Question

If you isolate .26 g of Phenacetin, what volume of water is required to dissolve it?...

If you isolate .26 g of Phenacetin, what volume of water is required to dissolve it?

what is the solubility of Phenacetin? (g/100ml)

What is the solubility of Acetanilide (g/100ml)

**Please show work, I am confused.

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Water Solubility of Phenacetin = 0.076 g/100 mL

Water Solubility of Acetanilide = 0.56 g/100 mL

These two values are based on literature. For these values no explanation is there, these are experimental values.

Now,

Water Solubility of Phenacetin = 0.076 g/100 mL

So,

0.076 g of Phenacetin dissolves in water of volume = 100 mL'

1 g of Phenacetin dissolves in water of volume = (100 / 0.076) mL'

0.26 g of Phenacetin dissolves in water of volume = 0.26 x (100 / 0.076) mL' = 342.10 mL

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1. What is the purpose of crystallization in an organic chemistry procedure? 2. Using the solubility...
1. What is the purpose of crystallization in an organic chemistry procedure? 2. Using the solubility data you found for benzoic acid, calculate the volume of water required to dissolve 1.0 g of benzoic acid at room temperature. Calculate the volume of boiling water needed to dissolve 1.0 g of benzoic acid. 3. Explain why a Büchner or Hirsh funnel is used to isolate the final crystallized product instead of stem funnel. 4. Explain when a mixture of solvents would...
How many milliliters of boiling water are required to dissolve 3.3 g phthalic acid? If the...
How many milliliters of boiling water are required to dissolve 3.3 g phthalic acid? If the solution were cooled to l4◦C, how many grams of phthalic acid would crystallize out? (The solubility of phthalic acid in water is 0.54 g/100 mL at 14◦C and 18 g/100mL at 99◦C.
how many ml of boiling water are required to dissolve 15.0g of phthalic acid? If a...
how many ml of boiling water are required to dissolve 15.0g of phthalic acid? If a solution were cooled too 14 degrees Celsius how many grams of phthalic acid would crystallize out? Determine the percent of recovery solubility           14°C                100°C phthalic acid   0.54g/100ml   18g/ml
(Please show work) Assume you dissolve 10.35 g MgCrO4 in enough water to make 250.0 mL...
(Please show work) Assume you dissolve 10.35 g MgCrO4 in enough water to make 250.0 mL of solution. The molarity of the solution is A)0.543M B)0.128M C)0.762M D)0.254 M E) none of these
The solubility of acid A in water is 200 g/L at 100 C and 5g/L at...
The solubility of acid A in water is 200 g/L at 100 C and 5g/L at 10 C. How much mL of water do you need to dissolve 20 g of acid A at 1000 C? How much of this compound would recrystalize out of the solution upon cooling to 10 C? What technique would you use to isolate the product?
If you dissolve 2.00 g of Ca(NO3)2 in 750 g of water, what is the molality...
If you dissolve 2.00 g of Ca(NO3)2 in 750 g of water, what is the molality of the solution?
You dissolve 5 g KCl in a total volume of 200 mL. What is the final...
You dissolve 5 g KCl in a total volume of 200 mL. What is the final [KCl]?
What volume of 16M HNO3 is required to dissolve 0.50g of Cu metal? What volume is...
What volume of 16M HNO3 is required to dissolve 0.50g of Cu metal? What volume is actually used? Why is there a difference?
If I dissolve 0.500 g of sodium butanate, NaC3H7COO, MM = 110.1 g/mol, in water to...
If I dissolve 0.500 g of sodium butanate, NaC3H7COO, MM = 110.1 g/mol, in water to make a solution with a final volume of 250.0 mL, what will be the pH of this solution? I started out with finding the concentration of sodium butanate using .500 g and the MM .500g/110.2g/mol = .0182 M Ka of butanoic acid, C3H7COOH, is 1.77x10-4 I then proceeded to equate that Ka value to the [H3O+][C3H7COOH]/[NaC3H7COO] Did I set this up correctly? If not,...
“Salt” (NaCl) is known to be readily soluble in water, however there is a limit to...
“Salt” (NaCl) is known to be readily soluble in water, however there is a limit to its solubility. The solubility of salt in water at 25° C is 35.9 g/100 mL. (3 x 5 points) a. Explain what the value 35.9 g/100 mL means. b. Write this value as two conversion factors. c. What minimum volume of water would be necessary to dissolve 2.2 kg of salt? (Show work)
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT