Question

Preparation of Copper(I) Chloride Reactions: 1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2)...

Preparation of Copper(I) Chloride

Reactions:

1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l)

2) 2HNO3(aq) + Na2CO3(s) -> H2O(l) + CO2(g) + 2NaNO3(aq)

3)Cu(NO3)2(aq) + Na2CO3(s) -> CuCO3(s) + 2NANO3(aq)

4)CuCO3(s) + 2HCL(aq) -> CuCl2(aq) + H2O(l) + CO2(g)

5)CuCl2(aq) + Cu(s) -> 2CuCl(s)

Report:

Weight of Copper: 1.067g

Volume of Added Nitric Acid: 5.0mL

Total weight of added Sodium Carbonate: 3.929g

Weight of watch glass and filter paper: 51.204g

Weight of watch glass, filter paper, and CuCl Precipitate: 52.288g

How do I find the following:

Experimental Yield of CuCl:

Theoretical Yield of CuCl:

Percent Yield of CuCl:

Homework Answers

Answer #1

Mass of copper = 1.067 g

Moles of copper = (Mass / Molar mass) = ( 1.067 / 63.54) mol = 0.0167 mol

Moles of CuCl = 2 x ( moles of Cu) = 0.0335 mol

Theoretical yield of CuCl = ( Moles x Molar mass) = 3.316 g

Experimental yield of CuCl = ( Mass of watch glass, filter paper & CuCl precipitate ) - ( Mass of watche glass & filter paper)

= (52.288 - 51.204) g

= 1.084 g

Percent yield of CuCl = ( Experimental yield / Theoretical yield) x 100 % = ( 1.084 / 3.316) x 100% = 32.68%

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2) 2HNO3(aq) + Na2CO3(s) -> H2O(l)...
1) Cu(S) + 4HNO3(aq) -> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) 2) 2HNO3(aq) + Na2CO3(s) -> H2O(l) + CO2(g) + 2NaNO3(aq) 3)Cu(NO3)2(aq) + Na2CO3(s) -> CuCO3(s) + 2NANO3(aq) 4)CuCO3(s) + 2HCL(aq) -> CuCl2(aq) + H2O(l) + CO2(g) 5)CuCl2(aq) + Cu(s) -> 2CuCl(s) weight of copper 1.022g volume of added nitric acid   5.3 ml total weight of added sodium carbonate 4.873g weight of watch glass and filter paper 25.372g Weight of watch glass, filter paper, and CuCl precipitate 53.650 g What is...
PbCO3(s) + 2HNO3(aq) -> Pb(NO3)2(aq) + H2O(l) + CO2(g) Pb(NO3)2(aq) + 2HCl(aq) -> 2HNO3(aq) + PbCl2(s)...
PbCO3(s) + 2HNO3(aq) -> Pb(NO3)2(aq) + H2O(l) + CO2(g) Pb(NO3)2(aq) + 2HCl(aq) -> 2HNO3(aq) + PbCl2(s) (A) If a student starts with 4.000 g of lead(II) carbonate for the first reaction and all other reagents are added in excess, what is the theoretical yield of lead(II) chloride solid? (B) If the student isolates 3.571 g of lead(II) chloride, what is the percent yield?
3. Cu(s) + 4HNO3(aq) --> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) a)Write the net ionic equation for...
3. Cu(s) + 4HNO3(aq) --> Cu(NO3)2(aq) + 2NO2(g) + 2H2O(l) a)Write the net ionic equation for the reaction of concentrated nitric acid with solid copper b) calculate the volume of concentrated nitric acid (16M) required to react with 0.37 g of Cu(s) c) If you use 1.69 mL (an excess) of HNO3, what volume of 5.0M NaOH will you need to neutralize the solution after the copper is compeltely dissolved?
Suppose that, for the reaction Cu(NO3)2 (aq) + 2NaOH (aq) = Cu(OH)2 (s) + 2NaNO3 (aq)...
Suppose that, for the reaction Cu(NO3)2 (aq) + 2NaOH (aq) = Cu(OH)2 (s) + 2NaNO3 (aq) , you have not added enough sodium hydroxide to precipitate all the copper as copper hydroxide. a) How could you tell that not all the copper had precipitated? b) What effect would this have on your final yield?
Cu(s) + HNO3(aq) -> Cu^2+(aq)+ NO2(g) +H2O (l) Balance the reaction of copper metal with nitric...
Cu(s) + HNO3(aq) -> Cu^2+(aq)+ NO2(g) +H2O (l) Balance the reaction of copper metal with nitric acid using the half- reaction method. Give the balanced half- reactions as well as the total balanced chemical equation. Which elements are changing oxidation states in this reaction?
Step 1) Cu (s) + 4 HNO3 -> Cu^(2+) + 2 NO3^(-) + 2 NO2 +...
Step 1) Cu (s) + 4 HNO3 -> Cu^(2+) + 2 NO3^(-) + 2 NO2 + 2 H2O Cu^(2+) + 6 H2O -> Cu(H2O)6 &^(2+) Description: Weight .49 of Cu wire and record . Under the heat add roughly 5 ML HNO3(nitric acid). When CU is dissolved add 10 mL of DI H2O. Step2) Cu(H2O)6 &^(2+) + 2 NaOH -> Cu(OH)3 + 6 H2O Description: Add 6 MNaOH drop wise while stirring. Stop when litmus paper turns blue. Step3) Cu(OH)3...
[Cu(H2O)6 2+ + 2OH-(aq) = [Cu(OH)2(H2O)4]+2 (s) + 2H2O(1) How will equilibrium shift if NaOh is...
[Cu(H2O)6 2+ + 2OH-(aq) = [Cu(OH)2(H2O)4]+2 (s) + 2H2O(1) How will equilibrium shift if NaOh is added? How will it shift if concentrated NH3 is added? Cr2O7-2 (aq) + H2O (l)   2CrO4-2 (aq) + 2H+1 (aq) H2O How will it shift if 6M HNO3 is added? How will it shift if 6M NaOH is added? How will it shift if 0.1 M BaCl2? How will it shift if 0.1 M BaCl2 is added? How will it shift if 0.1 M BaCl2...
Balance each of the following skeletal equations: (a) Al(s) + Cl2(g) → AlCl3(s) (b) Pb(NO3)2(aq) +...
Balance each of the following skeletal equations: (a) Al(s) + Cl2(g) → AlCl3(s) (b) Pb(NO3)2(aq) + K2CrO4(aq) → PbCrO4(aq) + KNO3(aq) (c) Li(s) + H2O(l) → LiOH(aq) + H2(g) (d) C6H14(g) + O2(g) → CO2(g) + H2O(g)
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Procedure Reaction 1: Dissolving the Copper 1. Obtain a clean, dry, glass centrifuge tube. 2. Place...
Procedure Reaction 1: Dissolving the Copper 1. Obtain a clean, dry, glass centrifuge tube. 2. Place a piece of copper wire in a weighing paper, determine the mass of the wire and place it in the centrifuge tube. The copper wire should weigh less than 0.0200 grams. 3. In a fume hood, add seven drops of concentrated nitric acid to the reaction tube so that the copper metal dissolves completely. Describe your observations in the lab report. (Caution, Concentrated nitric...