Question

( True or false) According to Arrhenius equation, the higher the activation energy, the lower the...

( True or false) According to Arrhenius equation, the higher the activation energy, the lower the rate of the reaction.?

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Arrhenius' equation gives the dependence of the rate constant of a chemical reaction on the absolute temperature (in kelvins), where is the pre-exponential factor, is the activation energy, and is the universal gas constant.

When Ea increases k decreases and rate of reaction also decreases.

Answer: True

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
± The Arrhenius Equation The Arrhenius equation shows the relationship between the rate constant k and...
± The Arrhenius Equation The Arrhenius equation shows the relationship between the rate constant k and the temperature T in kelvins and is typically written as k=Ae−Ea/RT where R is the gas constant (8.314 J/mol⋅K), A is a constant called the frequency factor, and Ea is the activation energy for the reaction. However, a more practical form of this equation is lnk2k1=EaR(1T1−1T2) which is mathmatically equivalent to lnk1k2=EaR(1T2−1T1) where k1 and k2 are the rate constants for a single reaction...
ARRHENIUS EQUATION CALCULATIONS The activation energy for the gas phase decomposition of dinitrogen pentoxide is 103...
ARRHENIUS EQUATION CALCULATIONS The activation energy for the gas phase decomposition of dinitrogen pentoxide is 103 kJ. N2O52 NO2 + 1/2 O2 The rate constant at 319 K is 5.59×10-4 /s. The rate constant will be 6.37×10-3 /s at ______ K. PART 2 The activation energy for the gas phase isomerization of isopropenyl allyl ether is 123 kJ. CH2=C(CH3)-O-CH2CH=CH2CH3COCH2CH2CH=CH2 The rate constant at 432 K is 2.68×10-4 /s. The rate constant will be______ /s at 474 K.
Which if the following statements is incorrect? A. Reaction with higher activation energy has higher rate...
Which if the following statements is incorrect? A. Reaction with higher activation energy has higher rate constant B. The catalyst does not affect the equilibrium of a reaction C. Half-life period of a first order reaction is independent of the final concentration D. In an endothermic reaction, the activation energy of the reverse reaction is lower than that of the forward reaction.
Define the following terms: transition state and activation energy. On a molecular level, how does an...
Define the following terms: transition state and activation energy. On a molecular level, how does an increase in temperature lead to an increase in reaction rate? Give the Arrhenius equation. Show how the Arrhenius equation can be used to calculate the activation energy and pre-exponential factor.
± The Arrhenius Equation The Arrhenius equation shows the relationship between the rate constant k and...
± The Arrhenius Equation The Arrhenius equation shows the relationship between the rate constant k and the temperature T in kelvins and is typically written as k=Ae−Ea/RT where R is the gas constant (8.314 J/mol⋅K), A is a constant called the frequency factor, and Eais the activation energy for the reaction. However, a more practical form of this equation is lnk2k1=EaR(1T1−1T2) which is mathmatically equivalent to lnk1k2=EaR(1T2−1T1) where k1 and k2 are the rate constants for a single reaction at...
] Using the Arrhenius equation, determine the following effects on the rate of a reaction. Which...
] Using the Arrhenius equation, determine the following effects on the rate of a reaction. Which increase the rate, and which decrease the rate? (1) Increasing the temperature of the reaction (2) Increasing the activation energy of a reaction (3) Decreasing the temperature of the reaction (4) Adding a catalyst to the reaction
True/False - The value of a European call is higher for lower strike prices.​ - According...
True/False - The value of a European call is higher for lower strike prices.​ - According to Put-Call Parity, a stock is equivalent to a long call, short put and long risk-free bond.​
explain a procedure/analysis to measure activation energy (Ea) experimentally by using the Arrhenius expression for the...
explain a procedure/analysis to measure activation energy (Ea) experimentally by using the Arrhenius expression for the temperature dependence of the rate constant k k(T)=Ae-Ea/RT
how does enzymes lower the activation energy of reaction but do not change free energy of...
how does enzymes lower the activation energy of reaction but do not change free energy of the reaction?
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in...
The Arrhenius equation shows the relationship between the rate constant k and the temperature T in kelvins and is typically written as k=Ae−Ea/RT where R is the gas constant (8.314 J/mol⋅K), A is a constant called the frequency factor, and Ea is the activation energy for the reaction. However, a more practical form of this equation is lnk2k1=EaR(1T1−1T2) which is mathmatically equivalent to lnk1k2=EaR(1T2−1T1) where k1 and k2 are the rate constants for a single reaction at two different absolute...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT