Question

In Experiment 2: Separation of a Heterogeneous Mixture, a redox reaction was performed. Which equation below...

In Experiment 2: Separation of a Heterogeneous Mixture, a redox reaction was performed. Which equation below describes that reaction. (a) CuSO4(aq) + Zn(s) → ZnSO4(aq) + Cu(s) (b) SiO2(s) + 2CuSO4 → 2Cu(s) + Si(SO4)2(aq) (c) SiO2(s) → Si(s) + O2(g) (d) Cu(s) + ZnSO4(aq) → CuSO4(aq) + Zn(s) (e) SiO2(s) + 2CuSO4(aq) → Si(SO4)2(aq) + 2CuO(s)

Homework Answers

Answer #1

Equation ( a) describes the reaction as here Zn undergoes oxidation and gets converted to Zinc sulphate. Copper sulphate undergoes reduction & form Cu.

In Equation b even though Copper has undergone reduction from Copper Sulphate to Copper but Silicon dioxide has not undergone oxidation because its oxidation state has not changed . It has remained the same i.e +4 in silicon dioxide as well as in silicon sulphate.Same explanation is valid for equation e.

In equation C on reactant side its not heterogenous mixture, its just single compound i.e silicon dioxide

Equation d is the wrong reaction as Copper cannot displace Zinc from its solution. According to the electrochemical series we know that copper is less reactive than zinc and it lies below zinc in the activity series so the reaction doesn't takes place.

Therefore Answer is equation a

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
  The chemical equation for the reaction between zinc and copper (II) sulfate is shown below. Use...
  The chemical equation for the reaction between zinc and copper (II) sulfate is shown below. Use the chemical equation to explain your observations upon mixing the two. 5 pts Zn(s) + CuSO4(aq) → Cu(s) + ZnSO4(aq)
I am struggling to understand how to find what is the reagent used in a reaction....
I am struggling to understand how to find what is the reagent used in a reaction. I have these 4 problems and I must figure out what "reagent used in reaction". My classmate described the reagent as the ractant that is entirly consumed when a reaction goes to completion. It determines how much of a product you can make. Cu(s) + 4 HNO3 (aq) –> Cu(NO3)2 (aq) + 2NO2 (g) + 2H20 Cu(NO3)2 (aq) + 2NaOH (aq) –>Cu(OH)2 (s) +...
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Calculate the standard molar enthalpy, entropy and free energy for the following reaction using ÆH of...
Calculate the standard molar enthalpy, entropy and free energy for the following reaction using ÆH of and ÆS o values. Zn(s) + CuSO4 (aq) ⇔ ZnSO4 (aq) + Cu(s) b. What is standard cell potential for the above reaction. Use equation (2).
4a. Use the Nernst equation to calculate the cell voltage (E) for the following redox reaction:...
4a. Use the Nernst equation to calculate the cell voltage (E) for the following redox reaction: i. Fe3+(aq)+Cu(s)→Cu2+(aq)+Fe2+(aq), given that [Fe3+]=0.05 and [[Cu2+]=0.125M at 25°C, and Fe3++e→Fe2+             E0=0.77 V Cu2+2e→Cu                   E0=0.34 V 4b. Use the information provided in question 4a to calculate the change in free energy (ΔG) and change in entropy (ΔS) for the redox reaction: i. Fe3+(aq)+Cu(s)→Cu2+(aq)+Fe2+(aq) What do the ΔG and ΔS values indicate about the spontaneity of the redox reaction?
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO +...
1: When the chemical equation, below, is properly balanced the coefficient of N2 is… NO + NH3   ⟶ N2 + H2O A: 4 B: 5 C: 6 D: 3 E: 2 2:Which combination of reactants dissolved in water is most likely to produce a precipitate as a product in a “double-displacement”-type reaction? A: (NH4)3PO4 + K2CrO4 B: AgCH3CO2 + KBr C: KI + Zn(NO3)2 D: Fe(NO3)3 + LiCl E: NaBr +MgCl2 3: Which of the following is not a redox...
CAn someone please let me know if my answers are correct Exercise 1: Construction of a...
CAn someone please let me know if my answers are correct Exercise 1: Construction of a Galvanic Cell Data Table 1. Spontaneous Reaction Observations. Metal in Solution Observations Zinc in Copper Sulfate Zinc turned black Copper in Zinc Sulfate There was no change Data Table 2. Multimeter Readings. Time (minutes) Multimeter Reading (Volts) 0 1.08 15 1.08 30 1.08 45 1.08 60 1.08 75 1.08 90 1.08 105 1.08 120 1.05 135 1.04 Data Table 3. Standard Cell Potential. Equation...
Consider the Daniell cell, for which the overall cell reaction is Zn(s)+Cu2+(aq)⇌Zn2+(aq)+Cu(s) The concentrations of CuSO4...
Consider the Daniell cell, for which the overall cell reaction is Zn(s)+Cu2+(aq)⇌Zn2+(aq)+Cu(s) The concentrations of CuSO4 and ZnSO4 are 2.20×10−3 m and 1.10×10−3 m , respectively. Part A Calculate E setting the activities of the ionic species equal to their molalities. Express your answer to four significant figures and include the appropriate units. E = ? Part B Calculate γ±,ZnSO4 for the half-cell solutions using the Debye-Huckel limiting law. Express your answer using three significant figures. γ±,ZnSO4 = ? Part...
Determine if the highlighted element in the first compound of each reaction was oxidized or reduced....
Determine if the highlighted element in the first compound of each reaction was oxidized or reduced. (a) Mg(s) + NiCl2(aq) ⟶ MgCl2(aq) + Ni(s) (b) PCl3(l) + Cl2(g) ⟶ PCl5(s) (c) C2 H4(g) + 3O2(g) ⟶ 2CO2(g) + 2H2 O(g) (d) Zn(s) + H2 SO4(aq) ⟶ ZnSO4(aq) + H2(g) (e) 2K2 S2 O3(s) + I2(s) ⟶ K2 S4 O6(s) + 2KI(s) (f) 3Cu(s) + 8HNO3(aq) ⟶ 3Cu(NO3)2(aq) + 2NO(g) + 4H2 O(l)
which of the follow is a redox reaction? a.) Ba2+ (aq) + SO42- (aq) ----> BaSO4...
which of the follow is a redox reaction? a.) Ba2+ (aq) + SO42- (aq) ----> BaSO4 (s) b.) K2Cr2O7 (aq) + 2 KOH (aq) ----> 2 K2CrO4 (aq) + H2O (l) c.) Na2CO3 (s) + 2 HCl (aq) ----> 2 NaCl (aq) + CO2 (g) + H2O (l) d.) 2 Na (g) + Cl2 (g) ----> 2 NaCl (s) e.) H2O (l) ----> H+ (aq) + OH- (aq) I know the answer is "d" however I do not know why....
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT