Question

Ascorbic acid has a Ka of 1.5 X 10-5 and acetic acid has a Ka of...

Ascorbic acid has a Ka of 1.5 X 10-5 and acetic acid has a Ka of 1.2 X 10-3 Which of the following is correct? (a) ascorbic acid is a stronger acid than acetic acid

b)acetic acid is a stronger acid than ascorbic acid

c)both acetic acid and ascorbic acids are equally strong acids

d)cannot tell from the information provided which acid is stronger

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

Ascorbic acid is stronger acid than acetic acid.Option( a)

Higher the value of Ka indicates that,stronger the acid.It means that ,acid is largely dissociate into its ions.Lower the ka value,weaker the acid.Ka is the acid dissociation constant.

It is given that Ka of ascorbic acid is 1.5 X 10-5 ,ka of acetic acid is 1.2 X 10-3

Ascorbic acid is stronger acid than acetic acid.

Ka value of ascorbic acid is higher,so it is stronger than acetic acid.Acetic acid is a weak acid.

'
0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
You create a 0.578 M solution of acetic acid (HC2H3O2, Ka = 1.8*10-5). Which of the...
You create a 0.578 M solution of acetic acid (HC2H3O2, Ka = 1.8*10-5). Which of the following represents the correct Ka expression for this reaction? 1.Ka = [HC2H3O2]/([H+][C2H3O2-]) 2.Ka = [H+][C2H3O2-]/[HC2H3O2] 3.Ka = [H+][OH-] Solve for x: you will get two possible values. After, plug both x values back into the original ICE table to determine the appropriate x value. What is the [H+] in molarity at equilibrium? What is the percent ionization for this reaction?
2. If an acid HA has a Ka value of 1.5 x 10-5, what will be...
2. If an acid HA has a Ka value of 1.5 x 10-5, what will be the value of equilibrium constant for the following reaction? Hint: You need to use Rxns 1 and 3 and Eqs 1 and 3 from the Background material. HA(aq) + OH-(aq) ↔ A-(aq) + H2O(l) Will this reaction be reactant favored or product favored? What does this tell you about the “completeness” of the titration reactions used in this laboratory?
1. For each of the following, tell whether the acid is strong or weak. a) Acetic...
1. For each of the following, tell whether the acid is strong or weak. a) Acetic acid b)HCl c) H3PO4 d)H2SO4 e)HCN f)H2CO3 2. Write the formula for the conjugate base of each acid. a) H2SO4 c)HI e)NH4 3. Write the formula for conjugate acid for each base. a) OH- b)NH3 c) CO3^2- 4. For each equilibrium, label the stronger acid, stronger base, weaker acid, weaker base. For which reaction(s) does the position of equilibrium lie toward the right? For...
Acetic acid has a Ka of 1.8×10−5. Three acetic acid/acetate buffer solutions, A, B, and C,...
Acetic acid has a Ka of 1.8×10−5. Three acetic acid/acetate buffer solutions, A, B, and C, were made using varying concentrations: [acetic acid] ten times greater than [acetate], [acetate] ten times greater than [acetic acid], and [acetate]=[acetic acid]. Match each buffer to the expected pH. pH = 3.74 ; pH = 4.74 ; pH = 5.74 Part B: How many grams of dry NH4Cl need to be added to 2.30 L of a 0.600 M solution of ammonia, NH3, to...
Calculate the pH of a 0.39 M CH3COOLi solution. Ka for acetic acid= 1.8 x 10^-5
Calculate the pH of a 0.39 M CH3COOLi solution. Ka for acetic acid= 1.8 x 10^-5
Ascorbic acid has two dissociation constants, Ka1=7.9 x 10-5 and Ka2=1.6 x 10-12. What reactions do...
Ascorbic acid has two dissociation constants, Ka1=7.9 x 10-5 and Ka2=1.6 x 10-12. What reactions do these constants refer to? Why is one of sthem so much larger than the other? Which one should you use to calculate the theoretical pH of a 0.50 M solution of ascorbic acid, and why?
Using the ionization constants for acetic acid (Ka= 1.8 x 10^-5) and ammonia (Kb= 1.8 x10^-5),...
Using the ionization constants for acetic acid (Ka= 1.8 x 10^-5) and ammonia (Kb= 1.8 x10^-5), calculate the expected pH of the above four solutions (0.100 M sodium acetate, ammonium chloride, acetic acid and ammonia). Use the simplified version instead of the quadratic equation.
a) If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the concentration of...
a) If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the concentration of acetic acid in the vinegar. A particular sample of vinegar has a pH of 2.95. b) The acid-dissociation constant for benzoic acid (C6H5COOH) is 6.3×10−5. Calculate the equilibrium concentration of H3O+ in the solution if the initial concentration of C6H5COOH is 6.2×10−2 M . c) Calculate the equilibrium concentration of C6H5COO− in the solution if the initial concentration of C6H5COOH is 6.2×10−2 M ....
The Ka of acetic acid (CH3CO2H) is 1.8 × 10–5. What is the pH of a...
The Ka of acetic acid (CH3CO2H) is 1.8 × 10–5. What is the pH of a solution that is made up by dissolving 0.45 moles of sodium acetate (CH3CO2Na) and 0.250 moles of acetic acid (CH3CO2H) in enough water to make 1 L of solution? 1.80 4.74 5.00 6.12 7.33 4.48
If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the initial concentration of...
If acetic acid is the only acid that vinegar contains (Ka=1.8×10−5), calculate the initial concentration of acetic acid in the vinegar. Express your answer using two significant figures. HC2H3O2 =   M   SubmitMy AnswersGive Up
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT