Question

We dissolve 10.0 g of each of the following in 800 g of water. In which...

We dissolve 10.0 g of each of the following in 800 g of water. In which solution would the molality of solute be highest?

1.) potassium iodide

2.) ammonium nitrate

3.) rubidium nitrate

4.) All would be the same.

5.) sodium iodide

Science   Chemistry   
0 0
Add a commentTranscribed image text
Next >

Homework Answers

Answer #1

0 0
Know the answer?
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for?
Ask your own homework help question
Similar Questions
A.) Pick an appropriate solvent to dissolve acetic acid (polar, contains an OH group) . Water...
A.) Pick an appropriate solvent to dissolve acetic acid (polar, contains an OH group) . Water (H2O) Acetone (CH3COCH3) Methanol (CH3OH) Ethanol (CH3CH2OH) Hexane (C6H14) Diethyl ether (CH3CH2OCH2CH3) Toluene (C7H8) Carbon tetrachloride (CCl4) B.) State the kind of intermolecular forces that would occur between the solute and solvent in acetic acid (polar, contains an OH group) solution. Dispersion Hydrogen bonding Ion-dipole Dipole-dipole C.) Pick an appropriate solvent to dissolve sodium chloride (ionic). (Same answer choices as Part A) D.) State...
For each, provide a.type of reaction, b. Molecular equation (balanced), c.Net ionic equation. 1. Mercury(II) oxide...
For each, provide a.type of reaction, b. Molecular equation (balanced), c.Net ionic equation. 1. Mercury(II) oxide and heat 2. Iron and oxygen (O2) 3. Water And sodium 4. potassium carbonate solution and calcium nitrate solution 5. silver nitrate solution and sodium chloride solution 6. Ammonium chloride solution and sodium sulfate solution 7. Potassium iodide solution and lead (II) nitrate solution 8. Sodium carbonate solution and hydrochloric acid 9. Potassium carbonate solution and acetic acid solution 10. Solid sodium bicarbonate and...
Write a balanced chemical equation for each of these reactions. Remember to write the phase after...
Write a balanced chemical equation for each of these reactions. Remember to write the phase after each reactant and product (g,l,s,aq) 1. Mercury(II) nitrate + potassium iodide 2. Aluminum nitrate + potassium iodide 3. Mercury (II) nitrate + sodium phosphate 4. Aluminum nitrate + sodium phosphate 5. HCl + sodium bicarbonate
Each question is and was separated by an asterisk. *The freezing point of water is 0.00°C...
Each question is and was separated by an asterisk. *The freezing point of water is 0.00°C at 1 atmosphere.   If 14.18 grams of cobalt(II) bromide, (218.7 g/mol), are dissolved in 271.6 grams of water ... The molality of the solution is  m. The freezing point of the solution is  °C. *The freezing point of water H2O is 0.00°C at 1 atmosphere. How many grams of sodium nitrate (85.00 g/mol), must be dissolved in 249.0 grams of water to reduce the freezing point...
Predict what would be observed (and why) from an aqueous mixture for each of the following...
Predict what would be observed (and why) from an aqueous mixture for each of the following (all substance are water soluble). a) potassium carbornate and hydrochloric acid b) zinc chloride and silver nitrate c) magnesium chloride and sodium hydroxide d) ammonium nitrate and sodium hydroxide
1. Which of the following aqueous solutions are good buffer systems? 0.24 M hydrobromic acid +...
1. Which of the following aqueous solutions are good buffer systems? 0.24 M hydrobromic acid + 0.21 M potassium bromide 0.33 M ammonium bromide + 0.37 M ammonia 0.39 M hydrocyanic acid + 0.23 M potassium cyanide 0.14 M acetic acid + 0.21 M sodium acetate 0.15 M sodium fluoride + 0.23 M hydrofluoric acid 2. Which of the following aqueous solutions are good buffer systems? 0.34 M ammonia + 0.34 M ammonium nitrate 0.16 M barium hydroxide + 0.23...
Which of the following pairs of ionic compounds are BOTH expected to be insoluble in water?...
Which of the following pairs of ionic compounds are BOTH expected to be insoluble in water? sodium acetate; calcium sulfate silver nitrate; silver chloride     silver chloride; barium sulfate magnesium chloride; potassium sulfate A solution is prepared by dissolving 4.68 g of NaCl in enough water to produce 40.0 mL of solution. What is the molarity of NaCl for the solution?   
If I dissolve 0.500 g of sodium butanate, NaC3H7COO, MM = 110.1 g/mol, in water to...
If I dissolve 0.500 g of sodium butanate, NaC3H7COO, MM = 110.1 g/mol, in water to make a solution with a final volume of 250.0 mL, what will be the pH of this solution? I started out with finding the concentration of sodium butanate using .500 g and the MM .500g/110.2g/mol = .0182 M Ka of butanoic acid, C3H7COOH, is 1.77x10-4 I then proceeded to equate that Ka value to the [H3O+][C3H7COOH]/[NaC3H7COO] Did I set this up correctly? If not,...
For each of the following aqueous mixtures, determine which ionic concentrations decrease and which remain the...
For each of the following aqueous mixtures, determine which ionic concentrations decrease and which remain the same. a. Sodium chloride and iron(II) chloride are dissolved in 100 mL water. b. Equimolar amounts of sodium carbonate and sulfuric acid react. c. Potassium sulfate and barium nitrate are dissolved in 100 mL water.
Pick an appropriate solvent from the table below to dissolve each substance. State the kind of...
Pick an appropriate solvent from the table below to dissolve each substance. State the kind of intermolecular forces that would occur between the solute and solvent in each case. Common polar solvents Common nonpolar solvents Water (H2O) Hexane (C6H14) Acetone (CH3COCH3) Diethyl ether (CH3CH2OCH2CH3) Methanol (CH3OH) Toluene (C7H8) Ethanol (CH3CH2OH) Carbon tetrachloride (CCl4) #1 State the kind of intermolecular forces that would occur between the solute and solvent in barium nitrate (ionic). Check all that apply. (hydrogen bonding) (ion-dipole) (dipole-dipole)...
ADVERTISEMENT
Need Online Homework Help?

Get Answers For Free
Most questions answered within 1 hours.

Ask a Question
ADVERTISEMENT