Question

The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield....

The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.15g of butanoic acid and excess ethanol?

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

molar mass of butyrate = 116.16 gram/mol

molar mass of butanoic acid = 88.11 gram/mol

theriticallly 88.18 grams of butanoic acid will give 116.16 grams of butyrate

7.15 grams of butanoic acid will give how much

7.15 x 116.16 / 88.18

= 9.148 grams should get this is theritical yield

but actually 78.0% is the yield

actuall yield / theritical yield x 1000 = 78.0

actul yield = 78.1 x theritical yield / 100

= 78.1 x 9..148 / 100

= 7.35 grams butyrate will produce

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
± Manipulating Theoretical, Actual, and Percent Yields Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly...
± Manipulating Theoretical, Actual, and Percent Yields Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 7.95 g of butanoic acid and excess ethanol, how...
Given 7.15g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be...
Given 7.15g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield?
1. How many grams of NH3 can be produced from 4.93 mol of N2 and excess...
1. How many grams of NH3 can be produced from 4.93 mol of N2 and excess H2. 2. How many grams of H2 are needed to produce 11.87 g of NH3? 3. How many molecules (not moles) of NH3 are produced from 7.69×10−4 g of H2?
.Rubidium nitrate reacts with cobalt (III) sulfide to yield rubidium sulfide and cobalt (III) nitrate a....
.Rubidium nitrate reacts with cobalt (III) sulfide to yield rubidium sulfide and cobalt (III) nitrate a. If two moles of cobalt (III) sulfide react with excess rubidium nitrate, how many grams of cobalt (III) nitrate will be produced? b. How many grams of rubidium nitrate would be required to produce 6.83*1048 formula units of cobalt (III) nitrate? c. If your experiment yielded 915.25 g of cobalt (III) nitrate, determine the percent yield?
1 ton of TNT can produce 4.6 x 109 J of energy. A chemist wants to...
1 ton of TNT can produce 4.6 x 109 J of energy. A chemist wants to know how to obtain this much energy from acetylene (C2H2) and Oxygen (O2). How much acetylene and Oxygen would be required? Provide the name and structure of the "TNT". Reaction between Acetylene and Oxygen: ΔH= -2510 KJ
How many grams of magnesium nitrate can be produced from 50.0 mL of a 2.0 mol/L...
How many grams of magnesium nitrate can be produced from 50.0 mL of a 2.0 mol/L nitric acid solution reacting with excess magnesium carbonate?
1) How many grams of NH3 can be produced from 4.48 mol of N2 and excess...
1) How many grams of NH3 can be produced from 4.48 mol of N2 and excess H2. Express your answer numerically in grams. 2) How many grams of H2 are needed to produce 11.93 g of NH3? Express your answer numerically in grams. 3)How many molecules (not moles) of NH3 are produced from 4.38×10−4 g of H2? Express your answer numerically as the number of molecules.
In the following chemical reaction, how many moles of O2 are needed to produce 2.8 mol...
In the following chemical reaction, how many moles of O2 are needed to produce 2.8 mol of CO2? C2H6 + O2 → CO2 + H2O? How many moles of methane are produced when 36.6 moles of carbon dioxide gas react with excess hydrogen gas? How many moles of hydrogen gas would be needed to react with excess carbon dioxide to produce 53.6 moles of water vapor? Plants convert carbon dioxide and water to glucose (C6H12O6) and oxygen in the process...
1. The percent yield for the reaction PCl3 + Cl2 → PCl5 is 62.6 percent. What...
1. The percent yield for the reaction PCl3 + Cl2 → PCl5 is 62.6 percent. What mass of PCl5 would be expected from the reaction of 32.1 grams of PCl3 with excess chlorine? 2. Balance the chemical equation for the important industrial process: C2H4 + O2 + HCl → C2H4Cl2 + H2O. Given 675.0 kg of C2H4, calculate how many kg of C2H4Cl2 can be produced. 3. Calculate the number of moles in 2.75 μg of Te.
1.) Use the equation given to solve the following problems: How many moles of AgNO3 would...
1.) Use the equation given to solve the following problems: How many moles of AgNO3 would be required to react with 1.0 mol of Na3PO4? How many moles of NaNO3 can be produced from 0.30 mol of Na3PO4? What weight of Ag3PO4 can be produced from 4.00 grams of AgNO3? If you have 8.44 grams of Na3PO4, what weight of AgNO3 will be needed for complete reaction? If you have 8.44 grams Na3PO4, what weight of AgNO3 will be needed...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT