Question

Calculate the pH of a 0.150 M solution of benzoic acid (C6H5CO2H) if   Ka= 6.3 x...

Calculate the pH of a 0.150 M solution of benzoic acid (C6H5CO2H) if  

Ka= 6.3 x 10-5for the acid.    C6H5CO2H(aq)     ⇌    H+(aq) + C6C5CO2-(aq)

Homework Answers

Answer #1

C6H5COOH dissociates as:

C6H5COOH -----> H+ + C6H5CO2-

0.15 0 0

0.15-x x x

Ka = [H+][C6H5CO2-]/[C6H5COOH]

Ka = x*x/(c-x)

Assuming x can be ignored as compared to c

So, above expression becomes

Ka = x*x/(c)

so, x = sqrt (Ka*c)

x = sqrt ((6.3*10^-5)*0.15) = 3.074*10^-3

since x is comparable c, our assumption is not correct

we need to solve this using Quadratic equation

Ka = x*x/(c-x)

6.3*10^-5 = x^2/(0.15-x)

9.45*10^-6 - 6.3*10^-5 *x = x^2

x^2 + 6.3*10^-5 *x-9.45*10^-6 = 0

This is quadratic equation (ax^2+bx+c=0)

a = 1

b = 6.3*10^-5

c = -9.45*10^-6

Roots can be found by

x = {-b + sqrt(b^2-4*a*c)}/2a

x = {-b - sqrt(b^2-4*a*c)}/2a

b^2-4*a*c = 3.78*10^-5

roots are :

x = 3.043*10^-3 and x = -3.106*10^-3

since x can't be negative, the possible value of x is

x = 3.043*10^-3

So, [H+] = x = 3.043*10^-3 M

use:

pH = -log [H+]

= -log (3.043*10^-3)

= 2.5167

Answer: 2.52

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Benzoic acid, C6H5CO2H, is a weak acid (Ka=6.3x10^-5). Calculate the initial concentration (in M) of benzoic...
Benzoic acid, C6H5CO2H, is a weak acid (Ka=6.3x10^-5). Calculate the initial concentration (in M) of benzoic acid that is required to produce an aqueous solution of benzoic acid that has a pH of 2.54
Question: Consider a .045 M solution of benzoic acid (C6H5CO2H) whose Ka value is 6.5 x...
Question: Consider a .045 M solution of benzoic acid (C6H5CO2H) whose Ka value is 6.5 x 10-5. A). write the acid-base reaction equation for this acid with water: B). write the equilibrium expression (Ka) for this reaction: C). Calculate the concentration of benzoic acid, benzoate ion (the conjugate base), and hydronium ion for this solution. D). Calculate the pH of this solution. E). Calculate the concentration of hydroxide ions in this solution.
How many grams of benzoic acid, C6H5CO2H, are in 3.00 L of a solution whose pH...
How many grams of benzoic acid, C6H5CO2H, are in 3.00 L of a solution whose pH is 2.8? Ka=6.5*10-5. The answer is 14.7 g benzoic acid but I do not know how they got to that answer. Can someone please show me how to do this question?
In a solution containing benzoic acid (Ka = 6.3*10^-5), propanoic acid (Ka = 1.3*10^-5), formic acid...
In a solution containing benzoic acid (Ka = 6.3*10^-5), propanoic acid (Ka = 1.3*10^-5), formic acid (Ka = 1.8*10^-4), and hydrazoic (Ka = 2.5*10^-5) acid buffered to pH 4.373, what percent of hydrazoic acid is protonated?
Find the pH of a 0.380 M aqueous benzoic acid solution. For benzoic acid, Ka=6.5⋅10−5.
Find the pH of a 0.380 M aqueous benzoic acid solution. For benzoic acid, Ka=6.5⋅10−5.
Assume you dissolve 0.235 g of the weak acid benzoic acid, C6H5CO2H, in enough water to...
Assume you dissolve 0.235 g of the weak acid benzoic acid, C6H5CO2H, in enough water to make 9.00 ✕ 10^2 mL of solution and then titrate the solution with 0.163 M NaOH. C6H5CO2H(aq) + OH-(aq) C6H5CO2-(aq) + H2O(ℓ) What are the concentrations of the following ions at the equivalence point? Na+, H3O+, OH- C6H5CO2- What is the pH of the solution?
Calculate the pH during the titration of 25.0 ml of 0.150 M benzoic acid with 0.150...
Calculate the pH during the titration of 25.0 ml of 0.150 M benzoic acid with 0.150 M NaOH after the following additions of titrant: 15.0 ml; 25.0 ml; 40.0 ml.
Assume you dissolve 0.235 g of the weak acid benzoic acid, C6H5CO2H, in enough water to...
Assume you dissolve 0.235 g of the weak acid benzoic acid, C6H5CO2H, in enough water to make 7.00 ✕ 102 mL of solution and then titrate the solution with 0.153 M NaOH. C6H5CO2H(aq) + OH-(aq) C6H5CO2-(aq) + H2O(ℓ) What are the concentrations of the following ions at the equivalence point? Na+, H3O+, OH- C6H5CO2- M Na+ M H3O+ M OH- M C6H5CO2 - What is the pH of the solution?
A buffer solution is prepared by adding 0.5 moles of benzoic acid (C6H5COOH, Ka = 6.3...
A buffer solution is prepared by adding 0.5 moles of benzoic acid (C6H5COOH, Ka = 6.3 x 10-5) and 0.5 moles of potassium benzoate (C6H5COOK) to enough water to make a 1L solution. How many grams of barium hydroxide is needed to shift the pH of this solution to 6? (This question was previously answered. The answer is not 19.4
Acid Ka H2PO4- 6.29 x 10-8 NH4+ 5.68 x 10 -10 HCl >> 1 ​ Calculate...
Acid Ka H2PO4- 6.29 x 10-8 NH4+ 5.68 x 10 -10 HCl >> 1 ​ Calculate the pH of a 0.150 M solution of Na2HPO4. Calculate the pH of a 0.150 M solution of NH4NO3. Calculate the pH of a 0.150 M solution of KCl.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT