Question

Create an ICE table and substitute the experimental Ka value (2.69*10^-4) to determine the pH of...

Create an ICE table and substitute the experimental Ka value (2.69*10^-4) to determine the pH of a 0.0020 M solution.

Requires use of the quadratic formula.

Homework Answers

Answer #1

lets your acid will be HA

HA + H2O ----> H3O+ + A-

I 0.002 0 0

C -x +x +x

E 0.002-x +x +x

dissociation constant

Ka = [H3O+][A-] / [HA]

2.69 *10-4 = [x][x] / [0.002-x]

2.69 *10-4 [0.002-x] = x2

x2 + x2.69 *10-4 - 5.38 * 10-7 =0 this is the quadratic equation

i am using the online sodt wear to calculate the quadratic equation

i got the two values for x one is in +ve and another one is in -Ve concentration cannot be a -ve value so i am taking positive value

x = 0.0006112 M = [H3O+] = [A-]

now you have the concentration of H3O+ from this we can find out pH

pH = -log[H3O+]

pH = -log[0.0006112]

pH = 3.214

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
What is the pH of a 0.0520 M solution of nitrous acid (HNO2)? (Ka = 4.5...
What is the pH of a 0.0520 M solution of nitrous acid (HNO2)? (Ka = 4.5 x 10-4) (Hint: use ICE and solve the quadratic equation) OR something A LOT simple PLEASE Question options: a) pH = 2.34 b) pH = 2.32 c) pH = 2.30 d) pH = 2.36     
SALTS: For each of the following salt solutions, record the experimental pH, determine the theoretical pH...
SALTS: For each of the following salt solutions, record the experimental pH, determine the theoretical pH (show your work) and then determine the percent error between the two (show your work). For errors of greater than 20%, provide an explanation for the deviation. 1) 0.15 M KCl Solution; experimental pH = 6.82 Acid Ka HCL >>1 Calculated pH: _____________ Actual pH: ______________ Percent error: ____________ 2) 0.15 M Na2HPO4 Solution; experimental pH = 8.90 Acid Ka H3PO4 7.1 x 10-3...
Please use an ice table and lable which answer is Ka for NH4+ and pka NH4+...
Please use an ice table and lable which answer is Ka for NH4+ and pka NH4+ balanced, ionic equation for the reaction of ammonium ion [NH4+] with water. NH4+(aq) + H2O(l) ⇄ NH3(aq) + H3O+(aq) equilibrium constant expression, Ka, for aqueous NH4+ Ka = [NH3][H3O+]/[NH4+] measured pH values for each solution (A-B) to calculate [H3O+] . Make an ICE table for each solution to find EQUILIBRIUM concentrations. Calculate Ka for NH4+ and pka NH4+ Solution A - pH = 4.56...
The Ka value for HF is 3.5×10?4. Calculate the change in pH when 2.0×10?2mol of NaOH...
The Ka value for HF is 3.5×10?4. Calculate the change in pH when 2.0×10?2mol of NaOH is added to 0.50 L of a buffer solution that is 0.15 M in HF and 0.20 M in NaF.
You create a 0.578 M solution of acetic acid (HC2H3O2, Ka = 1.8*10-5). Which of the...
You create a 0.578 M solution of acetic acid (HC2H3O2, Ka = 1.8*10-5). Which of the following represents the correct Ka expression for this reaction? 1.Ka = [HC2H3O2]/([H+][C2H3O2-]) 2.Ka = [H+][C2H3O2-]/[HC2H3O2] 3.Ka = [H+][OH-] Solve for x: you will get two possible values. After, plug both x values back into the original ICE table to determine the appropriate x value. What is the [H+] in molarity at equilibrium? What is the percent ionization for this reaction?
HNO2 ( Ka=4.5 x 10^-4) HCN (Ka= 4.9 x 10^-10) CH3NH2 (Kb=4.4 x 10^-4) HONH2 (Kb=1.1...
HNO2 ( Ka=4.5 x 10^-4) HCN (Ka= 4.9 x 10^-10) CH3NH2 (Kb=4.4 x 10^-4) HONH2 (Kb=1.1 x 10^-8) Use this data to rank the following solutions in order of increasing pH. In other words, select a '1' next to the solution that will have the lowest pH, a '2' next to the solution that will have the next lowest pH, and so on.. RANK THESE ONES: 0.1 M NaBr 0.1 M CH3NH3Cl 0.1 M KNO2 0.1 M HONH3Br
A.) Find the pH of a 0.338 M NaF solution. (The Ka of hydrofluoric acid, HF,...
A.) Find the pH of a 0.338 M NaF solution. (The Ka of hydrofluoric acid, HF, is 3.5×10?4.) B.) Determine the [OH?] of a 0.30 M solution of NaHCO3. and Determine the pH of this solution. C.)Find the [OH?] of a 0.46 M  methylamine (CH3NH2) solution. (The value of Kb for methylamine (CH3NH2) is 4.4×10?4.) include units D.) Find the pH of a 0.46? M  methylamine (CH3NH2) solution.
Calculate pH of 0.10 M hydrochloric acid (why no Ka?) Calculate the pH of a 0.100...
Calculate pH of 0.10 M hydrochloric acid (why no Ka?) Calculate the pH of a 0.100 M calcium hydroxide (hint: write the formula first & rxn in water) Calculate the pH and % ionization of a 0.05 M hydrofluoric acid (ka = 8.0 x 10 -4) . What is the hydrogen ion concentration for a hydrochloric acid solution that has a pH of 2.30?
What is the pH of a 0.15 M solution of HClO? Ka for HClO = 3.5...
What is the pH of a 0.15 M solution of HClO? Ka for HClO = 3.5 x 10-8   The value of Ka for the weak acid Benzoic acid (C6H6COOH) is 1.5 × 10-5. What are the equilibrium concentrations of all species if 1.50 g of Benzoic acid is dissolved in enough water to make a 250.0 mL solution? What is the pH of the solution? Ammonium ion is the conjugate acid of Ammonia.   What is the pH of a 0.25...
Find the pH of a 0.300 M HF (Ka=6.3×10−4) solution. Find the percent dissociation of a...
Find the pH of a 0.300 M HF (Ka=6.3×10−4) solution. Find the percent dissociation of a 0.300 M HF solution