Question

Complete ionic and net-ionic equation: 1. Fe (s) + 2HCl (aq) -> FeCl2 (aq) + H2...

Complete ionic and net-ionic equation:

1. Fe (s) + 2HCl (aq) -> FeCl2 (aq) + H2 (g)
2. Cu (s) + HCl (aq) -> ???

Homework Answers

Answer #1

1. Fe (s) + 2HCl (aq) -> FeCl2 (aq) + H2 (g)

   Fe(s) +2H^+ (aq) + 2Cl^-(aq) ----------> Fe^2+ (aq) + 2Cl^- (aq) + H2(g)

removal fo spectator ions to get net ionic equation

Fe(s) +2H^+ (aq) ----------> Fe^2+ (aq) + H2(g)

2. Cu (s) + 2HCl (aq) -> CuCl2(aq) + H2(g)

Cu (s) + 2H^+(aq) +2Cl^- (aq) -> Cu^+9aq)+2Cl^-(aq) + H2(g)

removal of spectator ions to get net ionic equation

Cu (s) + 2H^+(aq) -> Cu^+(aq) + H2(g) >>>>No reaction

2. Cu (s) + HCl (aq) -> ??? NO reaction >>>>>answer

Cu does not displacement the H2 from acid . NO reaction takes place.

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7....
Complete equation and net ionic equation for: 1. Mg(s)+2HCl(aq)=MgCl2(aq)+H2 2. 2Fe(s)+6HCl(aq)=2FeCl3(aq)+3H2(g) 3.Fe2Cu(NO3)2=2Cu+Fe(NO3)2 4.Fe+SnCl4=FeCl4+Sn 5.2Mg+2CuSO4=Cu2+2MgSO4 6.3Mg+Fe(NO3)3=3Mg(NO3)+Fe 7. 2Mg+SnCl4=2MgCl2+Sn 8. 2Mg+Zn(NO3)2=2MgNO3+Zn 9. Sn+2Zn(NO3)2=2Zn+Sn(NO3)4 10. Zn+CuSO4+ZnSO4+Cu 11. 2Zn+Fe(NO3)2=Fe+2Zn(NO3) 12. Zn+SnCl4=4ZnCl+Sn
Hydrochloric acid can dissolve solid iron according to the following reaction. Fe(s)+2HCl(aq)→FeCl2(aq)+H2(g) (Part A) What minimum...
Hydrochloric acid can dissolve solid iron according to the following reaction. Fe(s)+2HCl(aq)→FeCl2(aq)+H2(g) (Part A) What minimum mass of HCl in grams would you need to dissolve a 2.7 g iron bar on a padlock? (Part B) How much H2 would be produced by the complete reaction of the iron bar?
For redox reactions Mg + 2HCl --> MgCl2 + H2 and Fe + 2HCl --> FeCl2...
For redox reactions Mg + 2HCl --> MgCl2 + H2 and Fe + 2HCl --> FeCl2 + H2, what is their oxidation half reaction, reduction half reaction, and the minimum number of electrons exchanged in the redox reaction? My subject is Chem 2
Fe(s)+CuSO4(aq)---->FeSO4(aq)+Cu(s) Write ionic equation and net ionic equation. Redox yes or no If Redox: element that...
Fe(s)+CuSO4(aq)---->FeSO4(aq)+Cu(s) Write ionic equation and net ionic equation. Redox yes or no If Redox: element that is oxidized=_____ Element that is reduced=_____ Explain Circle reaction type:combination, decomposition, single replacement, or double replacement.
2 Al(s) + 6 HCl(aq) --> 2 AlCl3(aq) + 3 H2(g) Fe(s) + 2 HCl(aq) -->...
2 Al(s) + 6 HCl(aq) --> 2 AlCl3(aq) + 3 H2(g) Fe(s) + 2 HCl(aq) --> FeCl2(aq) + H2(g) When a 7.007-g sample of a particular iron-aluminum alloy was dissolved in excess hydrochloric acid, 0.4705 g of H2(g) was produced. What was the mass percentage of aluminum in the alloy?
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq)...
1- Write balanced complete ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 2- Write balanced net ionic equation for K2SO4(aq)+CaI2(aq)?CaSO4(s)+KI(aq) 3- Write balanced complete ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 4- Write balanced net ionic equation for NH4Cl(aq)+NaOH(aq)?H2O(l)+NH3(g)+NaCl(aq) 5- Write balanced complete ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 6- Write balanced net ionic equation for AgNO3(aq)+NaCl(aq)?AgCl(s)+NaNO3(aq) 7- Write balanced complete ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) 8- Write balanced net ionic equation for HC2H3O2(aq)+K2CO3(aq)?H2O(l)+CO2(g)+KC2H3O2(aq) (Express your answer as a chemical equation. Identify all of the phases in your answer)
3. Complete and balance the equation, and write the balanced net ionic equation. Na2CO3(aq) + HNO3(aq)...
3. Complete and balance the equation, and write the balanced net ionic equation. Na2CO3(aq) + HNO3(aq) <----> 4. Complete and balance the equation, and write the balanced net ionic equation. NH3(aq) + HCl(aq) <---->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Write the complete equation and net ionic equation for the following: Al(s)+Fe(NO3)3--------------> Al(s)+Cu(NO3)2--------------> Al(s)+Zn(NO3)2--------------> Al(s)+ZnCl4-------------->
Zinc reacts with hydrochloric acid according to the reaction equation Zn(s) + 2HCl(aq) -> ZnCl2(aq) +...
Zinc reacts with hydrochloric acid according to the reaction equation Zn(s) + 2HCl(aq) -> ZnCl2(aq) + H2(g) How many milliliters of 6.50 M HCl(aq) are required to react with 3.05 g of Zn(s)?
write a balanced net ionic equation for the reactions, if any, that occur between (a) ZnS(s)...
write a balanced net ionic equation for the reactions, if any, that occur between (a) ZnS(s) and HCl(aq); (b) K2CO3(aq) and Ca(NO3)2(aq); (c) Fe(NO3)2(aq) and H2S(aq); (d) Bi(OH)3(s) and HNO3(aq). Please show me molecular to complete ionic to net ionic as I need to understand how to do this, not just the answers.
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT