Question

Which statement is correct about Fe in the equation below: Fe (s) + Ni(NO3)2 (aq) ↔...

Which statement is correct about Fe in the equation below: Fe (s) + Ni(NO3)2 (aq) ↔ Fe(NO3)2 (aq) + Ni (s) A) Fe is the oxidizing agent. B) Fe is the reducing agent. C) Fe is reduced. D) Fe gains two electrons.

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Answer is B.

Reducing agent means it self oxidizes and helps in reduction of other substance.

Fe acts as reducing agent in the given reaction, because itself oxidised through out the reaction means oxidation state of Fe(S) increased from 0( Fe(s)=0) to +2 (Fe(NO3)2)=+2).

reducing agent helps in reduction of other substance in reaction means, in the gievn reaction the oxidation state of Ni decreased from +2(Ni(NO3)2) to 0(Ni(s)), and it is reduced.Hence Fe acts as reducing agent here.

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Al (s) + NiCl2 (aq) --> AlCl3 (aq) + Ni (s) Balance equation: Write the balanced...
Al (s) + NiCl2 (aq) --> AlCl3 (aq) + Ni (s) Balance equation: Write the balanced net ionic equation: write the oxidation and reduction half reaction for your net redox reaction: which species is the oxidizing agent? ______ the reducing agent? _______ Decide if the reaction will occur or not? And why??
3. Consider the following redox reaction, 3 Fe(NO3)2 (aq) + 2 Al (s) → 3 Fe...
3. Consider the following redox reaction, 3 Fe(NO3)2 (aq) + 2 Al (s) → 3 Fe (s) + 2 Al(NO3)3 (aq) a) Identify the species getting oxidized and the species getting reduced. b) If 6.3 moles of Fe(NO3)2 reacts with 5.4 moles of Al, which reactant is the limiting reactant? and c) How many grams of Al(NO3)3 will be produced?
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Consider the following redox reaction: 3 NO2 + 3 H2O →2 NO3- + 2 H3O+ +...
Consider the following redox reaction: 3 NO2 + 3 H2O →2 NO3- + 2 H3O+ + NO. Which species gets oxidized? Which species gets reduced? Which species is the oxidizing agent? Which species is the reducing agent? Which species gains electrons? . Which species loses electrons?
NiO2(s) + 2 H2O(l) + Fe(s) → Ni(OH)2(aq) + Fe(OH)2(aq) in basic solution #1 A.)Examine the...
NiO2(s) + 2 H2O(l) + Fe(s) → Ni(OH)2(aq) + Fe(OH)2(aq) in basic solution #1 A.)Examine the following and identify what elements are undergoing oxidation, what are undergoing reduction B.) Identifty number of electrons exchanged MS(s) ⇄ M+2(aq) + S-2(aq) Ksp = small number S-2= weak base #2Once you identify the nature of S-2 write the appropriate acid or base dissociation reaction and the correct Ka or Kb statement #3.) A sample of 0.500 g of sodium carbonate (Na2CO3) and 0.500...
In the net cell reaction shown below, identify the oxidizing and reducing agents. Cd(s) + NiO2(s)...
In the net cell reaction shown below, identify the oxidizing and reducing agents. Cd(s) + NiO2(s) + 2 H2O(l) → Cd(OH)2(s) + Ni(OH)2(s) A. Oxidizing Agent: H2O(l), Reducing Agent: Cd(s) B. Oxidizing Agent: Cd(s), Reducing Agent: NiO2(s) C. Oxidizing Agent: NiO2(s), Reducing Agent: Cd(s) D. Oxidizing Agent: Ni(OH)2(s), Reducing Agent: Cd(OH)2(s) E. Oxidizing Agent: Ni(OH)2(s), Reducing Agent: Cd(s)
Choose the best reducing agent from the list below. A. Ni2+(aq) B. Ag(s) C.F2(g) D. Fe(s)...
Choose the best reducing agent from the list below. A. Ni2+(aq) B. Ag(s) C.F2(g) D. Fe(s) I expected the answer to be A because the strongest reducing agent would be the most likely to be oxidized. Wouldn't a cation want to give up it's electrons, or be oxidized more than a metal solid or a highly electronegative halogen? The correct answer is D. Will someone please explain why this is?
Balance the following skeleton reaction and identify the oxidizing and reducing agents:' a) Sb(s) + NO3-(aq)...
Balance the following skeleton reaction and identify the oxidizing and reducing agents:' a) Sb(s) + NO3-(aq) > Sb4O6(s) + NO(g) [acidic] b) Mn2+(aq) + BiO3-(aq) > MnO4-(aq) + Bi3+(aq) [acidic] c) Fe(OH)2(s) + Pb(OH)3-(aq) > Fe(OH)3(s) + Pb(s) [basic]
Balance the following Redox reactions in basic solution a) NiO2 (s) + Fe (s) → Ni(OH)2...
Balance the following Redox reactions in basic solution a) NiO2 (s) + Fe (s) → Ni(OH)2 (s)+ Fe(OH)2 (s) b) OH- (aq) + NO2 (g) → NO3- (aq) + NO2- (aq) + H20 (l)
Write the net ionic equation (including phases) that corresponds to Fe(NO3)2(aq)+K2S(aq) right arrow FeS(s)+2KNO3(aq)
Write the net ionic equation (including phases) that corresponds to Fe(NO3)2(aq)+K2S(aq) right arrow FeS(s)+2KNO3(aq)
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT