Question

The mass action expression (MAE) for the following reaction is equal to what? Ca(OH)2 (s) +...

The mass action expression (MAE) for the following reaction is equal to what?

Ca(OH)2 (s) + CO32-(aq) <---> CaCO3(s) + OH- (aq)

[CaCO3][OH-]/[Ca(OH)2][CO32-]

[OH-]/[CO32-]

[Ca(OH)2][CO32-]/[CaCO3][OH-]/

[CO32-]/[OH-]
Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

The mass action expression (MAE) for the following reaction.

Ca(OH)2 (s) + CO32-(aq) <---> CaCO3(s) + OH- (aq)

mass action expression (MAE) = [Concentration of products/concentration of reactants]

                                                = [CaCO3][OH-]/[Ca(OH)2][CO32-]

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
In the reaction: Ca(OH)2 (aq) + 2HCl (aq) —> CaCl2 (aq) + 2H2O (l) a) What...
In the reaction: Ca(OH)2 (aq) + 2HCl (aq) —> CaCl2 (aq) + 2H2O (l) a) What is the mole ratio of OH- to Ca^2+? b) What is the experimental formula?
Consider the reaction: Ca(s) + 2 H2O(ℓ) → Ca(OH)2(aq) + 2H2(g) ΔfH°(kJ/mol) 0 -285.83 -1002.82 0...
Consider the reaction: Ca(s) + 2 H2O(ℓ) → Ca(OH)2(aq) + 2H2(g) ΔfH°(kJ/mol) 0 -285.83 -1002.82 0 S°(J/K·mol) 41.59 69.95 -74.5 130.7 What are the values of ΔH°, ΔS° and ΔG° ΔH° =   kJ/mol ΔS° =   J/mol·K ΔG° =   kJ/mol
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn=...
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn= -285kJ Ca(OH)2(s)--CaO(s)+H2O(l) Hrxn= 64kJ 2Ca(s)+O2(g)--2CaO(s) Hrxn= -1270kJ
Electrochemistry Given the following cell diagram C(gr)|SO4-2(aq), SO3-2(aq), OH-(aq)||MnO4-(aq),OH-(aq)|MnO2(s)|C(gr) Provide: a)The anode reaction, the cathode reaction,...
Electrochemistry Given the following cell diagram C(gr)|SO4-2(aq), SO3-2(aq), OH-(aq)||MnO4-(aq),OH-(aq)|MnO2(s)|C(gr) Provide: a)The anode reaction, the cathode reaction, the #of e- transferred, overall balanced equation, the Q expression. 2. Given the following skeletal reaction (assume acidic conditions): OBr-(aq)+Cr3+(aq)-->CrO4-2(aq)+Br(l) Provide: the anode reaction, the cathode reaction, the overall balanced equation, the number of e- transferred, the Q expression, the cell diagram
how would a calcium chloride solution addition to Ca2+ (aq) + 2 OH- (aq) <->Ca(OH)2 (s)...
how would a calcium chloride solution addition to Ca2+ (aq) + 2 OH- (aq) <->Ca(OH)2 (s) affect equilibrium? What visuals would you see?
Consider the following reaction: 2HI(aq)+Ca(OH)2(aq) → 2H2O(l)+CaI2(aq) Enter the complete ionic equation for this reaction. Express...
Consider the following reaction: 2HI(aq)+Ca(OH)2(aq) → 2H2O(l)+CaI2(aq) Enter the complete ionic equation for this reaction. Express your answer as a complete ionic equation. Identify all of the phases in your answer. B. What is the net ionic equation
Ammonia is produced by the following reaction in laboratory: 2NH4Cl(s) + Ca(OH)2(s) → CaCl2(s) + 2H2O(l)...
Ammonia is produced by the following reaction in laboratory: 2NH4Cl(s) + Ca(OH)2(s) → CaCl2(s) + 2H2O(l) + 2NH3(g) In one reaction, 4.0 kg of ammonium chloride is heated at 529 °C in a 5.0-L vessel. The pressure of NH3 is 0.16 bar after 8.0 minutes. a) What is the average rate of NH3 production in mol/min during the 8-minute interval? b) How many moles of ammonium chloride consumed in the 8-minute interval?
Calculate the equilibrium constant for the following reaction. Zn(OH)2(s) + 2CN-(aq) <--->Zn(CN)2(s) + 2 OH-(aq) Does...
Calculate the equilibrium constant for the following reaction. Zn(OH)2(s) + 2CN-(aq) <--->Zn(CN)2(s) + 2 OH-(aq) Does the equilibrium lie predominately to the left or to the right? Can zinc hydroxide be transformed into zine cyanide by adding a soluble salt of the cyanide ion?Calculate the equilibrium constant for the following reaction.
Consider the following reaction CaSO4 (s) ------- Ca +2 (aq) + SO4 -2 (aq) A. Calculate...
Consider the following reaction CaSO4 (s) ------- Ca +2 (aq) + SO4 -2 (aq) A. Calculate delta H B. Calculate delta S C. Calculate delta G at 25 C
Balance the following reaction assuming acidic solution: Fe(OH)2(s) + CrO42-(aq) --> Fe2O3(s) + Cr(OH)4-(aq) balance the...
Balance the following reaction assuming acidic solution: Fe(OH)2(s) + CrO42-(aq) --> Fe2O3(s) + Cr(OH)4-(aq) balance the reaction with the smallest whole number coefficient.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT