Question

Consider the balanced chemical reaction shown below. 1 Ca3P2(s) + 6 H2O(l) 3 Ca(OH)2(s) + 2...

Consider the balanced chemical reaction shown below.

1 Ca3P2(s) + 6 H2O(l) 3 Ca(OH)2(s) + 2 PH3(g)

In a certain experiment, 3.981 g of Ca3P2(s) reacts with 4.412 g of H2O(l).

(a) Which is the limiting reactant? (Example: type Ca3P2 for Ca3P2(s))

(b) How many grams of Ca(OH)2(s) form?

(c) How many grams of PH3(g) form?

(d) How many grams of the excess reactant remains after the limiting reactant is completely consumed?

Homework Answers

Answer #1

MW Ca3P2 = 182.18

mol of Ca3P2 = mass/mol = 3.981 /182.18 = 0.02185 mol of Ca3P2

mol of H2O = mass/MW = 4.412/18 = 0.245111 mol ofH2O

ratio is 1:6 so

0.245111 mol of water will need 0.245111 /6 = 0.040851 mol of Ca3P2 which we do not have so

a)

Ca3P2 is limitin reactatn

b)

0.02185 mol of Ca3P2 react

since ratio is 1:2; that is 2 with respect to Ca(OH)2

then

0.02185 *3 = 0.06555 mol of Ca(OH)2 will be formed

mass = mol*MW = 0.06555*74 = 4.8507g of Ca(OH)2

c)

PH3

the ratio is 1:2 so

0.02185 mol of Ca3P2 will form 0.02185 *2 mol of PH3 = 0.0437mol of PH3

mass = mol*MW = 0.0437*33.99758 = 1.48569 g of PH3

d)

excess remains?

0.0437mol consumed so 0.040851*6 mol of H2O consumed

0.245106 mol of H2O consumed

H2o left = 0.245111 -0.0437 = 0.201411 mol of H2O left

mass = mol*MW =0.201411*18

mass = 3.625398 g of water left

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Consider the balanced chemical reaction shown below. 4 PH3(g) + 8 O2(g) 6 H2O(l) + 1...
Consider the balanced chemical reaction shown below. 4 PH3(g) + 8 O2(g) 6 H2O(l) + 1 P4O10(s) In a certain experiment, 3.118 g of PH3(g) reacts with 6.294 g of O2(g). (a) Which is the limiting reactant? (Example: type PH3 for PH3(g)) is the limiting reactant. (b) How many grams of H2O(l) form? g of H2O(l) form. (c) How many grams of P4O10(s) form? g of P4O10(s) form. (d) How many grams of the excess reactant remains after the limiting...
Consider the balanced chemical reaction shown below. 2 C3H6(g) + 9 O2(g) 6 CO2(g) + 6...
Consider the balanced chemical reaction shown below. 2 C3H6(g) + 9 O2(g) 6 CO2(g) + 6 H2O(l) In a certain experiment, 6.004 g of C3H6(g) reacts with 2.118 g of O2(g). (a) Which is the limiting reactant? _____ is the limiting reactant. (b) How many grams of CO2(g) form? _____g of CO2(g) form. (c) How many grams of H2O(l) form? _____g of H2O(l) form. (d) How many grams of the excess reactant remains after the limiting reactant is completely consumed?_____...
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) +...
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) + 2 H2(g) This reaction is sometimes used to inflate life rafts, weather balloons, and the like, where a simple, compact means of generating H2 is desired. How many grams of CaH2 are needed to generate 13.0 L of H2 gas if the pressure of H2 is 740. torr at 22°C? g
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) +...
Calcium hydride, CaH2, reacts with water to form hydrogen gas. CaH2(s) + 2 H2O(l) Ca(OH)2(aq) + 2 H2(g) This reaction is sometimes used to inflate life rafts, weather balloons, and the like, where a simple, compact means of generating H2 is desired. How many grams of CaH2 are needed to generate 16.0 L of H2 gas if the pressure of H2 is 740. torr at 24°C?
Calcium oxide reacts with water in a combination reaction to produce calcium hydroxide: BaO(s)+H2O(l)-->Ba(OH)2(s) In a...
Calcium oxide reacts with water in a combination reaction to produce calcium hydroxide: BaO(s)+H2O(l)-->Ba(OH)2(s) In a particular experiment, a 1.50-g sample of BaO is reacted with excess water and 1.29 g of Ba(OH)2 is recovered. Calculate the theoretical yield and the percent yield of Ba(OH)2 in this experiment.
Consider the balanced equation for the following reaction: 3H2O(l) + Mg3N2(aq) → 3MgO(s) + 2NH3(g) If...
Consider the balanced equation for the following reaction: 3H2O(l) + Mg3N2(aq) → 3MgO(s) + 2NH3(g) If 57.7 grams of H2O reacts with 57.3 grams of Mg3N2, determine the limiting reagent in the reaction. A. Mg3N2 B. H2O C. NH3 D. MgO
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn=...
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn= -285kJ Ca(OH)2(s)--CaO(s)+H2O(l) Hrxn= 64kJ 2Ca(s)+O2(g)--2CaO(s) Hrxn= -1270kJ
(Part A) For the reaction, calculate how many grams of the product form when 16.4 g...
(Part A) For the reaction, calculate how many grams of the product form when 16.4 g of Ca completely reacts. Assume that there is more than enough of the other reactant. Ca(s)+Cl2(g)→CaCl2(s) (Part B) For the reaction, calculate how many grams of the product form when 16.4 g of Br2 completely reacts. Assume that there is more than enough of the other reactant. 2K(s)+Br2(l)→2KBr(s)
Consider this reaction, which occurs in the atmosphere and contributes to photochemical smog: ZnO(s) + H2O(l)...
Consider this reaction, which occurs in the atmosphere and contributes to photochemical smog: ZnO(s) + H2O(l) →Zn(OH)2(aq) If there is 16.9 g ZnO and excess H2O present, the reaction yields 18.5 g Zn(OH)2. Calculate the percent yield for the reaction. Metallic zinc reacts with aqueous HCl. Zn(s) + 2 HCl(aq) → ZnCl2(aq) + H2(g) What volume of 2.60 M HCl, in milliliters, is required to convert 12.6 g of Zn completely to products? mL HCl
Calcium hydride (CaH2) reacts with water to form hydrogen gas: CaH2(s) + 2H2O(l) → Ca(OH)2(aq) +...
Calcium hydride (CaH2) reacts with water to form hydrogen gas: CaH2(s) + 2H2O(l) → Ca(OH)2(aq) + 2H2(g) How many grams of CaH2 are needed to generate 55.0 L of H2 gas at a pressure of 0.811 atm and a temperature of 32°C?