Question

List the equilibria from largest to smallest equilibrium constant. List the equilibria from largest to smallest...

List the equilibria from largest to smallest equilibrium constant.

List the equilibria from largest to smallest equilibrium constant.

K I2>K Cl2>K Br2
KBr2>KCl2>KI2
KBr2>KI2>KCl2
KCl2>KI2>KBr2
KI2>KBr2>KCl2
KCl2>KBr2>KI2

b

Identify the proper form of the equilibrium-constant expression for the equation

N2(g)+O2(g)⇌2NO(g)

Identify the proper form of the equilibrium-constant expression for the equation

K=[NO][N2][O2]
K=[NO]2[N2][O2]
K=[N2][O2][NO]2
K=2[NO][N2][O2]

c

The equilibrium-constant of the reaction

NO2(g)+NO3(g)⇌N2O5(g)

is K=2.1×10−20. What can be said about this reaction?

The equilibrium-constant of the reaction

is . What can be said about this reaction?

At equilibrium the concentration of products and reactants is about the same.
At equilibrium the concentration of products is much greater than the concentration of reactants.
At equilibrium the concentration of reactants is much greater than that of products.

There are no reactants left over once the reaction reaches equilibrium.

d

The acid HOCl (hypochlorous acid) is produced by bubbling chlorine gas through a suspension of solid mercury(II) oxide particles in liquid water according to the equation

2HgO(s)+H2O(l)+2Cl2(g)⇌2HOCl(aq)+HgO⋅HgCl2(s)

What is the equilibrium-constant expression for this reaction?

The acid  (hypochlorous acid) is produced by bubbling chlorine gas through a suspension of solid mercury(II) oxide particles in liquid water according to the equation

What is the equilibrium-constant expression for this reaction?

K=[HOCl]2[HgO⋅HgCl2][Cl2]2[H2O][HgO]2
K=[Cl2]2[HOCl]2
K=[HOCl]2[Cl2]2
K=[HOCl]2[Cl2]2[H2O]
Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1) Identify the proper form of the equilibrium-constant expression for the equation N2(g)+O2(g)⇌2NO(g) K=[NO]   / [N2][O2]...
1) Identify the proper form of the equilibrium-constant expression for the equation N2(g)+O2(g)⇌2NO(g) K=[NO]   / [N2][O2] K=[NO]2 / [N2][O2] K=[N2][O2]   /   [NO]2 K=2[NO][N2]   /   [O2] 2) The acid HOCl (hypochlorous acid) is produced by bubbling chlorine gas through a suspension of solid mercury(II) oxide particles in liquid water according to the equation 2HgO(s)+H2O(l)+2Cl2(g)⇌2HOCl(aq)+HgO⋅HgCl2(s) What is the equilibrium-constant expression for this reaction? K=[HOCl]2   /   [Cl2]2 K=[HOCl]2[HgO⋅HgCl2]    /   [Cl2]2[H2O][HgO]2 K=[HOCl]2    /     [Cl2]2[H2O] K=[Cl2]2    /    [HOCl]2
Answer the following questions: (a) The equilibrium constant for the following reaction is 2.90×10-2 at 1150K....
Answer the following questions: (a) The equilibrium constant for the following reaction is 2.90×10-2 at 1150K. 2SO3(g) --> 2SO2(g) + O2(g) If an equilibrium mixture of the three gases at 1150K contains 2.33×10^-2 M SO3(g) and 1.73×10^-2 M SO2, what is the equilibrium concentration of O2? ________ M (b) Consider the equilibrium system at 881 K. 2NH3 (g) --> N2 (g) + 3H2 (g) If an equilibrium mixture of the three gases at 881 K contains 6.06 x10^-5 M NH3,...
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g)...
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g) K=[C2H6]2[O2]7 / [CO2]4[H2O]6 K=[CO2]4 / [C2H6]2[O2]7 K=K=[CO2]4[H2O]6 / [C2H6]2[O2]7 K=[CO2][H2O] / [C2H6]2[O2] B.)Consider the chemical equation and equilibrium constant at 25∘C: H2(g)+I2(g)⇌2HI(g) , K=6.2×102 Calculate the equilibrium constant for the following reaction at 25∘C: HI(g)⇌12H2(g)+12I2(g) Express the equilibrium constant to two significant figures. C.) Consider the following reaction and corresponding value of Kc: H2(g)+Br2(g)⇌2HBr(g) , Kc=1.9×1019 at 25∘C What is the value of Kp...
1.         Write equilibrium (mass action) expressions for each of the following reactions: (a) H2(g) + I2(g)          2 HI...
1.         Write equilibrium (mass action) expressions for each of the following reactions: (a) H2(g) + I2(g)          2 HI (b)2 NO(g) + O2(g)           2 NO2(g) (c)N2(g) + 3 H2(g)           2 NH3(g) (d) CO(g) + NO2(g)           CO2(g) + NO(g) (e) 2 CO(g) + O2(g)             2 CO2(g) 2.    Write equilibrium expressions for each of the following equilibria: (a) 2 C(s) + O2(g)                  CO(g) (b) Zn2+(aq) + H2S(g)               ZnS(s) + 2 H+(aq) (c) HCl(g) + H2O()                  H3O+(aq) + Cl–(aq) (d)H2(g) +  O2(g)                   H2O(g) 3.         Which of the following is more likely to precipitate the hydroxide ion? (a)...
Which equation is matched with the correct equilibrium expression for that reaction? Which equation is matched...
Which equation is matched with the correct equilibrium expression for that reaction? Which equation is matched with the correct equilibrium expression for that reaction? O3(g) + O(g) → 2O2(g), K c = 2 × [O2]/[O3][O] 2CO(g) + O2(g) → 2CO2(g), K c = [CO2]/[CO][O2] 2CO2(g) → 2CO(g) + O2(g) K c = [CO2]2/[CO]2[O2] N2(g) + O2(g) → 2NO(g), K c = [NO]2/[N2][O2] Calculate the pH for an aqueous solution of acetic acid that contains 5.15 × 10-3 hydronium ion. Calculate...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
The value of Kc for the reaction between water vapor and dichlorine monoxide is 0.0900 at...
The value of Kc for the reaction between water vapor and dichlorine monoxide is 0.0900 at 25°C. H2​O(g)+Cl2​O(g) 2HOCl(g) Part 1 Determine the equilibrium concentration of H2O if the starting concentrations of both reactants are 0.003923  M, with [HOCl]o = 0.000 M. Part 2 Determine the equilibrium concentration of Cl2O. Part 3 Determine the equilibrium concentration of HOCl.
The equilibrium constant, Kc, for the formation of nitrosyl chloride from nitric oxide and chlorine. 2NO(g)...
The equilibrium constant, Kc, for the formation of nitrosyl chloride from nitric oxide and chlorine. 2NO(g) + Cl2(g) ⇌ 2NOCl(g) is 6.5 ×104 at 35°C. In which direction will the reaction proceed to reach equilibrium if the starting concentrations of NO, Cl2, and NOCl are 5.2 × 10−3M, 3.4 × 10−4M, and 3.4 M respectively?
1: a) Write the equilibrium expression for the following: 2 NOCl (g) = 2 NO (g)...
1: a) Write the equilibrium expression for the following: 2 NOCl (g) = 2 NO (g) + Cl2 (g) b) In the reaction above, the equilibrium concentration of NOCl = [0.0610], NO=[0.0151], Cl2= [0.0142], what is the equilibrium constant? c) The initial concentration of NO2 in a closed container is 0.750 M. At equilibrium, the concentration of O2 is 0.125 M. What are the concentrations of NO2 and NO at equilibrium? 2 NO2 (aq) = 2 NO (aq) + O2...
The decomposition of NOCl: 2NOCl (g) <---> Cl2 (g) + 2NO (g) has an equilibrium constant...
The decomposition of NOCl: 2NOCl (g) <---> Cl2 (g) + 2NO (g) has an equilibrium constant of K=1.6*10^-5 at 35 degrees C. if the initial concentration of NOCl is 0.500M, what is the equilibrium concentration of NO? A. 1.00*10^-4M B. 2.00*10^-2M C. 1.00*10^-2M D. 2.3*10^-3M When sodium is added to the reaction vessel, it scavenges the chlorine gas in an exothermic reaction. What will the impact of adding sodium be on the equilibrium of the decomposition of NOCl? A. Shifts...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT