Question

Write the net ionic equations for the reaction of CuSO4(aq) with 1. Zn(s) 2. Mg(s) 3....

Write the net ionic equations for the reaction of CuSO4(aq) with 1. Zn(s) 2. Mg(s) 3. Fe(s) indicate the oxidizing agent and reducing agent in each of the three reactions

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

CuSO4 (aq) + Zn (s) -----> Cu(s) + ZnSO4 (aq)

oxidising agent : CuSO4

Reducing agent : Zn

Net ionic equation

Cu2+ (aq) + Zn (s) -----> Cu(s) + Zn2+ (aq)

CuSO4 (aq) + Mg (s) -----> Cu(s) + MgSO4 (aq)

oxidising agent : CuSO4

Reducing agent : Mg

Net ionic equation

Cu2+ (aq) + Mg (s) -----> Cu(s) + Mg2+ (aq)

CuSO4 (aq) + Fe (s) -----> Cu(s) + FeSO4 (aq)

oxidising agent : CuSO4

Reducing agent : Fe

Net ionic equation

Cu2+ (aq) + Fe (s) -----> Cu(s) + Fe2+ (aq)

( oxidising agent will reduce itself and reducing agent will oxidise by itself)

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
What are the molecular equation, total ionic equation, and net ionic equation for the reactions of:...
What are the molecular equation, total ionic equation, and net ionic equation for the reactions of: a.) tin and silver nitrate b.) tin and zinc nitrate For the following reactions... what is the substance oxidized and reduced? What are the oxidizing agent and reducing agent? a.) Mg + CuSO4 ---> b.) Zn + HCl -->
Fe(s)+CuSO4(aq)---->FeSO4(aq)+Cu(s) Write ionic equation and net ionic equation. Redox yes or no If Redox: element that...
Fe(s)+CuSO4(aq)---->FeSO4(aq)+Cu(s) Write ionic equation and net ionic equation. Redox yes or no If Redox: element that is oxidized=_____ Element that is reduced=_____ Explain Circle reaction type:combination, decomposition, single replacement, or double replacement.
Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)
Write net ionic equations for the following reactions. 1.2AgNO3(aq)+Fe(s)→Fe(NO3)2(aq)+2Ag(s) 2. 2NaI(aq)+Br2(l)→2NaBr(aq)+I2(s) 3. 2AuCl3(aq)+3Sn(s)→3SnCl2(aq)+2Au(s)
What the net ionic reaction for zn+mg(no3)2, fe +mg(no3)2, cu+mg(no3)2,Al+mg(no3)2, Fe+Zn(no3)2 , Cu+Zn(no3)2, Cu+Fe(no3)3
What the net ionic reaction for zn+mg(no3)2, fe +mg(no3)2, cu+mg(no3)2,Al+mg(no3)2, Fe+Zn(no3)2 , Cu+Zn(no3)2, Cu+Fe(no3)3
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Write the net ionic equation for the reaction of Zn in HI(aq).
Write the net ionic equation for the reaction of Zn in HI(aq).
2Na+(aq)+2OH−(aq)+Zn2+(aq)+2NO3−(aq) → Zn(OH)2(s)+2Na+(aq)+2NO3−(aq) Write the net ionic equation for this precipitation reaction.
2Na+(aq)+2OH−(aq)+Zn2+(aq)+2NO3−(aq) → Zn(OH)2(s)+2Na+(aq)+2NO3−(aq) Write the net ionic equation for this precipitation reaction.
1. write the full and net ionic equations; Mg(No3)2 (ag) +Na2CO3(aq)----->MgCO3(s) +2NaNO3(aq) 2. H2SO4(aq) +2KOH(aq) ------->K2SO4(aq0...
1. write the full and net ionic equations; Mg(No3)2 (ag) +Na2CO3(aq)----->MgCO3(s) +2NaNO3(aq) 2. H2SO4(aq) +2KOH(aq) ------->K2SO4(aq0 + 2H2O(l) 3. MnCl2(aq) +(NH4)2CO3(aq)------>MnCO3(s) +2 NH4Cl(aq) 4. BaBr2(aq) +K2SO4(aq)-----> BaSO4(s) + 2KBr(aq)
write a balanced net ionic equation for the following reaction in acidic solution: Zn(s)+VO2+(aq)->Zn2+(aq)+V3+(aq)
write a balanced net ionic equation for the following reaction in acidic solution: Zn(s)+VO2+(aq)->Zn2+(aq)+V3+(aq)
1) Write the ionic and net ionic equations for the balanced chemical reaction given. Ca(NO3)2(aq) +...
1) Write the ionic and net ionic equations for the balanced chemical reaction given. Ca(NO3)2(aq) + Na2CO3(aq) CaCO3(s) + 2 NaNO3(aq) 2) Give the products of the reaction between aqueous solutions of Na3PO4 and MgCl2. Na3PO4 + MgCl2  3) How much energy is needed to raise the temperature of 49.32 g of copper metal from 23.0oC to 137.0oC?
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT