Question

A buffer solution contains 0.15 moles of both HSO4- anion and SO4^2- anion. An aliquot of...

A buffer solution contains 0.15 moles of both HSO4- anion and SO4^2- anion. An aliquot of 0.05 moles of NaOH is added to the buffer solution. What is the new pH of the buffer solution?

The answers are multiple choice and they are 6.66, 7.04, 6.96, 6.74, or 7.26

Homework Answers

Answer #1

given concentrations of HSO4- and SO42- = 0.15 moles

The normal reaction between in a solution is given by

0.15 NA x x are the concentrations corresponding molecules in reaction

by Henderson Hasselbach equation pKa of HSO4- = 1.92

pH of buffer when 0.00 moles of NaOH added is given by

pH = 1.92

when 0.05 moles of NaOH is added then

0.15 0.05 0.15 NA

if we neutralize acid by base then it gets diluted so the concentration of HSO4- becomes 0.15 - 0.05 = 0.10 moles and concentration of SO42- will be increased 0.15 + 0.05 = 0.20 moles therefore

pH = 1.92 - 0.30 = 1.61

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate...
Consider a buffer solution that contains 0.25 M C6H4(CO2H)(CO2K) and 0.15 M C6H4(CO2K)2. pKa(C6H4(CO2H)CO2-)=5.41. a) Calculate its pH & Calculate the change in pH if 0.140 g of solid NaOH is added to 190 mL of this solution. b) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
A buffer solution contains 0.233 M ammonium chloride and 0.321 M ammonia. If 0.0188 moles of...
A buffer solution contains 0.233 M ammonium chloride and 0.321 M ammonia. If 0.0188 moles of perchloric acid are added to 150 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding perchloric acid) pH = A buffer solution contains 0.338 M NaH2PO4 and 0.394 M Na2HPO4. If 0.0497 moles of perchloric acid are added to 225 mL of this buffer, what is the pH of the resulting...
500 mL of a buffer solution contains 0.050 mol NaHSO3 and 0.031 mol Na2SO3. (a) What...
500 mL of a buffer solution contains 0.050 mol NaHSO3 and 0.031 mol Na2SO3. (a) What is the pH of the solution? (b) Write the net ionic equation for the reaction that occurs when NaOH is added to this buffer. (c) Calculate the new pH after 10. mL of 1.0 M NaOH is added to the buffer solution. d) calculate the buffer capacity (f) Calculate the new pH after 10. mL of 1.0 M NaOH is added to 500. mL...
A propionic acid (CH3CH2COOH) buffer is prepared by adding 0.15 moles of propionic acid and 0.10...
A propionic acid (CH3CH2COOH) buffer is prepared by adding 0.15 moles of propionic acid and 0.10 moles of sodium propionate (NaCH3CH2COO) to water to make 1.20 L of solution. The Ka of propionic acid is 1.3 x 10-5.   Then 2.5 mL of 1.00 M KOH is added. What is the new pH?
A buffer solution contains 0.341 M nitrous acid and 0.303 M sodium nitrite. If 0.0573 moles...
A buffer solution contains 0.341 M nitrous acid and 0.303 M sodium nitrite. If 0.0573 moles of nitric acid are added to 250 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding nitric acid) pH =
A buffer solution contains 0.259 M ammonium bromide and 0.394 M ammonia. If 0.0385 moles of...
A buffer solution contains 0.259 M ammonium bromide and 0.394 M ammonia. If 0.0385 moles of hydrochloric acid are added to 250 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume does not change upon adding hydrochloric acid)
A buffer solution contains 0.388 M ammonium bromide and 0.385 M ammonia. If 0.0484 moles of...
A buffer solution contains 0.388 M ammonium bromide and 0.385 M ammonia. If 0.0484 moles of perchloric acid are added to 225 mL of this buffer, what is the pH of the resulting solution? (Assume that the volume does not change upon adding perchloric acid.) pH = Please illustrate with step-by-step answer, thank you.
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274...
PART A A buffer solution contains 0.358 M ammonium chloride and 0.499 M ammonia. If 0.0274 moles of perchloric acid are added to 125 mL of this buffer, what is the pH of the resulting solution ? (Assume that the volume change does not change upon adding perchloric acid) pH = _______ PART B A buffer solution contains 0.328 M nitrous acid and 0.481 M sodium nitrite. If 0.0248 moles of hydrochloric acid are added to 125 mL of this...
Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate...
Consider a buffer solution that contains 0.25 M HCO2H and 0.20 M HCO2Na. pKa(HCO2H)=3.75. 1. Calculate its pH 2. Calculate the change in pH if 0.135 g of solid NaOH is added to 180 mL of this solution. 3. If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.
Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate...
Consider a buffer solution that contains 0.55 M NH2CH2CO2H and 0.35 M NH2CH2CO2Na. pKa(NH2CH2CO2H)=9.88. 1) Calculate its pH 2) Calculate the change in pH if 0.155 g of solid NaOH is added to 250 mL of this solution. 3) If the acceptable buffer range of the solution is ±0.10 pH units, calculate how many moles of H3O+ can be neutralized by 250 mL of the initial buffer.