Question

Decide which of the following statements are True and which are False about equilibrium systems: For...

Decide which of the following statements are True and which are False about equilibrium systems:

For the following reaction: CaCO3(s) ⇌ CaO(s) + CO2(g) the [CaCO3] appears in the denominator of the equilibrium expression.

The value of K at constant temperature does not depend on the amounts of reactants and products that are mixed together initially.

For the following reaction: H2(g) + F2(g) ⇌ 2HF(g) the values of K and Kp are the same.

For a reaction with K >> 1, the rate of the forward reaction is less than the rate of the reverse reaction at equilibrium.

A large value of K means the equilibrium position lies far to the left.

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Which of the following would an increase in pressure cause a shift in equilibrium that favors...
Which of the following would an increase in pressure cause a shift in equilibrium that favors reactants? Select one: a. CO2(g)+H2(g) ⇌CO(g)+H2O(g)CO2(g)+H2(g) ⇌CO(g)+H2O(g) b. CO(g) +12O2(g) ⇌CO2(g)CO(g) +12O2(g) ⇌CO2(g) c. 2Hg(l)+O2(g) ⇌2HgO(s)2Hg(l)+O2(g) ⇌2HgO(s) d. 2H2(g)+O2(g) 2H2O(l)2H2(g)+O2(g) 2H2O(l) e. CaCO3(s) ⇌CaO(s)+CO2(g)
The equilibrium constant, Kc, for the following reaction is 55.6 at 698 K. H2 (g) +...
The equilibrium constant, Kc, for the following reaction is 55.6 at 698 K. H2 (g) + I2 (g) forward and reverse arrows 2 HI (g) Calculate the equilibrium concentrations of reactants and product when 0.383 moles kf H2 and 0.383 moles of I2 are introduced into a 1.00 L vessel at 698 K. [H2] = M [I2] = M [HI] = M
please answear each question 1)At equilibrium, ________. a)the rates of the forward and reverse reactions are...
please answear each question 1)At equilibrium, ________. a)the rates of the forward and reverse reactions are equal b)the value of the equilibrium constant is 1 c)all chemical reactions have ceased d)the rate constants of the forward and reverse reactions are equal e)the limiting reagent has been consumed 2)The equilibrium-constant expression depends on the ________ of the reaction. a) stoichiometry b) mechanism c) the quantities of reactants and products initially present d) temperature e) stoichiometry and mechanism 3)Given the following reaction...
For each of the following changes at equilibrium, indicate whether the equilibrium shifts in the direction...
For each of the following changes at equilibrium, indicate whether the equilibrium shifts in the direction of products, reactants, or does not change: CaCO3(s)+heat⇌CaO(s)+CO2(g) 1) increasing the temperature shifts equilibrium in the direction of the reactants does not change shifts equilibrium in the direction of the products 2) decreasing the volume of the container shifts equilibrium in the direction of the reactants shifts equilibrium in the direction of the products does not change 3) adding a catalyst shifts equilibrium in...
Given the following reaction: heat + CaCO3(s) <----> CaO(s) + CO2(g) a. In which direction, if...
Given the following reaction: heat + CaCO3(s) <----> CaO(s) + CO2(g) a. In which direction, if any, will the equilibrium shift when the pressure of CO2 is increased? b. In which direction, if any, will the equilibrium shift if the temperature is decreased? c. In which direction, if any, will the equilibrium shift if the amount of CaCO3 is increased?
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g)...
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g) K=[C2H6]2[O2]7 / [CO2]4[H2O]6 K=[CO2]4 / [C2H6]2[O2]7 K=K=[CO2]4[H2O]6 / [C2H6]2[O2]7 K=[CO2][H2O] / [C2H6]2[O2] B.)Consider the chemical equation and equilibrium constant at 25∘C: H2(g)+I2(g)⇌2HI(g) , K=6.2×102 Calculate the equilibrium constant for the following reaction at 25∘C: HI(g)⇌12H2(g)+12I2(g) Express the equilibrium constant to two significant figures. C.) Consider the following reaction and corresponding value of Kc: H2(g)+Br2(g)⇌2HBr(g) , Kc=1.9×1019 at 25∘C What is the value of Kp...
2) The volume of the system is increased for each of the following reactions below. Explain...
2) The volume of the system is increased for each of the following reactions below. Explain whether each system would shift forward, in reverse, or stay the same (no effect) and give brief explanation for your answer. (a) 2 SO2 (g) + O2 (g)2 SO3 (g) (b) H2 (g) + I2 (g)2HI (g) (c) CaCO3 (g)CaO (s) + CO2 (g) (d) Ag+ (aq) + Cl- (aq)AgCl (s)
Which of the following statements is a true statement concerning a reaction that has reached a...
Which of the following statements is a true statement concerning a reaction that has reached a state of equilibrium? A system has reached equilibrium when there are equal amounts of products and reactants present in the system. A system has reached equilibrium when the rate constant for the forward reaction equals the rate constant of the reverse reaction. A system has reached equilibrium when the reaction has stopped and no more products are formed. A system has reached equilibrium when...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
Calculate So values for the following reactions by using tabulated So values from Appendix C. (a)...
Calculate So values for the following reactions by using tabulated So values from Appendix C. (a) H2(g) + F2(g) 2 HF(g) So = -546.6 Incorrect: Your answer is incorrect. J/K (b) 2 CH4(g) C2H6(g) + H2(g) So = -12.3 Incorrect: Your answer is incorrect. J/K (c) CaCO3(s) CaO(s) + CO2(g) So = 160.5 Correct: Your answer is correct. J/K (d) Be(OH)2(s) BeO(s) + H2O(g) So = 156.80 Incorrect: Your answer is incorrect. J/K
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT