Question

Compute the equilibrium constant at 25 °C for the following reaction: SnO2(s) + 2 CO(g) ...

Compute the equilibrium constant at 25 °C for the following reaction:

SnO2(s) + 2 CO(g)  2 CO2(g) + Sn(s, white)

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

SnO2(s) + 2 CO(g) -------> 2 CO2(g) + Sn(s, white) : ΔG = >

ΔG = ΔG0fproducts – ΔG0freactants

ΔG = [(2x ΔG0fCO2(g) )+ ( ΔG0fSn(s) )]- [( 2 x ΔG0fCO(g )+ ( ΔG0fSnO2 (s) )]

    = [(2x(-386.01)+0] - [(2x(-137.3))+ (-519.65)] kJ/mol

    = +22.23 kJ

Also ΔG = -RT lnK

Where R = gas constant = 8.314x10-3 kJ/mol-K

T = Temperature = 25 oC = 25 + 273 = 298 K

K = Equilibrium constan t = ?

Plug the values we get ln K = - ΔG /(RT) = -8.97

K = e-8.97 = 1.27x10-4

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Compute the equilibrium constant at 25 ∘ C for the reaction between Fe 2+ (aq) and...
Compute the equilibrium constant at 25 ∘ C for the reaction between Fe 2+ (aq) and Zn(s) which form Fe(s) and Zn 2+ (aq)
Consider the following reversible heterogenous reaction: C(s)+CO2(g) <--> 2CO(g) When equilibrium is reached at a certain...
Consider the following reversible heterogenous reaction: C(s)+CO2(g) <--> 2CO(g) When equilibrium is reached at a certain temperature, the total pressure of the system is found to be 5.17 atm. If the equilibbrium constant Kp for this reaction is equal to 1.67 at this temperature, calculate the equilibrium partial pressures of CO2 and CO gases.
The Equilibrium constant Kc for the reaction H2(g) + CO2(g) -> H2O(g) + CO(g) is 4.2...
The Equilibrium constant Kc for the reaction H2(g) + CO2(g) -> H2O(g) + CO(g) is 4.2 at 1650 deg C. Initially .74 mol H2 and .74 mol CO2 are injected into a 4.6-L flask. Calculate the concentration of each species at equilibrium. H2= CO2 = H2O= CO=
The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g)...
The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g) + H2(g) ⇌ CO(g) + H2O(g) If 0.65 moles of CO2 and 0.65 moles of H2 are introduced into a 1.0-L flask, what will be the concentration of CO when equilibrium is reached? The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g) + H2(g) ⇌ CO(g) + H2O(g) If 0.65 moles of CO2 and 0.65 moles of...
The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g)...
The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g) + H2(g) ⇌ CO(g) + H2O(g) If 0.35 moles of CO2 and 0.35 moles of H2 are introduced into a 1.0-L flask, what will be the concentration of CO when equilibrium is reached? The equilibrium constant, K c, is equal to 1.4 at 1200° K for the reaction: CO2(g) + H2(g) ⇌ CO(g) + H2O(g) If 0.35 moles of CO2 and 0.35 moles of...
The equilibrium constant Kp for the reaction C(s)+H2O(g)?CO(g)+H2(g) is 2.44 at 1000 K. What are the...
The equilibrium constant Kp for the reaction C(s)+H2O(g)?CO(g)+H2(g) is 2.44 at 1000 K. What are the equilibrium partial pressures of H2O, CO, and H2 if the initial partial pressures are PCO= 1.25 atm, and PH2= 1.60 atm? What is the equilibrium partial pressure of H2O? What is the equilibrium partial pressure of CO? What is the equilibrium partial pressure of H2?
The equilibrium constant Kc for the reaction H2(g) + CO2(g) = CO(g) + H20(g) is 5.1...
The equilibrium constant Kc for the reaction H2(g) + CO2(g) = CO(g) + H20(g) is 5.1 at 1700 C. Initially 0.65 mol of H2, 0.1 mol of CO and 0.65 mol of CO2 are injected into a 2.5-L flask. Calculate the concentraion of each species at equilibrium. Please show the steps so I can understand how to solve the problem. Thank you.
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g)...
A.) Express the equilibrium constant for the combustion of ethane in the balanced chemical equation. 2C2H6(g)+7O2(g)⇌4CO2(g)+6H2O(g) K=[C2H6]2[O2]7 / [CO2]4[H2O]6 K=[CO2]4 / [C2H6]2[O2]7 K=K=[CO2]4[H2O]6 / [C2H6]2[O2]7 K=[CO2][H2O] / [C2H6]2[O2] B.)Consider the chemical equation and equilibrium constant at 25∘C: H2(g)+I2(g)⇌2HI(g) , K=6.2×102 Calculate the equilibrium constant for the following reaction at 25∘C: HI(g)⇌12H2(g)+12I2(g) Express the equilibrium constant to two significant figures. C.) Consider the following reaction and corresponding value of Kc: H2(g)+Br2(g)⇌2HBr(g) , Kc=1.9×1019 at 25∘C What is the value of Kp...
The equilibrium constant for 2 CO2 (g) ⇌ 2 CO (g) + O2 (g) is 1.12x10-45...
The equilibrium constant for 2 CO2 (g) ⇌ 2 CO (g) + O2 (g) is 1.12x10-45 at room temperature. If the initial concentration of CO2 is 10 mM, what are the equilibrium concentrations of all three chemicals? The equilibrium constant is small, so you can assume x will be small.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT