Question

Calculate ?Hrxn for the following reaction: CH4(g)+4Cl2(g)?CCl4(g)+4HCl(g) Use the following reactions and given ?H?s. C(s)+2H2(g)?CH4(g)?H=?74.6kJC(s)+2Cl2(g)?CCl4(g)?H=?95.7kJH2(g)+Cl2(g)?2HCl(g)?H=?184.6kJ Express...

Calculate ?Hrxn for the following reaction:
CH4(g)+4Cl2(g)?CCl4(g)+4HCl(g)
Use the following reactions and given ?H?s.
C(s)+2H2(g)?CH4(g)?H=?74.6kJC(s)+2Cl2(g)?CCl4(g)?H=?95.7kJH2(g)+Cl2(g)?2HCl(g)?H=?184.6kJ

Express your answer using one decimal place.

?Hrxn =___________kJ

Homework Answers

Answer #1

C(s) + 2H2(g) ------> CH4 delta H = -74.6KJ

CH4-----> C(S) + 2H2 (g) delta H = +74.6 KJ .......1

C(s) + 2Cl2 (g) ------> CCl4 delta H = - 95.7KJ ......2

H2(g) + Cl2 (g) ------> 2HCl(g)   delta H = -184.6KJ ......x2

2H2(g)+2Cl2(g) --------> 4HCl(g)        delta H = - 369.2KJ ........3

adding equation 1,2 & 3

CH4(g) + 4Cl2(g)-------> CCl4(g) + 4HCl(g)

delta H= 74.6 - 95.7KJ - 369.2 KJ = - 390.3KJ

Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
Calculate ΔHrxn for the reaction CH4(g)+4Cl2(g)→CCl4(g)+4HCl(g) Given these reactions and their ΔH′s . C(s)+2H2(g)→CH4(g)ΔH=−74.6kJ C(s)+2Cl2(g)→CCl4(g)ΔH=−95.7kJ H2(g)+Cl2(g)→2HCl(g)ΔH=−184.6kJ...
Calculate ΔHrxn for the reaction CH4(g)+4Cl2(g)→CCl4(g)+4HCl(g) Given these reactions and their ΔH′s . C(s)+2H2(g)→CH4(g)ΔH=−74.6kJ C(s)+2Cl2(g)→CCl4(g)ΔH=−95.7kJ H2(g)+Cl2(g)→2HCl(g)ΔH=−184.6kJ ΔHrxn =
CH4(g)+4Cl2(g) —>CCl4(l) + 4HCl(g) 2.calculate the standard molar enthalpy (delta H ) of the reaction 3.Explain...
CH4(g)+4Cl2(g) —>CCl4(l) + 4HCl(g) 2.calculate the standard molar enthalpy (delta H ) of the reaction 3.Explain if the reaction/process is always spontaneous,never spontaneous,or spontaneous only at high temperatures.(Hint: consider how delta H and deltaS influence delta G and spontaneity with the equation delta G =delta H -T deltaS )
CH4(g)+4Cl2(g) —>CCl4(l) + 4HCl(g) ١.Methane reacts with chlorine gas to produce carbon tetrachloride and hydrogen chloride...
CH4(g)+4Cl2(g) —>CCl4(l) + 4HCl(g) ١.Methane reacts with chlorine gas to produce carbon tetrachloride and hydrogen chloride gas. Calculate the standerd entropy (d s) of the reaction and identify its spontaneity 2.calculate the standard molar enthalpy (delta H ) of the reaction 3.Explain if the reaction/process is always spontaneous,never spontaneous,or spontaneous only at high temperatures.(Hint: consider how delta H and deltaS influence delta G and spontaneity with the equation delta G =delta H -T deltaS )
Hess’s Law b) Calculate the ∆H for the reaction: Ti(s) + 2Cl2 (g) → TiCl4 (l)...
Hess’s Law b) Calculate the ∆H for the reaction: Ti(s) + 2Cl2 (g) → TiCl4 (l) Using the following chemical equations and their respective enthalpy changes: Ti(s) + 2Cl2 (g) → TiCl4 (g) ∆H = -763 kJ TiCl4 (l) → TiCl4 (g) ∆H = 41 kJ b) Calculate the ∆H for the reaction: 2CO(g) + O2 (g) → 2CO2 (g) Using the following chemical equations and their respective enthalpy changes: 2C(s) + O2 (g) → 2CO(g) ∆H = -221.0 kJ...
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn=...
Use the reaction enthalpies below to determine Hrxn for the following reaction: Ca(s)+2H20(l)--Ca(OH)2(s)+H2(g) Given: H2(g)+1/2O2(g)--H20(l) Hrxn= -285kJ Ca(OH)2(s)--CaO(s)+H2O(l) Hrxn= 64kJ 2Ca(s)+O2(g)--2CaO(s) Hrxn= -1270kJ
Use standard free energies of formation to calculate ΔG∘ΔG∘ at 25 ∘C∘C for each of the...
Use standard free energies of formation to calculate ΔG∘ΔG∘ at 25 ∘C∘C for each of the following reactions. Substance ΔG∘f(kJ/mol)ΔGf∘(kJ/mol) H2O(g)H2O(g) −−228.6 H2O(l)H2O(l) −−237.1 NH3(g)NH3(g) −−16.4 NO(g)NO(g) 87.6 CO(g)CO(g) −−137.2 CO2(g)CO2(g) −−394.4 CH4(g)CH4(g) −−50.5 C2H2(g)C2H2(g) 209.9 C2H6(g)C2H6(g) −−32.0 Fe3O4(s)Fe3O4(s) −−1015.4 KClO3(s)KClO3(s) −−296.3 KCl(s)KCl(s) −−408.5 Part A C(s,graphite)+2H2(g)→CH4(g)C(s,graphite)+2H2(g)→CH4(g) Express your answer to one decimal place and include the appropriate units. Part B Fe3O4(s)+4H2(g)→3Fe(s)+4H2O(g)Fe3O4(s)+4H2(g)→3Fe(s)+4H2O(g) Express your answer to one decimal place and include the appropriate units. Part C N2(g)+O2(g)→2NO(g)N2(g)+O2(g)→2NO(g) Express your answer...
Given the standard reaction enthalpies for these two reactions: (1) 2C(s) + 2H2(g) = C2H4(g)...... ΔrH°...
Given the standard reaction enthalpies for these two reactions: (1) 2C(s) + 2H2(g) = C2H4(g)...... ΔrH° = 52.3 kJ/mol (2) 2C(s) + 3H2(g) = C2H6(g)......ΔrH° = -84.7 kJ/mol calculate the standard reaction enthalpy for the reaction: (3) C2H4(g) + H2(g) = C2H6(g)......ΔrH° = ?
Find the ΔH for the reaction below, given the following reactions and subsequent ΔH values: 2HCl(g)...
Find the ΔH for the reaction below, given the following reactions and subsequent ΔH values: 2HCl(g) + 2NaNO 2 (s) → HNO 2 (l) + 2NaCl(s) 1) 2NaCl(s) + H 2 O(l) → 2HCl(g) + Na 2 O(s) ΔH = 507 kJ 2) NO(g) + NO 2 (g) + Na 2 O(s) → 2NaNO 2 (s) ΔH = -427 kJ 3) NO(g) + NO 2 (g) → N 2 O(g) + O 2 (g) ΔH = -43 kJ 4) HNO...
Calculate the value of Delta H for each of the following reactions. 1. CaO(s)+2HCl(g)→CaCl2(s)+H2O(g) Answer has...
Calculate the value of Delta H for each of the following reactions. 1. CaO(s)+2HCl(g)→CaCl2(s)+H2O(g) Answer has 4 significant figures 2. 4FeO(s)+O2(g)→2Fe2O3(s) Answer has four significant figures 3. 2CuO(s)+NO(g)→Cu2O(s)+NO2(g) Answer has three significant figures 4. 4NH3(g)+O2(g)→2N2H4(g)+2H2O(l) Answer has five significant figures
Answer the following questions using the chemical reaction and thermochemical information given below: Cl2(g) + C5H8(g)...
Answer the following questions using the chemical reaction and thermochemical information given below: Cl2(g) + C5H8(g) ⇌ 1C5H6(g) + 2HCl(g) ΔHf° (kJ/mol) S° (J mol-1 K-1) C5H6 139.00 274.47 HCl   -92.31 186.90 Cl2 0.00 223.08 C5H8 36.00 289.66 1. Determine ΔG°rx (in kJ) for this reaction at 1474.8 K. Assume ΔH°f and S° do not vary as a function of temperature. Report your answer to two decimal places 2. Determine the equilibrium constant for this reaction. Report your answer to...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT