Question

Calculate the equilibrium concentrations of C2H5COO- and C2H5COOH in a solution prepare by dissolving 0.04 mole...

Calculate the equilibrium concentrations of C2H5COO- and C2H5COOH in a solution prepare by dissolving 0.04 mole of propionic acid in 150 ml of water.

Homework Answers

Answer #1

ka for propanoic acid = 1.34*10^-5

[C2H5COOH] = number of moles / volume in L

= 0.04 mol / 0.150 L

= 0.267 M

Lets write the dissociation equation of C2H5COOH

C2H5COOH -----> H+ + C2H5COO-

0.267 0 0

0.267-x x x

Ka = [H+][C2H5COO-]/[C2H5COOH]

Ka = x*x/(c-x)

Assuming small x approximation, that is lets assume that x can be ignored as compared to c

So, above expression becomes

Ka = x*x/(c)

so, x = sqrt (Ka*c)

x = sqrt ((1.34*10^-5)*0.267) = 1.892*10^-3

since c is much greater than x, our assumption is correct

so, x = 1.89*10^-3 M

[C2H5COO] = x = 1.89*10^-3 M

[C2H5COO-] = 0.267-x

= 0.267 - 1.89*10^-3

= 0.265 M

[C2H5COO] = 1.89*10^-3 M

[C2H5COO-] = 0.265 M

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
The Ka of propanoic acid (C2H5COOH) is 1.34×10−5. Calculate the pH of the solution and the...
The Ka of propanoic acid (C2H5COOH) is 1.34×10−5. Calculate the pH of the solution and the concentrations of C2H5COOH and C2H5COO− in a 0.331 M propanoic acid solution at equilibrium. pH= C2H5COOH]= [C2H5COO−]= At 25 °C,25 °C, how many dissociated H+H+ ions are there in 357 mL357 mL of an aqueous solution whose pH is 11.95?
The Ka of propanoic acid (C2H5COOH) is 1.34 x 10-5. Calculate the pH of the solution...
The Ka of propanoic acid (C2H5COOH) is 1.34 x 10-5. Calculate the pH of the solution and the concentrations of C2H5COOH and C2H5COO- in a 0.297 M propanoic acid solution at equilibrium. pH = _____ [C2H5COOH] = _____ M [C2H5COO-] = ______ M
Calculate the percent ionization of propionic acid (C2H5COOH) in solutions of each of the following concentrations...
Calculate the percent ionization of propionic acid (C2H5COOH) in solutions of each of the following concentrations (Ka is given in Appendix D in the textbook a) 0.250 M . b 7.74×10−2 M . c 2.03×10−2 M .
Calculate the concentrations of hydronium and hydroxide ions in a solution prepared by dissolving 0.798 g...
Calculate the concentrations of hydronium and hydroxide ions in a solution prepared by dissolving 0.798 g of HCl gas in enough water to make 443 mL of solution. [OH−] = [H3O+] =
Calculate the percent ionization of propionic acid (C2H5COOH) in solutions of each of the following concentrations:...
Calculate the percent ionization of propionic acid (C2H5COOH) in solutions of each of the following concentrations: Part A 0.260 M . Express your answer using two significant figures. Part B 8.19×10−2 M . Express your answer using two significant figures. Part C 2.01×10−2 M . Express your answer using two significant figures.
Calculate the pH of a buffer solution prepared by dissolving 0.200 mole of cyanic acid (HCNO)...
Calculate the pH of a buffer solution prepared by dissolving 0.200 mole of cyanic acid (HCNO) and 0.800 mole of sodium cyanate (NaCNO) in enough water to make 1.00 liters of solution. Ka(HCNO) = 2.0 x 10-4 A. 3.70 B. 4.40 C. 3.10 D. 4.30
At 25 °C, how many dissociated H+ ions are there in 327 mL327 mL of an...
At 25 °C, how many dissociated H+ ions are there in 327 mL327 mL of an aqueous solution whose pH is 11.65? Write the balanced equation for each reaction. Phases are optional. The carbonate ion (CO2−3)(CO32−) acts as a Brønsted base with water. The carbon-containing product from the first reaction acts as a Brønsted base with water. The carbon-containing product from the second reaction decomposes into carbon dioxide gas and water. The carbon-containing product from the second reaction decomposes into...
1. Calculate the percent ionization of propionic acid (C2H5COOH) in solutions of each of the following...
1. Calculate the percent ionization of propionic acid (C2H5COOH) in solutions of each of the following concentrations. Part A 2.06×10−2 M . 2. Calculate the pH at the equivalence point in titrating 0.100 M solutions of each of the following with 8.0×10−2 MNaOH. Part A hydrobromic acid (HBr) Part B chlorous acid (HClO2) Part C benzoic acid (C6H5COOH)
Use the Henderson Hasselbalch equation to calculate the pH of a buffer solution prepared by dissolving...
Use the Henderson Hasselbalch equation to calculate the pH of a buffer solution prepared by dissolving 4.200 g of sodium acetate and adding 8.5 mL of 6.0 M acetic acid in enough water to prepare 100.0 mL of solution.        
A solution was prepared by dissolving 155.0g of 245 g of water. Calculate the mole fraction...
A solution was prepared by dissolving 155.0g of 245 g of water. Calculate the mole fraction of KCl(the formula weight of KCl is 74.6 g/mol. The formula weight of water is 18.0g/mol). Express the mole fraction of KClto two decimal places.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT