 x 10-5) using 0.165 M sodium hydroxide solution. If 30.8 mL of the sodium hydroxide solution are required to titrate 36 mL of the propanoic acid solution to the equivalence point, what is the pH of the original propanoic acid solution?
A 1.31 L buffer solution consists of 0.281 M propanoic acid and 0.104 M sodium propanoate....
A 1.31 L buffer solution consists of 0.281 M propanoic acid and 0.104 M sodium propanoate. Calculate the pH of the solution following the addition of 0.068 moles of HCl. Assume that any contribution of the HCl to the volume of the solution is negligible. The Ka of propanoic acid is 1.34 × 10-5.
Calculate the pH during the titration of 20.00 mL of 0.1000 M C2H5COOH(aq) with 0.2000 M...
Calculate the pH during the titration of 20.00 mL of 0.1000 M C2H5COOH(aq) with 0.2000 M LiOH(aq) after 9.7 mL of the base have been added. Ka of propanoic acid = 1.3 x 10-5.
Calculate the equilibrium concentrations of C2H5COO- and C2H5COOH in a solution prepare by dissolving 0.04 mole...
Calculate the equilibrium concentrations of C2H5COO- and C2H5COOH in a solution prepare by dissolving 0.04 mole of propionic acid in 150 ml of water.
Calculate the pH of a 0.375 M aqueous solution of nitrous acid (HNO2, Ka = 4.5×10-4)...
Calculate the pH of a 0.375 M aqueous solution of nitrous acid (HNO2, Ka = 4.5×10-4) and the equilibrium concentrations of the weak acid and its conjugate base. pH =    [HNO2 ]equilibrium =    M [NO2- ]equilibrium =    M
Calculate the pH of a 0.501 M aqueous solution of chlorous acid (HClO2, Ka = 1.1×10-2)...
Calculate the pH of a 0.501 M aqueous solution of chlorous acid (HClO2, Ka = 1.1×10-2) and the equilibrium concentrations of the weak acid and its conjugate base. pH = [HClO2]equilibrium = M [ClO2- ]equilibrium = M
Calculate the pH of a 0.334 M aqueous solution of phenol (a weak acid) (C6H5OH, Ka...
Calculate the pH of a 0.334 M aqueous solution of phenol (a weak acid) (C6H5OH, Ka = 1.0×10-10) and the equilibrium concentrations of the weak acid and its conjugate base. pH =    [C6H5OH ]equilibrium =    M [C6H5O- ]equilibrium =    M