Question

write the equilibrium constant expression for the reaction if the equilibrium constant is 78

write the equilibrium constant expression for the reaction if the equilibrium constant is 78

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Consider the balanced reversible reaction below

aA+bB⇋cC+dD

if we know the molar concentrations for each reaction species, we can find the value for Kc using the relationship

K C  =[C]c[D]d/ [A]a[B]b

KC= 78

Compare this with the chemical equation for the equilibrium. The convention is that the substances on the right-hand side of the equation are written at the top of the Kc expression, and those on the left-hand side at the bottom.

The relationship between the two equilibrium constants are:

Kp=Kc(RT)^Δn

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Part 1: a) write the ka reaction for HCNO. b) write the equilibrium constant expression for...
Part 1: a) write the ka reaction for HCNO. b) write the equilibrium constant expression for the dissociation of HCNO. c) Construct (don't solve) the ICE chart for the acid dissociation of 0.100 M HCNO. d) what is the pH of a 0.100 M HCNO solution. Part II: a) Write the base dissociation reaction of HONH2. b) write the equilibrium constant expression for the base dissociation of HONH2. c) Construct (don't solve) the ICE chart for the acid dissociation of...
Consider the salt, lead(II) iodate, Pb(IO3)2. Write the equilibrium reaction (with states), and the equilibrium-constant expression...
Consider the salt, lead(II) iodate, Pb(IO3)2. Write the equilibrium reaction (with states), and the equilibrium-constant expression for the Ksp of this slightly soluble salt (including activity coefficients). Why doesn
write the equilibrium constant expression, Kc, for this reaction: NiS(s) > Ni^+2(aq) + S^-2(aq). given that...
write the equilibrium constant expression, Kc, for this reaction: NiS(s) > Ni^+2(aq) + S^-2(aq). given that Ksp=3.0×10^-10
The equilibrium constant expression for a reaction can be written if the balanced equation is known....
The equilibrium constant expression for a reaction can be written if the balanced equation is known. true or False
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g)...
Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4 (g) + 3 O2 (g) ⇌ 2 CO (g) + 4 H2O (g) a. K′c=[CO]2[H2O]4[CH4]2[O2]3 b. K′c=[CH4]2[O2]3[CO]2[H2O]4 c. K′c=2[CO]+4[H2O]2[CH4]+3[O2] d. K′c=2[CH4]+3[O2]2[CO]+4[H2O] Write the equilibrium constant expression for the following reaction in the reverse direction: 2 CH4(g) + 3 O2(g) ⇌ 2 CO(g) + 4 H2O(g) a. Kp′=2[PCH4]+3[PO2]2[PCO]+4[PH2O] b. Kp′=2[PCO]+4[PH2O]2[PCH4]+3[PO2] c. Kp′=[PCO]2[PH2O]4[PCH4]2[PO2]3 d. Kp′=[PCH4]2[PO2]3[PCO]2[PH2O]4 What is the equilibrium equation for the following reaction? C2H4 (g) +...
1.) Write the equilibrium onstant expression for the reaction below (Keq): CH4(g)+2H2S(g) <--> CS2(g)+4H2(g) A reation...
1.) Write the equilibrium onstant expression for the reaction below (Keq): CH4(g)+2H2S(g) <--> CS2(g)+4H2(g) A reation mixture initially contains 0.50M CH4 ad 0.75M H2S. If the equilibrium concenration of H2 is 0.44M, find the equilibrium constatn (Kc) for the reaction. 2.) Express the equilibrium constant for the following reaction. P4(s)+5O2(g) <--> P4O10(s)
Write the expression for the equilibrium constant Kc for each of the following equations: b   FeO(s)...
Write the expression for the equilibrium constant Kc for each of the following equations: b   FeO(s) + CO(g) - Fe(s) + CO2(g) d   PbI2(s) - Pb2 1 (aq) + 2I2(aq)
1: a) Write the equilibrium expression for the following: 2 NOCl (g) = 2 NO (g)...
1: a) Write the equilibrium expression for the following: 2 NOCl (g) = 2 NO (g) + Cl2 (g) b) In the reaction above, the equilibrium concentration of NOCl = [0.0610], NO=[0.0151], Cl2= [0.0142], what is the equilibrium constant? c) The initial concentration of NO2 in a closed container is 0.750 M. At equilibrium, the concentration of O2 is 0.125 M. What are the concentrations of NO2 and NO at equilibrium? 2 NO2 (aq) = 2 NO (aq) + O2...
Write the equilibrium‑constant expression for the reaction A(s)+3B(l)↽−−⇀2C(aq)+D(aq)A(s)+3B(l)↽−−⇀2C(aq)+D(aq) in terms of [A],[A], [B],[B], [C],[C], and [D],[D],...
Write the equilibrium‑constant expression for the reaction A(s)+3B(l)↽−−⇀2C(aq)+D(aq)A(s)+3B(l)↽−−⇀2C(aq)+D(aq) in terms of [A],[A], [B],[B], [C],[C], and [D],[D], as needed. Note that ?c,Kc, which is sometimes symbolized as ?eq,Keq, denotes that the equilibrium constant is expressed using molar concentrations. For this question, ?cKc means the same thing as ?eq.
What is the equilibrium constant expression for the following reaction: C5H5NH(aq) + H2O(l) ⇔ C5H5NH2+(aq) +...
What is the equilibrium constant expression for the following reaction: C5H5NH(aq) + H2O(l) ⇔ C5H5NH2+(aq) + OH-(aq) Choose from the list below and enter the letters in alphabetical order. (e.g. For an equilibrium constant of [OH-]-1eq[H2O]eq enter AH.) A. [H2O]eq B. [C5H5NH]eq C. [C5H5NH2+]eq D. [OH-]eq E. [H2O]-1eq F. [C5H5NH]-1eq G. [C5H5NH2+]-1eq H. [OH-]-1eq
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT