Question

You obtain an unknown concentration of acetic acid (HC2H3O2, Ka = 1.8*10-5). You determine the pH...

You obtain an unknown concentration of acetic acid (HC2H3O2, Ka = 1.8*10-5). You determine the pH of the solution to be 2.38. What is the concentration of the acid?

Answer: 0.96605

Please explain how to set up.

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
acetic acid (hc2h3o2) is a weak acid (ka= 1.8*10^-5). Calculate the pH of a15.1 M HC2H3O2...
acetic acid (hc2h3o2) is a weak acid (ka= 1.8*10^-5). Calculate the pH of a15.1 M HC2H3O2 solution.
If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the initial concentration of...
If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the initial concentration of acetic acid in the vinegar. Express your answer using two significant figures. HC2H3O2 =   M   SubmitMy AnswersGive Up
Find the pH of a 0.342 M NaC2H3O2 solution. (The Ka of acetic acid, HC2H3O2, is...
Find the pH of a 0.342 M NaC2H3O2 solution. (The Ka of acetic acid, HC2H3O2, is 1.8×10−5.)
You create a 0.578 M solution of acetic acid (HC2H3O2, Ka = 1.8*10-5). Which of the...
You create a 0.578 M solution of acetic acid (HC2H3O2, Ka = 1.8*10-5). Which of the following represents the correct Ka expression for this reaction? 1.Ka = [HC2H3O2]/([H+][C2H3O2-]) 2.Ka = [H+][C2H3O2-]/[HC2H3O2] 3.Ka = [H+][OH-] Solve for x: you will get two possible values. After, plug both x values back into the original ICE table to determine the appropriate x value. What is the [H+] in molarity at equilibrium? What is the percent ionization for this reaction?
a) Calculate the pH of a 0.22-M acetic acid solution. Ka (acetic acid) = 1.8 ×...
a) Calculate the pH of a 0.22-M acetic acid solution. Ka (acetic acid) = 1.8 × 10-5 pH = ____ b) You add 83 g of sodium acetate to 1.50 L of the 0.22-M acetic acid solution. Calculate the new pH of the solution. (Ka for acetic acid is 1.8 × 10-5). pH = _____
The Ka of acetic acid (CH3CO2H) is 1.8 × 10–5. What is the pH of a...
The Ka of acetic acid (CH3CO2H) is 1.8 × 10–5. What is the pH of a solution that is made up by dissolving 0.45 moles of sodium acetate (CH3CO2Na) and 0.250 moles of acetic acid (CH3CO2H) in enough water to make 1 L of solution? 1.80 4.74 5.00 6.12 7.33 4.48
a) If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the concentration of...
a) If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. A particular sample of vinegar has a pH of 2.95. b) The acid-dissociation constant for benzoic acid (C6H5COOH) is 6.3×10−5. Calculate the equilibrium concentration of H3O+ in the solution if the initial concentration of C6H5COOH is 6.2×10−2 M . c) Calculate the equilibrium concentration of C6H5COO− in the solution if the initial concentration of C6H5COOH is 6.2×10−2 M ....
Calculate the pH of a 0.39 M CH3COOLi solution. Ka for acetic acid= 1.8 x 10^-5
Calculate the pH of a 0.39 M CH3COOLi solution. Ka for acetic acid= 1.8 x 10^-5
Acetic acid has a Ka of 1.8×10−5. Three acetic acid/acetate buffer solutions, A, B, and C,...
Acetic acid has a Ka of 1.8×10−5. Three acetic acid/acetate buffer solutions, A, B, and C, were made using varying concentrations: [acetic acid] ten times greater than [acetate], [acetate] ten times greater than [acetic acid], and [acetate]=[acetic acid]. Match each buffer to the expected pH. pH = 3.74 ; pH = 4.74 ; pH = 5.74 Part B: How many grams of dry NH4Cl need to be added to 2.30 L of a 0.600 M solution of ammonia, NH3, to...
Calculate the pH of a 0.59 M CH3COONa solution. (Ka for acetic acid = 1.8 ×...
Calculate the pH of a 0.59 M CH3COONa solution. (Ka for acetic acid = 1.8 × 10^−5.)
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT