Question

Write the net ionic equation (including phases) that corresponds to Fe(NO3)2(aq)+K2S(aq) right arrow FeS(s)+2KNO3(aq)

Write the net ionic equation (including phases) that corresponds to Fe(NO3)2(aq)+K2S(aq) right arrow FeS(s)+2KNO3(aq)

Homework Answers

Answer #1

Whenever a precipitate in the solid form appears only that species will be present in net ionic equation, remaining all aqueous phase ions are called as spectator ions an won't appear in net ionic equation.

In the given reaction only FeS is in solid form, hence the NIE (net ionic equation) will be

Fe2+(aq) + S2-(aq) --> FeS(s)                    ---------------------------- This is your answer my friend

Thank You So Much! Please Rate this answer as you wish.

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
3) a) Write balanced net ionic equation for the following reaction: Fe(OH)3(s)+H2SO4(aq)→? Express your answer as...
3) a) Write balanced net ionic equation for the following reaction: Fe(OH)3(s)+H2SO4(aq)→? Express your answer as a chemical equation. Identify all of the phases in your answer. b) Write balanced net ionic equation for the following reaction: HClO3(aq)+NaOH(aq)→? Note that HClO3 is a strong acid. Express your answer as a chemical equation. Identify all of the phases in your answer. 4) a) Write net ionic equation for the following reaction S8(s)+8O2(g)→8SO2(g). Express your answer as a chemical equation. Identify all...
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)
Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)
Fe(s)+CuSO4(aq)---->FeSO4(aq)+Cu(s) Write ionic equation and net ionic equation. Redox yes or no If Redox: element that...
Fe(s)+CuSO4(aq)---->FeSO4(aq)+Cu(s) Write ionic equation and net ionic equation. Redox yes or no If Redox: element that is oxidized=_____ Element that is reduced=_____ Explain Circle reaction type:combination, decomposition, single replacement, or double replacement.
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq)...
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 3- Write balanced complete ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 4- Write balanced net ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 5- Write balanced complete ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 6- Write balanced net ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 7- Write balanced complete ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) 8- Write balanced net ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) (Express your answer as a chemical equation. Identify all of the phases in your answer)
Complete ionic and net-ionic equation: 1. Fe (s) + 2HCl (aq) -> FeCl2 (aq) + H2...
Complete ionic and net-ionic equation: 1. Fe (s) + 2HCl (aq) -> FeCl2 (aq) + H2 (g) 2. Cu (s) + HCl (aq) -> ???
write a balanced net ionic equation for the reactions, if any, that occur between (a) ZnS(s)...
write a balanced net ionic equation for the reactions, if any, that occur between (a) ZnS(s) and HCl(aq); (b) K2CO3(aq) and Ca(NO3)2(aq); (c) Fe(NO3)2(aq) and H2S(aq); (d) Bi(OH)3(s) and HNO3(aq). Please show me molecular to complete ionic to net ionic as I need to understand how to do this, not just the answers.
Write the balanced complete ionic equation for the reaction HI(aq)+CsOH(aq)→ Write the balanced net ionic equation...
Write the balanced complete ionic equation for the reaction HI(aq)+CsOH(aq)→ Write the balanced net ionic equation for the reaction HI(aq)+CsOH(aq)→ Write the balanced complete ionic equation for the reaction HCHO2(aq)+NaOH(aq)→ Write the balanced net ionic equation for the reaction HCHO2(aq)+NaOH(aq)→ Write the balanced complete ionic equation for the reaction HC2H3O2(aq)+LiOH(aq)→ Write the balanced net ionic equation for the reaction HC2H3O2(aq)+LiOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your answer.
Write a net ionic equation: Na2SO4 + K3PO4 And next Ni(NO3)3(aq) + KBr(aq)
Write a net ionic equation: Na2SO4 + K3PO4 And next Ni(NO3)3(aq) + KBr(aq)
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT