Question

Use appendix C to calculate ∆So for the following a) CH4 (g) + 2 O2 (g)...

Use appendix C to calculate ∆So for the following a) CH4 (g) + 2 O2 (g) → CO2 (g) + 2 H2O (g)
b) 6 CO2 (g) + 6 H2O (l) → C6H12O6 (s) + 6 O2 (g)
c) P4O10 (s) + 6 H2O (l) → 4 H3PO4 (aq)
d) NH3 (g) + HCl (g) → NH4Cl (s)

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

dS:

a) CH4 (g) + 2 O2 (g) → CO2 (g) + 2 H2O (g)

dS = Sproducts - Sreactants

dS = (CO2 + 2H2O) -(CH4+2O2)

dS = (213.8+ 2*188.8) -(186.3+2*205.2)

dS= -5.3 J/molK

b) 6 CO2 (g) + 6 H2O (l) → C6H12O6 (s) + 6 O2 (g)

dS = Sproducts - Sreactants

dS = (C6H12O6 + 6*O2) - (6*CO2 + 6*H2O)

dS = (C6H12O6 + 6*O2) - (6*213.8+ 6*70.0)

dS = (212+ 6*205.5) - (6*213.8+ 6*70.0)

dS = -257.8 J/molK

c) P4O10 (s) + 6 H2O (l) → 4 H3PO4 (aq)

dS = Sproducts - Sreactants

dS = (4*H3PO4) - (P4O10 + 6*H2O )

dS = (4*158.2 ) - (228.86+ 6*70.0)

dS = -16.06 J/molK

d) NH3 (g) + HCl (g) → NH4Cl (s)

dS = Sproducts - Sreactants

dS = (NH4Cl (s) ) - (NH3 (g) + HCl (g) )

dS = (94.6) - (192.8 + 186.9)

dS = -285.1 J/Kmol

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Which is the most exothermic reaction? A. CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(g)...
Which is the most exothermic reaction? A. CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(g) B. CH4(g) + 2 O2(g) → CO2(g) + 2 H2O(l) C. CO2(g) + 2 H2O(l) → CH4(g) + 2 O2(g) D. CO2(g) + 2 H2O(g) → CH4(g) + 2 O2(g)
Using values from the Appendix of Thermodynamic data, calculate the value of H° for each of...
Using values from the Appendix of Thermodynamic data, calculate the value of H° for each of the following reactions. (a) Fe2O3(s) + 6 HCl(g) 2 FeCl3(s) + 3 H2O(g) H° = kJ (b) 2 H2S(g) + 3 O2 (g) 2 SO2 (g) + 2 H2O(g) H° = kJ (c) NaOH(s) + CO2(g) NaHCO3(s) H° = kJ (d) 4 NH3(g) + O2(g) 2 N2H4(g) + 2 H2O(l) H° = kJ
ΔS is positive for which of the following reactions? A. 2 H2 (g) + O2 (g)...
ΔS is positive for which of the following reactions? A. 2 H2 (g) + O2 (g) --> 2 H2O (l) B. H2O (l) --> H2O (s) C. CO2 (s) --> CO2 (g) D. Ag+ (aq) + Cl- (aq) --> AgCl (s) E. N2 (g) + 3 H2 (g) --> 2 NH3 (g)
Calculate Delta G for the following reactions: Rxn 1: CH4(g) + 2 O2(g) --> CO2(g) +...
Calculate Delta G for the following reactions: Rxn 1: CH4(g) + 2 O2(g) --> CO2(g) + 2 H2O(l) Rxn 2 2 H2 (g) + O2(g) --> 2 H2O(g)
Calculate So values for the following reactions by using tabulated So values from Appendix C. (a)...
Calculate So values for the following reactions by using tabulated So values from Appendix C. (a) H2(g) + F2(g) 2 HF(g) So = -546.6 Incorrect: Your answer is incorrect. J/K (b) 2 CH4(g) C2H6(g) + H2(g) So = -12.3 Incorrect: Your answer is incorrect. J/K (c) CaCO3(s) CaO(s) + CO2(g) So = 160.5 Correct: Your answer is correct. J/K (d) Be(OH)2(s) BeO(s) + H2O(g) So = 156.80 Incorrect: Your answer is incorrect. J/K
Calculate So values for the following reactions by using tabulated So values from Appendix C. (a)...
Calculate So values for the following reactions by using tabulated So values from Appendix C. (a) N2H4(g) + H2(g)--> 2 NH3(g) S = J/K (b) N2O4(g) --> 2 NO2(g) S= ___J/K (c) Be(OH)2(s) --> BeO(s) + H2O(g) deltaS= ___J/K (d) 2 NOCl(g) Æ 2 NO(g) + Cl2(g) delta-S = ___J/K
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
Energy change is measured: CH4(g) + 2 O2 (g) --> CO2 (g) + 2 H2O (l)...
Energy change is measured: CH4(g) + 2 O2 (g) --> CO2 (g) + 2 H2O (l)   ΔH−882.kJ Is the reaction endothermic or exothermic? If 22.8g of CH4 react, will any heat be absorbed or relased? If yes, calculate how much heat will be released or absorbed with correct significant digits.
Using values from Appendix C of your textbook, calculate the value of Keq at 298 K...
Using values from Appendix C of your textbook, calculate the value of Keq at 298 K for each of the following reactions: (a) 2 NH3(g) N2(g) + 3 H2(g) Keq = . (b) 4 HCl(g) + O2(g) 2 Cl2(g) + 2 H2O(g) Keq = . (c) 2 NO(g) N2(g) + O2(g) Keq = .
Use standard free energies of formation to calculate ΔG∘ΔG∘ at 25 ∘C∘C for each of the...
Use standard free energies of formation to calculate ΔG∘ΔG∘ at 25 ∘C∘C for each of the following reactions. Substance ΔG∘f(kJ/mol)ΔGf∘(kJ/mol) H2O(g)H2O(g) −−228.6 H2O(l)H2O(l) −−237.1 NH3(g)NH3(g) −−16.4 NO(g)NO(g) 87.6 CO(g)CO(g) −−137.2 CO2(g)CO2(g) −−394.4 CH4(g)CH4(g) −−50.5 C2H2(g)C2H2(g) 209.9 C2H6(g)C2H6(g) −−32.0 Fe3O4(s)Fe3O4(s) −−1015.4 KClO3(s)KClO3(s) −−296.3 KCl(s)KCl(s) −−408.5 Part A C(s,graphite)+2H2(g)→CH4(g)C(s,graphite)+2H2(g)→CH4(g) Express your answer to one decimal place and include the appropriate units. Part B Fe3O4(s)+4H2(g)→3Fe(s)+4H2O(g)Fe3O4(s)+4H2(g)→3Fe(s)+4H2O(g) Express your answer to one decimal place and include the appropriate units. Part C N2(g)+O2(g)→2NO(g)N2(g)+O2(g)→2NO(g) Express your answer...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT