Question

What class of reaction occurs when you add SnCl2 to a mixture of Fe(NO3)3 and NH4SCN?...

What class of reaction occurs when you add SnCl2 to a mixture of Fe(NO3)3 and NH4SCN? What is the net ionic equation of the chemical reaction that causes the equilibrium shift as well?

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

A reduction reaction occurs.

Tin(II) reduces Fe(III) to Fe(II). Hence the concentration of Fe(III) decreases. So according to Le Chatelier principle, More ferric thiocyanate will dissociate to form Fe(III).

answered by: anonymous
0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
What the net ionic reaction for zn+mg(no3)2, fe +mg(no3)2, cu+mg(no3)2,Al+mg(no3)2, Fe+Zn(no3)2 , Cu+Zn(no3)2, Cu+Fe(no3)3
What the net ionic reaction for zn+mg(no3)2, fe +mg(no3)2, cu+mg(no3)2,Al+mg(no3)2, Fe+Zn(no3)2 , Cu+Zn(no3)2, Cu+Fe(no3)3
Please answer the following questions: 1) Balance this equation: ____ LiOH + ____ Fe(NO3)3 --> ____...
Please answer the following questions: 1) Balance this equation: ____ LiOH + ____ Fe(NO3)3 --> ____ LiNO3 + ____ Fe(OH)3 2) What type of chemical reaction is taking place in this process? 3) If I perform this reaction by combining 25.0g of LiOH with an excess of Fe(NO3)3, how much Fe(OH)3 will I be able to make? 4) If 47.5g of Fe(OH)3 are actually made, what is my percent yield for this reaction? ****Having a hard time solving this, would...
Wrige the net ionic equation for the reaction that occurs when ammonia is added to a...
Wrige the net ionic equation for the reaction that occurs when ammonia is added to a ni(no3)2 solution? What is the concentration of Ni2+ (aq) ion in 0.045 M Ni(NO3)2 solution that is also 1 M NH3 (k for Ni(NH3)6 = 5.5E5?
Enter the complete ionic equation when Li3PO4 and AgNO3 are mixed. Express your answer as a...
Enter the complete ionic equation when Li3PO4 and AgNO3 are mixed. Express your answer as a complete ionic equation. Identify all of the phases in your answer. Enter noreaction if no reaction occurs. Enter the net ionic equation when Li3PO4 and AgNO3 are mixed. Express your answer as a net ionic equation. Identify all of the phases in your answer. Enter noreaction if no reaction occurs. Enter the complete ionic equation when K2SO4 and Na2CO3 are mixed. Express your answer...
In a lab experiment where we add NaSCN and Fe(NO3)3 together. Give two compounds whose aqeuous...
In a lab experiment where we add NaSCN and Fe(NO3)3 together. Give two compounds whose aqeuous solutions would cause the equilibrium to shift to form . 1) More products. 2) More reactants. (DO NOT INCLUDE COMPOUNDS USED IN EXPERIMENT )
1. Write a net ionic equation for the reaction that occurs when aqueous solutions of barium...
1. Write a net ionic equation for the reaction that occurs when aqueous solutions of barium hydroxide and hypochlorous acid are combined. 2. Write a net ionic equation for the reaction that occurs when excess hydroiodic acid and potassium carbonate (aq) are combined. 3. Write a net ionic equation for the reaction that occurs when ammonium sulfide and excess hydrochloric acid (aq) are combined. 4. Write a net ionic equation for the reaction that occurs when barium sulfite (s) and...
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write a net ionic equation for the reaction that occurs when aqueous solutions of barium hydroxide...
Write a net ionic equation for the reaction that occurs when aqueous solutions of barium hydroxide and perchloric acid are combined. (Use H+ instead of H3O+.) Write a net ionic equation for the reaction that occurs when aqueous solutions of hydrofluoric acid and sodium hydroxide are combined. Write a net ionic equation for the reaction that occurs when aqueous solutions of ammonia and perchloric acid are combined. Write a net ionic equation for the reaction that occurs when aqueous solutions...
Fe(NO3)3. 9H2O in 0.5M HNO3 forms a colorless hexa-aquocomplex with the chemical formula {Fe(H2O)6)3+ (aq) This...
Fe(NO3)3. 9H2O in 0.5M HNO3 forms a colorless hexa-aquocomplex with the chemical formula {Fe(H2O)6)3+ (aq) This complex can then undergo an equilibrium reaction with pottasium thiocynate (KSCN) to form a red complex with the chemical formula {Fe(H2O)5SCN}2+ (aq). In order to make this reaction occur, the two chemicals need to be mixed with 0.5M nitric acid. This equilibrium reaction is shown below: {Fe(H2O)6}3+ (aq) + SCN-(aq) <--------> {Fe(H2O)5SCN}2+(aq) + H2O (l) a) When recording the absorbance values, what should be...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT